Merge branch 'master' of https://github.com/photonstorm/phaser

CHANGELOG-v3.60.md

@@ -70,6 +70,9 @@ Development of this feature was kindly sponsored by Club Penguin Rewritten (http
 * `Math.LinearXY` is a new function that will interpolate between 2 given Vector2s and return a new Vector2 as a result (thanks @GregDevProjects)
 * `Curves.Path.getCurveAt` is a new method that will return the curve that forms the path at the given location (thanks @natureofcode)
 * You can now use any `Shape` Game Object as a Geometry Mask. Fix #5900 (thanks @rexrainbow)
+* `Mesh.setTint` is a new method that will set the tint color across all vertices of a Mesh (thanks @rexrainbow)
+* `Mesh.tint` is a new setter that will  set the tint color across all vertices of a Mesh (thanks @rexrainbow)
+* `Mesh.clearTint` is a new method that will clear the tint from all vertices of a Mesh (thanks @rexrainbow)
 
 ### Geom Updates
 
@@ -117,6 +120,9 @@ The following are API-breaking, in that a new optional parameter has been insert
 * `TileMap.createStaticLayer` has now been removed as it was deprecated in 3.50.
 * `Animations.AnimationManager.createFromAseprite` has a new optional 3rd parameter `target`. This allows you to create the animations directly on a Sprite, instead of in the global Animation Manager (thanks Telemako)
 * `Animations.AnimationState.createFromAseprite` is a new method that allows you to create animations from exported Aseprite data directly on a Sprite, rather than always in the global Animation Manager (thanks Telemako)
+* The `path` package used by the TS Defs generator has been moved to `devDependencies` (thanks @antkhnvsk)
+* The `GetValue` function has a new optional parameter `altSource` which allows you to provide an alternative object to source the value from.
+* The `Renderer.Snapshot.WebGL` function has had its first parameter changed from an `HTMLCanvasElement` to a `WebGLRenderingContext`. This is now passed in from the `snapshot` methods inside the WebGL Renderer. The change was made to allow it to work with WebGL2 custom contexts (thanks @andymikulski)
 
 ### Bug Fixes
 
@@ -165,9 +171,24 @@ The following are API-breaking, in that a new optional parameter has been insert
 * `InputPlugin.disable` will now also reset the drag state of the Game Object as well as remove it from all of the internal temporary arrays. This fixes issues where if you disabled a Game Object for input during an input event it would still remain in the temporary internal arrays. This method now also returns the Input Plugin, to match `enable`. Fix #5828 (thank @natureofcode @thewaver)
 * The `GetBounds` component has been removed from the Point Light Game Object. Fix #5934 (thanks @x-wk @samme)
 * `SceneManager.moveAbove` and `moveBelow` now take into account the modified indexes after the move (thanks @EmilSV)
+* When forcing a game to use `setTimeout` and then sending the game to sleep, it would accidentally restart by using Request Animation Frame instead (thanks @andymikulski)
+* Including a `render` object within the Game Config will no longer erase any top-level config render settings. The `render` object will now take priority over the game config, but both will be used (thanks @vzhou842)
+* Calling `Tween.stop(0)` would run for an additional delta before stopping, causing the Tween to not be truly 100% "reset". Fix #5986 (thanks @Mesonyx)
+* The `Utils.Array.SafeRange` function would exclude valid certain ranges. Fix #5979 (thanks @ksritharan)
+* The "Skip intersects check by argument" change in Arcade Physics has been reverted. Fix #5956 (thanks @samme)
+* The `Container.pointToContainer` method would ignore the provided `output` parameter, but now uses it (thanks @vforsh)
+* The `Polygon` Game Object would ignore its `closePath` property when rendering in Canvas. Fix #5983 (thanks @optimumsuave)
+* IE9 Fix: Added 2 missing Typed Array polyfills (thanks @jcyuan)
+* IE9 Fix: CanvasRenderer ignores frames with zero dimensions (thanks @jcyuan)
+* `RenderTexture.batchTextureFrame` will now skip the `drawImage` call in canvas if the frame width or height are zero. Fix #5951 (thanks @Hoshinokoe)
+* `BlitterCanvasRenderer` will now skip the `drawImage` call in canvas if the frame width or height are zero.
+* `ParticleManagerCanvasRenderer` will now skip the `drawImage` call in canvas if the frame width or height are zero.
+* `CanvasSnapshot` will now skip the `drawImage` call in canvas if the frame width or height are zero.
+* `TextureManager.getBase64` will now skip the `drawImage` call in canvas if the frame width or height are zero.
+* `TilemapLayerCanvasRenderer` will now skip the `drawImage` call in canvas if the frame width or height are zero.
 
 ### Examples, Documentation and TypeScript
 
 My thanks to the following for helping with the Phaser 3 Examples, Docs, and TypeScript definitions, either by reporting errors, fixing them, or helping author the docs:
 
-@necrokot Golen @Pythux @samme @danfoster @eltociear @sylvainpolletvillard @hanzooo @etherealmachine @DeweyHur @twoco @austinlyon @Arcanorum OmniOwl @EsteFilipe
+@necrokot Golen @Pythux @samme @danfoster @eltociear @sylvainpolletvillard @hanzooo @etherealmachine @DeweyHur @twoco @austinlyon @Arcanorum OmniOwl @EsteFilipe @PhaserEditor2D @Fake 

package.json

@@ -64,27 +64,28 @@
     "web audio"
   ],
   "devDependencies": {
+    "@types/offscreencanvas": "^2019.6.4",
     "@types/source-map": "^0.5.7",
     "clean-webpack-plugin": "^4.0.0",
     "dts-dom": "^3.6.0",
-    "eslint": "^8.4.1",
+    "eslint": "^8.8.0",
     "eslint-plugin-es5": "^1.5.0",
     "exports-loader": "^3.1.0",
     "fs-extra": "^10.0.0",
     "imports-loader": "^3.1.1",
-    "jsdoc": "^3.6.7",
+    "jsdoc": "^3.6.10",
     "node-sloc": "^0.2.1",
+    "path": "^0.12.7",
     "remove-files-webpack-plugin": "^1.5.0",
     "source-map": "^0.7.3",
-    "terser-webpack-plugin": "^5.2.5",
-    "typescript": "^4.5.4",
+    "terser-webpack-plugin": "^5.3.1",
+    "typescript": "^4.5.5",
     "vivid-cli": "^1.1.2",
-    "webpack": "^5.65.0",
-    "webpack-cli": "^4.9.1",
+    "webpack": "^5.68.0",
+    "webpack-cli": "^4.9.2",
     "webpack-shell-plugin": "^0.5.0"
   },
   "dependencies": {
-    "eventemitter3": "^4.0.7",
-    "path": "^0.12.7"
+    "eventemitter3": "^4.0.7"
   }
 }

plugins/spine/README.md

@@ -2,10 +2,11 @@
 
 1. Checkout the Esoteric Spine Runtimes repo to the `spine-runtimes` folder: https://github.com/EsotericSoftware/spine-runtimes/ and make sure this is in the `plugins/spine` folder, not the `plugins/spine/src` folder.
 2. Run `npm i` inside the `spine-runtimes` folder.
-3. Add the `source-map` module: `npm i --save-dev source-map`.
-4. Run `npm run plugin.spine.runtimes` to build the new runtimes to the `plugins/spine/src/runtimes` folder.
+3. Add the `offscreencanvas` module: `npm i --save-dev @types/offscreencanvas`.
+4. Add the `source-map` module: `npm i --save-dev source-map`.
+5. Run `npm run plugin.spine.runtimes` to build the new runtimes to the `plugins/spine/src/runtimes` folder.
 
 You can now build a new version of the Spine Plugin:
 
-5. `npm run plugin.spine.dist`.
+6. `npm run plugin.spine.dist`.
 

plugins/spine/src/runtimes/spine-both.d.ts

@@ -1,3 +1,4 @@
+/// <reference types="offscreencanvas" />
 declare module spine {
     class Animation {
         name: string;
@@ -1402,7 +1403,7 @@ declare module spine.webgl {
         static DISABLE_UNPACK_PREMULTIPLIED_ALPHA_WEBGL: boolean;
         constructor(context: ManagedWebGLRenderingContext | WebGLRenderingContext, image: HTMLImageElement | ImageBitmap, useMipMaps?: boolean);
         setFilters(minFilter: TextureFilter, magFilter: TextureFilter): void;
-        static validateMagFilter(magFilter: TextureFilter): TextureFilter.Nearest | TextureFilter.Linear | TextureFilter.Linear;
+        static validateMagFilter(magFilter: TextureFilter): TextureFilter.Nearest | TextureFilter.Linear;
         setWraps(uWrap: TextureWrap, vWrap: TextureWrap): void;
         update(useMipMaps: boolean): void;
         restore(): void;

plugins/spine/src/runtimes/spine-both.js

@@ -6,6 +6,8 @@ var __extends = (this && this.__extends) || (function () {
         return extendStatics(d, b);
     };
     return function (d, b) {
+        if (typeof b !== "function" && b !== null)
+            throw new TypeError("Class extends value " + String(b) + " is not a constructor or null");
         extendStatics(d, b);
         function __() { this.constructor = d; }
         d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
@@ -2239,9 +2241,9 @@ var spine;
                 _this.toLoad--;
                 _this.loaded++;
             }, function (state, responseText) {
-                _this.errors[path] = "Couldn't load binary " + path + ": status " + status + ", " + responseText;
+                _this.errors[path] = "Couldn't load binary ".concat(path, ": status ").concat(status, ", ").concat(responseText);
                 if (error)
-                    error(path, "Couldn't load binary " + path + ": status " + status + ", " + responseText);
+                    error(path, "Couldn't load binary ".concat(path, ": status ").concat(status, ", ").concat(responseText));
                 _this.toLoad--;
                 _this.loaded++;
             });
@@ -2259,9 +2261,9 @@ var spine;
                 _this.toLoad--;
                 _this.loaded++;
             }, function (state, responseText) {
-                _this.errors[path] = "Couldn't load text " + path + ": status " + status + ", " + responseText;
+                _this.errors[path] = "Couldn't load text ".concat(path, ": status ").concat(status, ", ").concat(responseText);
                 if (error)
-                    error(path, "Couldn't load text " + path + ": status " + status + ", " + responseText);
+                    error(path, "Couldn't load text ".concat(path, ": status ").concat(status, ", ").concat(responseText));
                 _this.toLoad--;
                 _this.loaded++;
             });
@@ -2284,11 +2286,11 @@ var spine;
                     success(path, img);
             };
             img.onerror = function (ev) {
-                _this.errors[path] = "Couldn't load image " + path;
+                _this.errors[path] = "Couldn't load image ".concat(path);
                 _this.toLoad--;
                 _this.loaded++;
                 if (error)
-                    error(path, "Couldn't load image " + path);
+                    error(path, "Couldn't load image ".concat(path));
             };
             if (this.rawDataUris[path])
                 path = this.rawDataUris[path];
@@ -2315,9 +2317,9 @@ var spine;
                 }
                 catch (e) {
                     var ex = e;
-                    _this.errors[path] = "Couldn't load texture atlas " + path + ": " + ex.message;
+                    _this.errors[path] = "Couldn't load texture atlas ".concat(path, ": ").concat(ex.message);
                     if (error)
-                        error(path, "Couldn't load texture atlas " + path + ": " + ex.message);
+                        error(path, "Couldn't load texture atlas ".concat(path, ": ").concat(ex.message));
                     _this.toLoad--;
                     _this.loaded++;
                     return;
@@ -2340,17 +2342,17 @@ var spine;
                                 }
                                 catch (e) {
                                     var ex = e;
-                                    _this.errors[path] = "Couldn't load texture atlas " + path + ": " + ex.message;
+                                    _this.errors[path] = "Couldn't load texture atlas ".concat(path, ": ").concat(ex.message);
                                     if (error)
-                                        error(path, "Couldn't load texture atlas " + path + ": " + ex.message);
+                                        error(path, "Couldn't load texture atlas ".concat(path, ": ").concat(ex.message));
                                     _this.toLoad--;
                                     _this.loaded++;
                                 }
                             }
                             else {
-                                _this.errors[path] = "Couldn't load texture atlas page " + imagePath + "} of atlas " + path;
+                                _this.errors[path] = "Couldn't load texture atlas page ".concat(imagePath, "} of atlas ").concat(path);
                                 if (error)
-                                    error(path, "Couldn't load texture atlas page " + imagePath + " of atlas " + path);
+                                    error(path, "Couldn't load texture atlas page ".concat(imagePath, " of atlas ").concat(path));
                                 _this.toLoad--;
                                 _this.loaded++;
                             }
@@ -2359,9 +2361,9 @@ var spine;
                         pageLoadError = true;
                         pagesLoaded.count++;
                         if (pagesLoaded.count == atlasPages.length) {
-                            _this.errors[path] = "Couldn't load texture atlas page " + imagePath + "} of atlas " + path;
+                            _this.errors[path] = "Couldn't load texture atlas page ".concat(imagePath, "} of atlas ").concat(path);
                             if (error)
-                                error(path, "Couldn't load texture atlas page " + imagePath + " of atlas " + path);
+                                error(path, "Couldn't load texture atlas page ".concat(imagePath, " of atlas ").concat(path));
                             _this.toLoad--;
                             _this.loaded++;
                         }
@@ -2372,9 +2374,9 @@ var spine;
                     _loop_1(atlasPage);
                 }
             }, function (state, responseText) {
-                _this.errors[path] = "Couldn't load texture atlas " + path + ": status " + status + ", " + responseText;
+                _this.errors[path] = "Couldn't load texture atlas ".concat(path, ": status ").concat(status, ", ").concat(responseText);
                 if (error)
-                    error(path, "Couldn't load texture atlas " + path + ": status " + status + ", " + responseText);
+                    error(path, "Couldn't load texture atlas ".concat(path, ": status ").concat(status, ", ").concat(responseText));
                 _this.toLoad--;
                 _this.loaded++;
             });
@@ -3540,7 +3542,7 @@ var spine;
                         _this.rawAssets[path] = request.responseText;
                     }
                     else {
-                        _this.errors[path] = "Couldn't load text " + path + ": status " + request.status + ", " + request.responseText;
+                        _this.errors[path] = "Couldn't load text ".concat(path, ": status ").concat(request.status, ", ").concat(request.responseText);
                     }
                 }
             };
@@ -3560,7 +3562,7 @@ var spine;
                         _this.rawAssets[path] = JSON.parse(request.responseText);
                     }
                     else {
-                        _this.errors[path] = "Couldn't load text " + path + ": status " + request.status + ", " + request.responseText;
+                        _this.errors[path] = "Couldn't load text ".concat(path, ": status ").concat(request.status, ", ").concat(request.responseText);
                     }
                 }
             };
@@ -3597,7 +3599,7 @@ var spine;
                     _this.rawAssets[path] = img_1;
                 };
                 img_1.onerror = function (ev) {
-                    _this.errors[path] = "Couldn't load image " + path;
+                    _this.errors[path] = "Couldn't load image ".concat(path);
                 };
                 img_1.src = path;
             }
@@ -6251,7 +6253,7 @@ var spine;
                 return spine.BlendMode.Multiply;
             if (str == "screen")
                 return spine.BlendMode.Screen;
-            throw new Error("Unknown blend mode: " + str);
+            throw new Error("Unknown blend mode: ".concat(str));
         };
         SkeletonJson.positionModeFromString = function (str) {
             str = str.toLowerCase();
@@ -6259,7 +6261,7 @@ var spine;
                 return spine.PositionMode.Fixed;
             if (str == "percent")
                 return spine.PositionMode.Percent;
-            throw new Error("Unknown position mode: " + str);
+            throw new Error("Unknown position mode: ".concat(str));
         };
         SkeletonJson.spacingModeFromString = function (str) {
             str = str.toLowerCase();
@@ -6269,7 +6271,7 @@ var spine;
                 return spine.SpacingMode.Fixed;
             if (str == "percent")
                 return spine.SpacingMode.Percent;
-            throw new Error("Unknown position mode: " + str);
+            throw new Error("Unknown position mode: ".concat(str));
         };
         SkeletonJson.rotateModeFromString = function (str) {
             str = str.toLowerCase();
@@ -6279,7 +6281,7 @@ var spine;
                 return spine.RotateMode.Chain;
             if (str == "chainscale")
                 return spine.RotateMode.ChainScale;
-            throw new Error("Unknown rotate mode: " + str);
+            throw new Error("Unknown rotate mode: ".concat(str));
         };
         SkeletonJson.transformModeFromString = function (str) {
             str = str.toLowerCase();
@@ -6293,7 +6295,7 @@ var spine;
                 return spine.TransformMode.NoScale;
             if (str == "noscaleorreflection")
                 return spine.TransformMode.NoScaleOrReflection;
-            throw new Error("Unknown transform mode: " + str);
+            throw new Error("Unknown transform mode: ".concat(str));
         };
         return SkeletonJson;
     }());
@@ -6558,7 +6560,7 @@ var spine;
                 case "mipmaplinearnearest": return TextureFilter.MipMapLinearNearest;
                 case "mipmapnearestlinear": return TextureFilter.MipMapNearestLinear;
                 case "mipmaplinearlinear": return TextureFilter.MipMapLinearLinear;
-                default: throw new Error("Unknown texture filter " + text);
+                default: throw new Error("Unknown texture filter ".concat(text));
             }
         };
         Texture.wrapFromString = function (text) {
@@ -6566,7 +6568,7 @@ var spine;
                 case "mirroredtepeat": return TextureWrap.MirroredRepeat;
                 case "clamptoedge": return TextureWrap.ClampToEdge;
                 case "repeat": return TextureWrap.Repeat;
-                default: throw new Error("Unknown texture wrap " + text);
+                default: throw new Error("Unknown texture wrap ".concat(text));
             }
         };
         return Texture;
@@ -9796,14 +9798,14 @@ var spine;
                 var gl = this.context.gl;
                 var location = gl.getUniformLocation(this.program, uniform);
                 if (!location && !gl.isContextLost())
-                    throw new Error("Couldn't find location for uniform " + uniform);
+                    throw new Error("Couldn't find location for uniform ".concat(uniform));
                 return location;
             };
             Shader.prototype.getAttributeLocation = function (attribute) {
                 var gl = this.context.gl;
                 var location = gl.getAttribLocation(this.program, attribute);
                 if (location == -1 && !gl.isContextLost())
-                    throw new Error("Couldn't find location for attribute " + attribute);
+                    throw new Error("Couldn't find location for attribute ".concat(attribute));
                 return location;
             };
             Shader.prototype.dispose = function () {
@@ -9823,17 +9825,17 @@ var spine;
                 }
             };
             Shader.newColoredTextured = function (context) {
-                var vs = "\n\t\t\t\tattribute vec4 " + Shader.POSITION + ";\n\t\t\t\tattribute vec4 " + Shader.COLOR + ";\n\t\t\t\tattribute vec2 " + Shader.TEXCOORDS + ";\n\t\t\t\tuniform mat4 " + Shader.MVP_MATRIX + ";\n\t\t\t\tvarying vec4 v_color;\n\t\t\t\tvarying vec2 v_texCoords;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tv_color = " + Shader.COLOR + ";\n\t\t\t\t\tv_texCoords = " + Shader.TEXCOORDS + ";\n\t\t\t\t\tgl_Position = " + Shader.MVP_MATRIX + " * " + Shader.POSITION + ";\n\t\t\t\t}\n\t\t\t";
+                var vs = "\n\t\t\t\tattribute vec4 ".concat(Shader.POSITION, ";\n\t\t\t\tattribute vec4 ").concat(Shader.COLOR, ";\n\t\t\t\tattribute vec2 ").concat(Shader.TEXCOORDS, ";\n\t\t\t\tuniform mat4 ").concat(Shader.MVP_MATRIX, ";\n\t\t\t\tvarying vec4 v_color;\n\t\t\t\tvarying vec2 v_texCoords;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tv_color = ").concat(Shader.COLOR, ";\n\t\t\t\t\tv_texCoords = ").concat(Shader.TEXCOORDS, ";\n\t\t\t\t\tgl_Position = ").concat(Shader.MVP_MATRIX, " * ").concat(Shader.POSITION, ";\n\t\t\t\t}\n\t\t\t");
                 var fs = "\n\t\t\t\t#ifdef GL_ES\n\t\t\t\t\t#define LOWP lowp\n\t\t\t\t\tprecision mediump float;\n\t\t\t\t#else\n\t\t\t\t\t#define LOWP\n\t\t\t\t#endif\n\t\t\t\tvarying LOWP vec4 v_color;\n\t\t\t\tvarying vec2 v_texCoords;\n\t\t\t\tuniform sampler2D u_texture;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tgl_FragColor = v_color * texture2D(u_texture, v_texCoords);\n\t\t\t\t}\n\t\t\t";
                 return new Shader(context, vs, fs);
             };
             Shader.newTwoColoredTextured = function (context) {
-                var vs = "\n\t\t\t\tattribute vec4 " + Shader.POSITION + ";\n\t\t\t\tattribute vec4 " + Shader.COLOR + ";\n\t\t\t\tattribute vec4 " + Shader.COLOR2 + ";\n\t\t\t\tattribute vec2 " + Shader.TEXCOORDS + ";\n\t\t\t\tuniform mat4 " + Shader.MVP_MATRIX + ";\n\t\t\t\tvarying vec4 v_light;\n\t\t\t\tvarying vec4 v_dark;\n\t\t\t\tvarying vec2 v_texCoords;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tv_light = " + Shader.COLOR + ";\n\t\t\t\t\tv_dark = " + Shader.COLOR2 + ";\n\t\t\t\t\tv_texCoords = " + Shader.TEXCOORDS + ";\n\t\t\t\t\tgl_Position = " + Shader.MVP_MATRIX + " * " + Shader.POSITION + ";\n\t\t\t\t}\n\t\t\t";
+                var vs = "\n\t\t\t\tattribute vec4 ".concat(Shader.POSITION, ";\n\t\t\t\tattribute vec4 ").concat(Shader.COLOR, ";\n\t\t\t\tattribute vec4 ").concat(Shader.COLOR2, ";\n\t\t\t\tattribute vec2 ").concat(Shader.TEXCOORDS, ";\n\t\t\t\tuniform mat4 ").concat(Shader.MVP_MATRIX, ";\n\t\t\t\tvarying vec4 v_light;\n\t\t\t\tvarying vec4 v_dark;\n\t\t\t\tvarying vec2 v_texCoords;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tv_light = ").concat(Shader.COLOR, ";\n\t\t\t\t\tv_dark = ").concat(Shader.COLOR2, ";\n\t\t\t\t\tv_texCoords = ").concat(Shader.TEXCOORDS, ";\n\t\t\t\t\tgl_Position = ").concat(Shader.MVP_MATRIX, " * ").concat(Shader.POSITION, ";\n\t\t\t\t}\n\t\t\t");
                 var fs = "\n\t\t\t\t#ifdef GL_ES\n\t\t\t\t\t#define LOWP lowp\n\t\t\t\t\tprecision mediump float;\n\t\t\t\t#else\n\t\t\t\t\t#define LOWP\n\t\t\t\t#endif\n\t\t\t\tvarying LOWP vec4 v_light;\n\t\t\t\tvarying LOWP vec4 v_dark;\n\t\t\t\tvarying vec2 v_texCoords;\n\t\t\t\tuniform sampler2D u_texture;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tvec4 texColor = texture2D(u_texture, v_texCoords);\n\t\t\t\t\tgl_FragColor.a = texColor.a * v_light.a;\n\t\t\t\t\tgl_FragColor.rgb = ((texColor.a - 1.0) * v_dark.a + 1.0 - texColor.rgb) * v_dark.rgb + texColor.rgb * v_light.rgb;\n\t\t\t\t}\n\t\t\t";
                 return new Shader(context, vs, fs);
             };
             Shader.newColored = function (context) {
-                var vs = "\n\t\t\t\tattribute vec4 " + Shader.POSITION + ";\n\t\t\t\tattribute vec4 " + Shader.COLOR + ";\n\t\t\t\tuniform mat4 " + Shader.MVP_MATRIX + ";\n\t\t\t\tvarying vec4 v_color;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tv_color = " + Shader.COLOR + ";\n\t\t\t\t\tgl_Position = " + Shader.MVP_MATRIX + " * " + Shader.POSITION + ";\n\t\t\t\t}\n\t\t\t";
+                var vs = "\n\t\t\t\tattribute vec4 ".concat(Shader.POSITION, ";\n\t\t\t\tattribute vec4 ").concat(Shader.COLOR, ";\n\t\t\t\tuniform mat4 ").concat(Shader.MVP_MATRIX, ";\n\t\t\t\tvarying vec4 v_color;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tv_color = ").concat(Shader.COLOR, ";\n\t\t\t\t\tgl_Position = ").concat(Shader.MVP_MATRIX, " * ").concat(Shader.POSITION, ";\n\t\t\t\t}\n\t\t\t");
                 var fs = "\n\t\t\t\t#ifdef GL_ES\n\t\t\t\t\t#define LOWP lowp\n\t\t\t\t\tprecision mediump float;\n\t\t\t\t#else\n\t\t\t\t\t#define LOWP\n\t\t\t\t#endif\n\t\t\t\tvarying LOWP vec4 v_color;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tgl_FragColor = v_color;\n\t\t\t\t}\n\t\t\t";
                 return new Shader(context, vs, fs);
             };

plugins/spine/src/runtimes/spine-canvas.js

@@ -6,6 +6,8 @@ var __extends = (this && this.__extends) || (function () {
         return extendStatics(d, b);
     };
     return function (d, b) {
+        if (typeof b !== "function" && b !== null)
+            throw new TypeError("Class extends value " + String(b) + " is not a constructor or null");
         extendStatics(d, b);
         function __() { this.constructor = d; }
         d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
@@ -2239,9 +2241,9 @@ var spine;
                 _this.toLoad--;
                 _this.loaded++;
             }, function (state, responseText) {
-                _this.errors[path] = "Couldn't load binary " + path + ": status " + status + ", " + responseText;
+                _this.errors[path] = "Couldn't load binary ".concat(path, ": status ").concat(status, ", ").concat(responseText);
                 if (error)
-                    error(path, "Couldn't load binary " + path + ": status " + status + ", " + responseText);
+                    error(path, "Couldn't load binary ".concat(path, ": status ").concat(status, ", ").concat(responseText));
                 _this.toLoad--;
                 _this.loaded++;
             });
@@ -2259,9 +2261,9 @@ var spine;
                 _this.toLoad--;
                 _this.loaded++;
             }, function (state, responseText) {
-                _this.errors[path] = "Couldn't load text " + path + ": status " + status + ", " + responseText;
+                _this.errors[path] = "Couldn't load text ".concat(path, ": status ").concat(status, ", ").concat(responseText);
                 if (error)
-                    error(path, "Couldn't load text " + path + ": status " + status + ", " + responseText);
+                    error(path, "Couldn't load text ".concat(path, ": status ").concat(status, ", ").concat(responseText));
                 _this.toLoad--;
                 _this.loaded++;
             });
@@ -2284,11 +2286,11 @@ var spine;
                     success(path, img);
             };
             img.onerror = function (ev) {
-                _this.errors[path] = "Couldn't load image " + path;
+                _this.errors[path] = "Couldn't load image ".concat(path);
                 _this.toLoad--;
                 _this.loaded++;
                 if (error)
-                    error(path, "Couldn't load image " + path);
+                    error(path, "Couldn't load image ".concat(path));
             };
             if (this.rawDataUris[path])
                 path = this.rawDataUris[path];
@@ -2315,9 +2317,9 @@ var spine;
                 }
                 catch (e) {
                     var ex = e;
-                    _this.errors[path] = "Couldn't load texture atlas " + path + ": " + ex.message;
+                    _this.errors[path] = "Couldn't load texture atlas ".concat(path, ": ").concat(ex.message);
                     if (error)
-                        error(path, "Couldn't load texture atlas " + path + ": " + ex.message);
+                        error(path, "Couldn't load texture atlas ".concat(path, ": ").concat(ex.message));
                     _this.toLoad--;
                     _this.loaded++;
                     return;
@@ -2340,17 +2342,17 @@ var spine;
                                 }
                                 catch (e) {
                                     var ex = e;
-                                    _this.errors[path] = "Couldn't load texture atlas " + path + ": " + ex.message;
+                                    _this.errors[path] = "Couldn't load texture atlas ".concat(path, ": ").concat(ex.message);
                                     if (error)
-                                        error(path, "Couldn't load texture atlas " + path + ": " + ex.message);
+                                        error(path, "Couldn't load texture atlas ".concat(path, ": ").concat(ex.message));
                                     _this.toLoad--;
                                     _this.loaded++;
                                 }
                             }
                             else {
-                                _this.errors[path] = "Couldn't load texture atlas page " + imagePath + "} of atlas " + path;
+                                _this.errors[path] = "Couldn't load texture atlas page ".concat(imagePath, "} of atlas ").concat(path);
                                 if (error)
-                                    error(path, "Couldn't load texture atlas page " + imagePath + " of atlas " + path);
+                                    error(path, "Couldn't load texture atlas page ".concat(imagePath, " of atlas ").concat(path));
                                 _this.toLoad--;
                                 _this.loaded++;
                             }
@@ -2359,9 +2361,9 @@ var spine;
                         pageLoadError = true;
                         pagesLoaded.count++;
                         if (pagesLoaded.count == atlasPages.length) {
-                            _this.errors[path] = "Couldn't load texture atlas page " + imagePath + "} of atlas " + path;
+                            _this.errors[path] = "Couldn't load texture atlas page ".concat(imagePath, "} of atlas ").concat(path);
                             if (error)
-                                error(path, "Couldn't load texture atlas page " + imagePath + " of atlas " + path);
+                                error(path, "Couldn't load texture atlas page ".concat(imagePath, " of atlas ").concat(path));
                             _this.toLoad--;
                             _this.loaded++;
                         }
@@ -2372,9 +2374,9 @@ var spine;
                     _loop_1(atlasPage);
                 }
             }, function (state, responseText) {
-                _this.errors[path] = "Couldn't load texture atlas " + path + ": status " + status + ", " + responseText;
+                _this.errors[path] = "Couldn't load texture atlas ".concat(path, ": status ").concat(status, ", ").concat(responseText);
                 if (error)
-                    error(path, "Couldn't load texture atlas " + path + ": status " + status + ", " + responseText);
+                    error(path, "Couldn't load texture atlas ".concat(path, ": status ").concat(status, ", ").concat(responseText));
                 _this.toLoad--;
                 _this.loaded++;
             });
@@ -3540,7 +3542,7 @@ var spine;
                         _this.rawAssets[path] = request.responseText;
                     }
                     else {
-                        _this.errors[path] = "Couldn't load text " + path + ": status " + request.status + ", " + request.responseText;
+                        _this.errors[path] = "Couldn't load text ".concat(path, ": status ").concat(request.status, ", ").concat(request.responseText);
                     }
                 }
             };
@@ -3560,7 +3562,7 @@ var spine;
                         _this.rawAssets[path] = JSON.parse(request.responseText);
                     }
                     else {
-                        _this.errors[path] = "Couldn't load text " + path + ": status " + request.status + ", " + request.responseText;
+                        _this.errors[path] = "Couldn't load text ".concat(path, ": status ").concat(request.status, ", ").concat(request.responseText);
                     }
                 }
             };
@@ -3597,7 +3599,7 @@ var spine;
                     _this.rawAssets[path] = img_1;
                 };
                 img_1.onerror = function (ev) {
-                    _this.errors[path] = "Couldn't load image " + path;
+                    _this.errors[path] = "Couldn't load image ".concat(path);
                 };
                 img_1.src = path;
             }
@@ -6251,7 +6253,7 @@ var spine;
                 return spine.BlendMode.Multiply;
             if (str == "screen")
                 return spine.BlendMode.Screen;
-            throw new Error("Unknown blend mode: " + str);
+            throw new Error("Unknown blend mode: ".concat(str));
         };
         SkeletonJson.positionModeFromString = function (str) {
             str = str.toLowerCase();
@@ -6259,7 +6261,7 @@ var spine;
                 return spine.PositionMode.Fixed;
             if (str == "percent")
                 return spine.PositionMode.Percent;
-            throw new Error("Unknown position mode: " + str);
+            throw new Error("Unknown position mode: ".concat(str));
         };
         SkeletonJson.spacingModeFromString = function (str) {
             str = str.toLowerCase();
@@ -6269,7 +6271,7 @@ var spine;
                 return spine.SpacingMode.Fixed;
             if (str == "percent")
                 return spine.SpacingMode.Percent;
-            throw new Error("Unknown position mode: " + str);
+            throw new Error("Unknown position mode: ".concat(str));
         };
         SkeletonJson.rotateModeFromString = function (str) {
             str = str.toLowerCase();
@@ -6279,7 +6281,7 @@ var spine;
                 return spine.RotateMode.Chain;
             if (str == "chainscale")
                 return spine.RotateMode.ChainScale;
-            throw new Error("Unknown rotate mode: " + str);
+            throw new Error("Unknown rotate mode: ".concat(str));
         };
         SkeletonJson.transformModeFromString = function (str) {
             str = str.toLowerCase();
@@ -6293,7 +6295,7 @@ var spine;
                 return spine.TransformMode.NoScale;
             if (str == "noscaleorreflection")
                 return spine.TransformMode.NoScaleOrReflection;
-            throw new Error("Unknown transform mode: " + str);
+            throw new Error("Unknown transform mode: ".concat(str));
         };
         return SkeletonJson;
     }());
@@ -6558,7 +6560,7 @@ var spine;
                 case "mipmaplinearnearest": return TextureFilter.MipMapLinearNearest;
                 case "mipmapnearestlinear": return TextureFilter.MipMapNearestLinear;
                 case "mipmaplinearlinear": return TextureFilter.MipMapLinearLinear;
-                default: throw new Error("Unknown texture filter " + text);
+                default: throw new Error("Unknown texture filter ".concat(text));
             }
         };
         Texture.wrapFromString = function (text) {
@@ -6566,7 +6568,7 @@ var spine;
                 case "mirroredtepeat": return TextureWrap.MirroredRepeat;
                 case "clamptoedge": return TextureWrap.ClampToEdge;
                 case "repeat": return TextureWrap.Repeat;
-                default: throw new Error("Unknown texture wrap " + text);
+                default: throw new Error("Unknown texture wrap ".concat(text));
             }
         };
         return Texture;

plugins/spine/src/runtimes/spine-webgl.d.ts

@@ -1,3 +1,4 @@
+/// <reference types="offscreencanvas" />
 declare module spine {
     class Animation {
         name: string;
@@ -1371,7 +1372,7 @@ declare module spine.webgl {
         static DISABLE_UNPACK_PREMULTIPLIED_ALPHA_WEBGL: boolean;
         constructor(context: ManagedWebGLRenderingContext | WebGLRenderingContext, image: HTMLImageElement | ImageBitmap, useMipMaps?: boolean);
         setFilters(minFilter: TextureFilter, magFilter: TextureFilter): void;
-        static validateMagFilter(magFilter: TextureFilter): TextureFilter.Nearest | TextureFilter.Linear | TextureFilter.Linear;
+        static validateMagFilter(magFilter: TextureFilter): TextureFilter.Nearest | TextureFilter.Linear;
         setWraps(uWrap: TextureWrap, vWrap: TextureWrap): void;
         update(useMipMaps: boolean): void;
         restore(): void;

plugins/spine/src/runtimes/spine-webgl.js

@@ -6,6 +6,8 @@ var __extends = (this && this.__extends) || (function () {
         return extendStatics(d, b);
     };
     return function (d, b) {
+        if (typeof b !== "function" && b !== null)
+            throw new TypeError("Class extends value " + String(b) + " is not a constructor or null");
         extendStatics(d, b);
         function __() { this.constructor = d; }
         d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
@@ -2239,9 +2241,9 @@ var spine;
                 _this.toLoad--;
                 _this.loaded++;
             }, function (state, responseText) {
-                _this.errors[path] = "Couldn't load binary " + path + ": status " + status + ", " + responseText;
+                _this.errors[path] = "Couldn't load binary ".concat(path, ": status ").concat(status, ", ").concat(responseText);
                 if (error)
-                    error(path, "Couldn't load binary " + path + ": status " + status + ", " + responseText);
+                    error(path, "Couldn't load binary ".concat(path, ": status ").concat(status, ", ").concat(responseText));
                 _this.toLoad--;
                 _this.loaded++;
             });
@@ -2259,9 +2261,9 @@ var spine;
                 _this.toLoad--;
                 _this.loaded++;
             }, function (state, responseText) {
-                _this.errors[path] = "Couldn't load text " + path + ": status " + status + ", " + responseText;
+                _this.errors[path] = "Couldn't load text ".concat(path, ": status ").concat(status, ", ").concat(responseText);
                 if (error)
-                    error(path, "Couldn't load text " + path + ": status " + status + ", " + responseText);
+                    error(path, "Couldn't load text ".concat(path, ": status ").concat(status, ", ").concat(responseText));
                 _this.toLoad--;
                 _this.loaded++;
             });
@@ -2284,11 +2286,11 @@ var spine;
                     success(path, img);
             };
             img.onerror = function (ev) {
-                _this.errors[path] = "Couldn't load image " + path;
+                _this.errors[path] = "Couldn't load image ".concat(path);
                 _this.toLoad--;
                 _this.loaded++;
                 if (error)
-                    error(path, "Couldn't load image " + path);
+                    error(path, "Couldn't load image ".concat(path));
             };
             if (this.rawDataUris[path])
                 path = this.rawDataUris[path];
@@ -2315,9 +2317,9 @@ var spine;
                 }
                 catch (e) {
                     var ex = e;
-                    _this.errors[path] = "Couldn't load texture atlas " + path + ": " + ex.message;
+                    _this.errors[path] = "Couldn't load texture atlas ".concat(path, ": ").concat(ex.message);
                     if (error)
-                        error(path, "Couldn't load texture atlas " + path + ": " + ex.message);
+                        error(path, "Couldn't load texture atlas ".concat(path, ": ").concat(ex.message));
                     _this.toLoad--;
                     _this.loaded++;
                     return;
@@ -2340,17 +2342,17 @@ var spine;
                                 }
                                 catch (e) {
                                     var ex = e;
-                                    _this.errors[path] = "Couldn't load texture atlas " + path + ": " + ex.message;
+                                    _this.errors[path] = "Couldn't load texture atlas ".concat(path, ": ").concat(ex.message);
                                     if (error)
-                                        error(path, "Couldn't load texture atlas " + path + ": " + ex.message);
+                                        error(path, "Couldn't load texture atlas ".concat(path, ": ").concat(ex.message));
                                     _this.toLoad--;
                                     _this.loaded++;
                                 }
                             }
                             else {
-                                _this.errors[path] = "Couldn't load texture atlas page " + imagePath + "} of atlas " + path;
+                                _this.errors[path] = "Couldn't load texture atlas page ".concat(imagePath, "} of atlas ").concat(path);
                                 if (error)
-                                    error(path, "Couldn't load texture atlas page " + imagePath + " of atlas " + path);
+                                    error(path, "Couldn't load texture atlas page ".concat(imagePath, " of atlas ").concat(path));
                                 _this.toLoad--;
                                 _this.loaded++;
                             }
@@ -2359,9 +2361,9 @@ var spine;
                         pageLoadError = true;
                         pagesLoaded.count++;
                         if (pagesLoaded.count == atlasPages.length) {
-                            _this.errors[path] = "Couldn't load texture atlas page " + imagePath + "} of atlas " + path;
+                            _this.errors[path] = "Couldn't load texture atlas page ".concat(imagePath, "} of atlas ").concat(path);
                             if (error)
-                                error(path, "Couldn't load texture atlas page " + imagePath + " of atlas " + path);
+                                error(path, "Couldn't load texture atlas page ".concat(imagePath, " of atlas ").concat(path));
                             _this.toLoad--;
                             _this.loaded++;
                         }
@@ -2372,9 +2374,9 @@ var spine;
                     _loop_1(atlasPage);
                 }
             }, function (state, responseText) {
-                _this.errors[path] = "Couldn't load texture atlas " + path + ": status " + status + ", " + responseText;
+                _this.errors[path] = "Couldn't load texture atlas ".concat(path, ": status ").concat(status, ", ").concat(responseText);
                 if (error)
-                    error(path, "Couldn't load texture atlas " + path + ": status " + status + ", " + responseText);
+                    error(path, "Couldn't load texture atlas ".concat(path, ": status ").concat(status, ", ").concat(responseText));
                 _this.toLoad--;
                 _this.loaded++;
             });
@@ -3540,7 +3542,7 @@ var spine;
                         _this.rawAssets[path] = request.responseText;
                     }
                     else {
-                        _this.errors[path] = "Couldn't load text " + path + ": status " + request.status + ", " + request.responseText;
+                        _this.errors[path] = "Couldn't load text ".concat(path, ": status ").concat(request.status, ", ").concat(request.responseText);
                     }
                 }
             };
@@ -3560,7 +3562,7 @@ var spine;
                         _this.rawAssets[path] = JSON.parse(request.responseText);
                     }
                     else {
-                        _this.errors[path] = "Couldn't load text " + path + ": status " + request.status + ", " + request.responseText;
+                        _this.errors[path] = "Couldn't load text ".concat(path, ": status ").concat(request.status, ", ").concat(request.responseText);
                     }
                 }
             };
@@ -3597,7 +3599,7 @@ var spine;
                     _this.rawAssets[path] = img_1;
                 };
                 img_1.onerror = function (ev) {
-                    _this.errors[path] = "Couldn't load image " + path;
+                    _this.errors[path] = "Couldn't load image ".concat(path);
                 };
                 img_1.src = path;
             }
@@ -6251,7 +6253,7 @@ var spine;
                 return spine.BlendMode.Multiply;
             if (str == "screen")
                 return spine.BlendMode.Screen;
-            throw new Error("Unknown blend mode: " + str);
+            throw new Error("Unknown blend mode: ".concat(str));
         };
         SkeletonJson.positionModeFromString = function (str) {
             str = str.toLowerCase();
@@ -6259,7 +6261,7 @@ var spine;
                 return spine.PositionMode.Fixed;
             if (str == "percent")
                 return spine.PositionMode.Percent;
-            throw new Error("Unknown position mode: " + str);
+            throw new Error("Unknown position mode: ".concat(str));
         };
         SkeletonJson.spacingModeFromString = function (str) {
             str = str.toLowerCase();
@@ -6269,7 +6271,7 @@ var spine;
                 return spine.SpacingMode.Fixed;
             if (str == "percent")
                 return spine.SpacingMode.Percent;
-            throw new Error("Unknown position mode: " + str);
+            throw new Error("Unknown position mode: ".concat(str));
         };
         SkeletonJson.rotateModeFromString = function (str) {
             str = str.toLowerCase();
@@ -6279,7 +6281,7 @@ var spine;
                 return spine.RotateMode.Chain;
             if (str == "chainscale")
                 return spine.RotateMode.ChainScale;
-            throw new Error("Unknown rotate mode: " + str);
+            throw new Error("Unknown rotate mode: ".concat(str));
         };
         SkeletonJson.transformModeFromString = function (str) {
             str = str.toLowerCase();
@@ -6293,7 +6295,7 @@ var spine;
                 return spine.TransformMode.NoScale;
             if (str == "noscaleorreflection")
                 return spine.TransformMode.NoScaleOrReflection;
-            throw new Error("Unknown transform mode: " + str);
+            throw new Error("Unknown transform mode: ".concat(str));
         };
         return SkeletonJson;
     }());
@@ -6558,7 +6560,7 @@ var spine;
                 case "mipmaplinearnearest": return TextureFilter.MipMapLinearNearest;
                 case "mipmapnearestlinear": return TextureFilter.MipMapNearestLinear;
                 case "mipmaplinearlinear": return TextureFilter.MipMapLinearLinear;
-                default: throw new Error("Unknown texture filter " + text);
+                default: throw new Error("Unknown texture filter ".concat(text));
             }
         };
         Texture.wrapFromString = function (text) {
@@ -6566,7 +6568,7 @@ var spine;
                 case "mirroredtepeat": return TextureWrap.MirroredRepeat;
                 case "clamptoedge": return TextureWrap.ClampToEdge;
                 case "repeat": return TextureWrap.Repeat;
-                default: throw new Error("Unknown texture wrap " + text);
+                default: throw new Error("Unknown texture wrap ".concat(text));
             }
         };
         return Texture;
@@ -9528,14 +9530,14 @@ var spine;
                 var gl = this.context.gl;
                 var location = gl.getUniformLocation(this.program, uniform);
                 if (!location && !gl.isContextLost())
-                    throw new Error("Couldn't find location for uniform " + uniform);
+                    throw new Error("Couldn't find location for uniform ".concat(uniform));
                 return location;
             };
             Shader.prototype.getAttributeLocation = function (attribute) {
                 var gl = this.context.gl;
                 var location = gl.getAttribLocation(this.program, attribute);
                 if (location == -1 && !gl.isContextLost())
-                    throw new Error("Couldn't find location for attribute " + attribute);
+                    throw new Error("Couldn't find location for attribute ".concat(attribute));
                 return location;
             };
             Shader.prototype.dispose = function () {
@@ -9555,17 +9557,17 @@ var spine;
                 }
             };
             Shader.newColoredTextured = function (context) {
-                var vs = "\n\t\t\t\tattribute vec4 " + Shader.POSITION + ";\n\t\t\t\tattribute vec4 " + Shader.COLOR + ";\n\t\t\t\tattribute vec2 " + Shader.TEXCOORDS + ";\n\t\t\t\tuniform mat4 " + Shader.MVP_MATRIX + ";\n\t\t\t\tvarying vec4 v_color;\n\t\t\t\tvarying vec2 v_texCoords;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tv_color = " + Shader.COLOR + ";\n\t\t\t\t\tv_texCoords = " + Shader.TEXCOORDS + ";\n\t\t\t\t\tgl_Position = " + Shader.MVP_MATRIX + " * " + Shader.POSITION + ";\n\t\t\t\t}\n\t\t\t";
+                var vs = "\n\t\t\t\tattribute vec4 ".concat(Shader.POSITION, ";\n\t\t\t\tattribute vec4 ").concat(Shader.COLOR, ";\n\t\t\t\tattribute vec2 ").concat(Shader.TEXCOORDS, ";\n\t\t\t\tuniform mat4 ").concat(Shader.MVP_MATRIX, ";\n\t\t\t\tvarying vec4 v_color;\n\t\t\t\tvarying vec2 v_texCoords;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tv_color = ").concat(Shader.COLOR, ";\n\t\t\t\t\tv_texCoords = ").concat(Shader.TEXCOORDS, ";\n\t\t\t\t\tgl_Position = ").concat(Shader.MVP_MATRIX, " * ").concat(Shader.POSITION, ";\n\t\t\t\t}\n\t\t\t");
                 var fs = "\n\t\t\t\t#ifdef GL_ES\n\t\t\t\t\t#define LOWP lowp\n\t\t\t\t\tprecision mediump float;\n\t\t\t\t#else\n\t\t\t\t\t#define LOWP\n\t\t\t\t#endif\n\t\t\t\tvarying LOWP vec4 v_color;\n\t\t\t\tvarying vec2 v_texCoords;\n\t\t\t\tuniform sampler2D u_texture;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tgl_FragColor = v_color * texture2D(u_texture, v_texCoords);\n\t\t\t\t}\n\t\t\t";
                 return new Shader(context, vs, fs);
             };
             Shader.newTwoColoredTextured = function (context) {
-                var vs = "\n\t\t\t\tattribute vec4 " + Shader.POSITION + ";\n\t\t\t\tattribute vec4 " + Shader.COLOR + ";\n\t\t\t\tattribute vec4 " + Shader.COLOR2 + ";\n\t\t\t\tattribute vec2 " + Shader.TEXCOORDS + ";\n\t\t\t\tuniform mat4 " + Shader.MVP_MATRIX + ";\n\t\t\t\tvarying vec4 v_light;\n\t\t\t\tvarying vec4 v_dark;\n\t\t\t\tvarying vec2 v_texCoords;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tv_light = " + Shader.COLOR + ";\n\t\t\t\t\tv_dark = " + Shader.COLOR2 + ";\n\t\t\t\t\tv_texCoords = " + Shader.TEXCOORDS + ";\n\t\t\t\t\tgl_Position = " + Shader.MVP_MATRIX + " * " + Shader.POSITION + ";\n\t\t\t\t}\n\t\t\t";
+                var vs = "\n\t\t\t\tattribute vec4 ".concat(Shader.POSITION, ";\n\t\t\t\tattribute vec4 ").concat(Shader.COLOR, ";\n\t\t\t\tattribute vec4 ").concat(Shader.COLOR2, ";\n\t\t\t\tattribute vec2 ").concat(Shader.TEXCOORDS, ";\n\t\t\t\tuniform mat4 ").concat(Shader.MVP_MATRIX, ";\n\t\t\t\tvarying vec4 v_light;\n\t\t\t\tvarying vec4 v_dark;\n\t\t\t\tvarying vec2 v_texCoords;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tv_light = ").concat(Shader.COLOR, ";\n\t\t\t\t\tv_dark = ").concat(Shader.COLOR2, ";\n\t\t\t\t\tv_texCoords = ").concat(Shader.TEXCOORDS, ";\n\t\t\t\t\tgl_Position = ").concat(Shader.MVP_MATRIX, " * ").concat(Shader.POSITION, ";\n\t\t\t\t}\n\t\t\t");
                 var fs = "\n\t\t\t\t#ifdef GL_ES\n\t\t\t\t\t#define LOWP lowp\n\t\t\t\t\tprecision mediump float;\n\t\t\t\t#else\n\t\t\t\t\t#define LOWP\n\t\t\t\t#endif\n\t\t\t\tvarying LOWP vec4 v_light;\n\t\t\t\tvarying LOWP vec4 v_dark;\n\t\t\t\tvarying vec2 v_texCoords;\n\t\t\t\tuniform sampler2D u_texture;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tvec4 texColor = texture2D(u_texture, v_texCoords);\n\t\t\t\t\tgl_FragColor.a = texColor.a * v_light.a;\n\t\t\t\t\tgl_FragColor.rgb = ((texColor.a - 1.0) * v_dark.a + 1.0 - texColor.rgb) * v_dark.rgb + texColor.rgb * v_light.rgb;\n\t\t\t\t}\n\t\t\t";
                 return new Shader(context, vs, fs);
             };
             Shader.newColored = function (context) {
-                var vs = "\n\t\t\t\tattribute vec4 " + Shader.POSITION + ";\n\t\t\t\tattribute vec4 " + Shader.COLOR + ";\n\t\t\t\tuniform mat4 " + Shader.MVP_MATRIX + ";\n\t\t\t\tvarying vec4 v_color;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tv_color = " + Shader.COLOR + ";\n\t\t\t\t\tgl_Position = " + Shader.MVP_MATRIX + " * " + Shader.POSITION + ";\n\t\t\t\t}\n\t\t\t";
+                var vs = "\n\t\t\t\tattribute vec4 ".concat(Shader.POSITION, ";\n\t\t\t\tattribute vec4 ").concat(Shader.COLOR, ";\n\t\t\t\tuniform mat4 ").concat(Shader.MVP_MATRIX, ";\n\t\t\t\tvarying vec4 v_color;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tv_color = ").concat(Shader.COLOR, ";\n\t\t\t\t\tgl_Position = ").concat(Shader.MVP_MATRIX, " * ").concat(Shader.POSITION, ";\n\t\t\t\t}\n\t\t\t");
                 var fs = "\n\t\t\t\t#ifdef GL_ES\n\t\t\t\t\t#define LOWP lowp\n\t\t\t\t\tprecision mediump float;\n\t\t\t\t#else\n\t\t\t\t\t#define LOWP\n\t\t\t\t#endif\n\t\t\t\tvarying LOWP vec4 v_color;\n\n\t\t\t\tvoid main () {\n\t\t\t\t\tgl_FragColor = v_color;\n\t\t\t\t}\n\t\t\t";
                 return new Shader(context, vs, fs);
             };

plugins/spine/webpack.auto.dist.config.js

@@ -1,7 +1,7 @@
 'use strict';
 
 const webpack = require('webpack');
-const UglifyJSPlugin = require('uglifyjs-webpack-plugin');
+const TerserPlugin = require('terser-webpack-plugin');
 const exec = require('child_process').exec;
 const RemovePlugin = require('remove-files-webpack-plugin');
 
@@ -53,18 +53,19 @@ module.exports = {
 
     optimization: {
         minimizer: [
-            new UglifyJSPlugin({
+            new TerserPlugin({
                 include: /\.min\.js$/,
                 parallel: true,
-                sourceMap: false,
-                uglifyOptions: {
+                extractComments: false,
+                terserOptions: {
+                    format: {
+                        comments: false
+                    },
                     compress: true,
                     ie8: false,
                     ecma: 5,
-                    output: {comments: false},
                     warnings: false
-                },
-                warningsFilter: () => false
+                }
             })
         ]
     },

plugins/spine/webpack.canvas.dist.config.js

@@ -1,7 +1,7 @@
 'use strict';
 
 const webpack = require('webpack');
-const UglifyJSPlugin = require('uglifyjs-webpack-plugin');
+const TerserPlugin = require('terser-webpack-plugin');
 const exec = require('child_process').exec;
 const RemovePlugin = require('remove-files-webpack-plugin');
 
@@ -53,18 +53,19 @@ module.exports = {
 
     optimization: {
         minimizer: [
-            new UglifyJSPlugin({
+            new TerserPlugin({
                 include: /\.min\.js$/,
                 parallel: true,
-                sourceMap: false,
-                uglifyOptions: {
+                extractComments: false,
+                terserOptions: {
+                    format: {
+                        comments: false
+                    },
                     compress: true,
                     ie8: false,
                     ecma: 5,
-                    output: {comments: false},
                     warnings: false
-                },
-                warningsFilter: () => false
+                }
             })
         ]
     },

plugins/spine/webpack.webgl.dist.config.js

@@ -1,7 +1,7 @@
 'use strict';
 
 const webpack = require('webpack');
-const UglifyJSPlugin = require('uglifyjs-webpack-plugin');
+const TerserPlugin = require('terser-webpack-plugin');
 const exec = require('child_process').exec;
 const RemovePlugin = require('remove-files-webpack-plugin');
 
@@ -53,18 +53,19 @@ module.exports = {
 
     optimization: {
         minimizer: [
-            new UglifyJSPlugin({
+            new TerserPlugin({
                 include: /\.min\.js$/,
                 parallel: true,
-                sourceMap: false,
-                uglifyOptions: {
+                extractComments: false,
+                terserOptions: {
+                    format: {
+                        comments: false
+                    },
                     compress: true,
                     ie8: false,
                     ecma: 5,
-                    output: {comments: false},
                     warnings: false
-                },
-                warningsFilter: () => false
+                }
             })
         ]
     },

src/animations/AnimationManager.js

@@ -603,6 +603,7 @@ var AnimationManager = new Class({
      * Generates objects with string based frame names, as configured by the given {@link Phaser.Types.Animations.GenerateFrameNames}.
      *
      * It's a helper method, designed to make it easier for you to extract all of the frame names from texture atlases.
+     *
      * If you're working with a sprite sheet, see the `generateFrameNumbers` method instead.
      *
      * Example:
@@ -697,7 +698,6 @@ var AnimationManager = new Class({
      * If you're working with a texture atlas, see the `generateFrameNames` method instead.
      *
      * It's a helper method, designed to make it easier for you to extract frames from sprite sheets.
-     * If you're working with a texture atlas, see the `generateFrameNames` method instead.
      *
      * Example:
      *

src/animations/AnimationState.js

@@ -472,7 +472,7 @@ var AnimationState = new Class({
      * @method Phaser.Animations.AnimationState#chain
      * @since 3.16.0
      *
-     * @param {(string|Phaser.Animations.Animation|Phaser.Types.Animations.PlayAnimationConfig|string[]|Phaser.Animations.Animation[]|Phaser.Types.Animations.PlayAnimationConfig[])} key - The string-based key of the animation to play, or an Animation instance, or a `PlayAnimationConfig` object, or an array of them.
+     * @param {(string|Phaser.Animations.Animation|Phaser.Types.Animations.PlayAnimationConfig|string[]|Phaser.Animations.Animation[]|Phaser.Types.Animations.PlayAnimationConfig[])} [key] - The string-based key of the animation to play, or an Animation instance, or a `PlayAnimationConfig` object, or an array of them.
      *
      * @return {Phaser.GameObjects.GameObject} The Game Object that owns this Animation Component.
      */

src/core/Config.js

@@ -46,97 +46,79 @@ var Config = new Class({
 
         var defaultBannerTextColor = '#ffffff';
 
+        //  Scale Manager - Anything set in here over-rides anything set in the core game config
+
+        var scaleConfig = GetValue(config, 'scale', null);
+
         /**
          * @const {(number|string)} Phaser.Core.Config#width - The width of the underlying canvas, in pixels.
          */
-        this.width = GetValue(config, 'width', 1024);
+        this.width = GetValue(scaleConfig, 'width', 1024, config);
 
         /**
          * @const {(number|string)} Phaser.Core.Config#height - The height of the underlying canvas, in pixels.
          */
-        this.height = GetValue(config, 'height', 768);
+        this.height = GetValue(scaleConfig, 'height', 768, config);
 
         /**
          * @const {(Phaser.Scale.ZoomType|number)} Phaser.Core.Config#zoom - The zoom factor, as used by the Scale Manager.
          */
-        this.zoom = GetValue(config, 'zoom', 1);
+        this.zoom = GetValue(scaleConfig, 'zoom', 1, config);
 
         /**
          * @const {?*} Phaser.Core.Config#parent - A parent DOM element into which the canvas created by the renderer will be injected.
          */
-        this.parent = GetValue(config, 'parent', undefined);
+        this.parent = GetValue(scaleConfig, 'parent', undefined, config);
 
         /**
          * @const {Phaser.Scale.ScaleModeType} Phaser.Core.Config#scaleMode - The scale mode as used by the Scale Manager. The default is zero, which is no scaling.
          */
-        this.scaleMode = GetValue(config, 'scaleMode', 0);
+        this.scaleMode = GetValue(scaleConfig, 'scaleMode', 0, config);
 
         /**
          * @const {boolean} Phaser.Core.Config#expandParent - Is the Scale Manager allowed to adjust the CSS height property of the parent to be 100%?
          */
-        this.expandParent = GetValue(config, 'expandParent', true);
+        this.expandParent = GetValue(scaleConfig, 'expandParent', true, config);
 
         /**
          * @const {boolean} Phaser.Core.Config#autoRound - Automatically round the display and style sizes of the canvas. This can help with performance in lower-powered devices.
          */
-        this.autoRound = GetValue(config, 'autoRound', false);
+        this.autoRound = GetValue(scaleConfig, 'autoRound', false, config);
 
         /**
          * @const {Phaser.Scale.CenterType} Phaser.Core.Config#autoCenter - Automatically center the canvas within the parent?
          */
-        this.autoCenter = GetValue(config, 'autoCenter', 0);
+        this.autoCenter = GetValue(scaleConfig, 'autoCenter', 0, config);
 
         /**
          * @const {number} Phaser.Core.Config#resizeInterval - How many ms should elapse before checking if the browser size has changed?
          */
-        this.resizeInterval = GetValue(config, 'resizeInterval', 500);
+        this.resizeInterval = GetValue(scaleConfig, 'resizeInterval', 500, config);
 
         /**
          * @const {?(HTMLElement|string)} Phaser.Core.Config#fullscreenTarget - The DOM element that will be sent into full screen mode, or its `id`. If undefined Phaser will create its own div and insert the canvas into it when entering fullscreen mode.
          */
-        this.fullscreenTarget = GetValue(config, 'fullscreenTarget', null);
+        this.fullscreenTarget = GetValue(scaleConfig, 'fullscreenTarget', null, config);
 
         /**
          * @const {number} Phaser.Core.Config#minWidth - The minimum width, in pixels, the canvas will scale down to. A value of zero means no minimum.
          */
-        this.minWidth = GetValue(config, 'minWidth', 0);
+        this.minWidth = GetValue(scaleConfig, 'minWidth', 0, config);
 
         /**
          * @const {number} Phaser.Core.Config#maxWidth - The maximum width, in pixels, the canvas will scale up to. A value of zero means no maximum.
          */
-        this.maxWidth = GetValue(config, 'maxWidth', 0);
+        this.maxWidth = GetValue(scaleConfig, 'maxWidth', 0, config);
 
         /**
          * @const {number} Phaser.Core.Config#minHeight - The minimum height, in pixels, the canvas will scale down to. A value of zero means no minimum.
          */
-        this.minHeight = GetValue(config, 'minHeight', 0);
+        this.minHeight = GetValue(scaleConfig, 'minHeight', 0, config);
 
         /**
          * @const {number} Phaser.Core.Config#maxHeight - The maximum height, in pixels, the canvas will scale up to. A value of zero means no maximum.
          */
-        this.maxHeight = GetValue(config, 'maxHeight', 0);
-
-        //  Scale Manager - Anything set in here over-rides anything set above
-
-        var scaleConfig = GetValue(config, 'scale', null);
-
-        if (scaleConfig)
-        {
-            this.width = GetValue(scaleConfig, 'width', this.width);
-            this.height = GetValue(scaleConfig, 'height', this.height);
-            this.zoom = GetValue(scaleConfig, 'zoom', this.zoom);
-            this.parent = GetValue(scaleConfig, 'parent', this.parent);
-            this.scaleMode = GetValue(scaleConfig, 'mode', this.scaleMode);
-            this.expandParent = GetValue(scaleConfig, 'expandParent', this.expandParent);
-            this.autoRound = GetValue(scaleConfig, 'autoRound', this.autoRound);
-            this.autoCenter = GetValue(scaleConfig, 'autoCenter', this.autoCenter);
-            this.resizeInterval = GetValue(scaleConfig, 'resizeInterval', this.resizeInterval);
-            this.fullscreenTarget = GetValue(scaleConfig, 'fullscreenTarget', this.fullscreenTarget);
-            this.minWidth = GetValue(scaleConfig, 'min.width', this.minWidth);
-            this.maxWidth = GetValue(scaleConfig, 'max.width', this.maxWidth);
-            this.minHeight = GetValue(scaleConfig, 'min.height', this.minHeight);
-            this.maxHeight = GetValue(scaleConfig, 'max.height', this.maxHeight);
-        }
+        this.maxHeight = GetValue(scaleConfig, 'maxHeight', 0, config);
 
         /**
          * @const {number} Phaser.Core.Config#renderType - Force Phaser to use a specific renderer. Can be `CONST.CANVAS`, `CONST.WEBGL`, `CONST.HEADLESS` or `CONST.AUTO` (default)
@@ -336,45 +318,44 @@ var Config = new Class({
          */
         this.fps = GetValue(config, 'fps', null);
 
-        //  Renderer Settings
-        //  These can either be in a `render` object within the Config, or specified on their own
+        //  Render Settings - Anything set in here over-rides anything set in the core game config
 
-        var renderConfig = GetValue(config, 'render', config);
+        var renderConfig = GetValue(config, 'render', null);
 
         /**
          * @const {Phaser.Types.Core.PipelineConfig} Phaser.Core.Config#pipeline - An object mapping WebGL names to WebGLPipeline classes. These should be class constructors, not instances.
          */
-        this.pipeline = GetValue(renderConfig, 'pipeline', null);
+        this.pipeline = GetValue(renderConfig, 'pipeline', null, config);
 
         /**
          * @const {boolean} Phaser.Core.Config#antialias - When set to `true`, WebGL uses linear interpolation to draw scaled or rotated textures, giving a smooth appearance. When set to `false`, WebGL uses nearest-neighbor interpolation, giving a crisper appearance. `false` also disables antialiasing of the game canvas itself, if the browser supports it, when the game canvas is scaled.
          */
-        this.antialias = GetValue(renderConfig, 'antialias', true);
+        this.antialias = GetValue(renderConfig, 'antialias', true, config);
 
         /**
          * @const {boolean} Phaser.Core.Config#antialiasGL - Sets the `antialias` property when the WebGL context is created. Setting this value does not impact any subsequent textures that are created, or the canvas style attributes.
          */
-        this.antialiasGL = GetValue(renderConfig, 'antialiasGL', true);
+        this.antialiasGL = GetValue(renderConfig, 'antialiasGL', true, config);
 
         /**
          * @const {string} Phaser.Core.Config#mipmapFilter - Sets the `mipmapFilter` property when the WebGL renderer is created.
          */
-        this.mipmapFilter = GetValue(renderConfig, 'mipmapFilter', 'LINEAR');
+        this.mipmapFilter = GetValue(renderConfig, 'mipmapFilter', 'LINEAR', config);
 
         /**
          * @const {boolean} Phaser.Core.Config#desynchronized - When set to `true` it will create a desynchronized context for both 2D and WebGL. See https://developers.google.com/web/updates/2019/05/desynchronized for details.
          */
-        this.desynchronized = GetValue(renderConfig, 'desynchronized', false);
+        this.desynchronized = GetValue(renderConfig, 'desynchronized', false, config);
 
         /**
          * @const {boolean} Phaser.Core.Config#roundPixels - Draw texture-based Game Objects at only whole-integer positions. Game Objects without textures, like Graphics, ignore this property.
          */
-        this.roundPixels = GetValue(renderConfig, 'roundPixels', false);
+        this.roundPixels = GetValue(renderConfig, 'roundPixels', false, config);
 
         /**
          * @const {boolean} Phaser.Core.Config#pixelArt - Prevent pixel art from becoming blurred when scaled. It will remain crisp (tells the WebGL renderer to automatically create textures using a linear filter mode).
          */
-        this.pixelArt = GetValue(renderConfig, 'pixelArt', this.zoom !== 1);
+        this.pixelArt = GetValue(renderConfig, 'pixelArt', this.zoom !== 1, config);
 
         if (this.pixelArt)
         {
@@ -386,47 +367,47 @@ var Config = new Class({
         /**
          * @const {boolean} Phaser.Core.Config#transparent - Whether the game canvas will have a transparent background.
          */
-        this.transparent = GetValue(renderConfig, 'transparent', false);
+        this.transparent = GetValue(renderConfig, 'transparent', false, config);
 
         /**
          * @const {boolean} Phaser.Core.Config#clearBeforeRender - Whether the game canvas will be cleared between each rendering frame. You can disable this if you have a full-screen background image or game object.
          */
-        this.clearBeforeRender = GetValue(renderConfig, 'clearBeforeRender', true);
+        this.clearBeforeRender = GetValue(renderConfig, 'clearBeforeRender', true, config);
 
         /**
          * @const {boolean} Phaser.Core.Config#preserveDrawingBuffer - If the value is true the WebGL buffers will not be cleared and will preserve their values until cleared or overwritten by the author.
          */
-        this.preserveDrawingBuffer = GetValue(renderConfig, 'preserveDrawingBuffer', false);
+        this.preserveDrawingBuffer = GetValue(renderConfig, 'preserveDrawingBuffer', false, config);
 
         /**
          * @const {boolean} Phaser.Core.Config#premultipliedAlpha - In WebGL mode, sets the drawing buffer to contain colors with pre-multiplied alpha.
          */
-        this.premultipliedAlpha = GetValue(renderConfig, 'premultipliedAlpha', true);
+        this.premultipliedAlpha = GetValue(renderConfig, 'premultipliedAlpha', true, config);
 
         /**
          * @const {boolean} Phaser.Core.Config#failIfMajorPerformanceCaveat - Let the browser abort creating a WebGL context if it judges performance would be unacceptable.
          */
-        this.failIfMajorPerformanceCaveat = GetValue(renderConfig, 'failIfMajorPerformanceCaveat', false);
+        this.failIfMajorPerformanceCaveat = GetValue(renderConfig, 'failIfMajorPerformanceCaveat', false, config);
 
         /**
          * @const {string} Phaser.Core.Config#powerPreference - "high-performance", "low-power" or "default". A hint to the browser on how much device power the game might use.
          */
-        this.powerPreference = GetValue(renderConfig, 'powerPreference', 'default');
+        this.powerPreference = GetValue(renderConfig, 'powerPreference', 'default', config);
 
         /**
          * @const {number} Phaser.Core.Config#batchSize - The default WebGL Batch size. Represents the number of _quads_ that can be added to a single batch.
          */
-        this.batchSize = GetValue(renderConfig, 'batchSize', 4096);
+        this.batchSize = GetValue(renderConfig, 'batchSize', 4096, config);
 
         /**
          * @const {number} Phaser.Core.Config#maxTextures - When in WebGL mode, this sets the maximum number of GPU Textures to use. The default, -1, will use all available units. The WebGL1 spec says all browsers should provide a minimum of 8.
          */
-        this.maxTextures = GetValue(renderConfig, 'maxTextures', -1);
+        this.maxTextures = GetValue(renderConfig, 'maxTextures', -1, config);
 
         /**
          * @const {number} Phaser.Core.Config#maxLights - The maximum number of lights allowed to be visible within range of a single Camera in the LightManager.
          */
-        this.maxLights = GetValue(renderConfig, 'maxLights', 10);
+        this.maxLights = GetValue(renderConfig, 'maxLights', 10, config);
 
         var bgc = GetValue(config, 'backgroundColor', 0);
 

src/core/TimeStep.js

@@ -651,7 +651,7 @@ var TimeStep = new Class({
             this.startTime += -this.lastTime + (this.lastTime + window.performance.now());
         }
 
-        this.raf.start(this.step.bind(this), this.useRAF);
+        this.raf.start(this.step.bind(this), this.forceSetTimeOut, this._target);
 
         this.running = true;
 

src/gameobjects/blitter/BlitterCanvasRenderer.js

@@ -85,17 +85,20 @@ var BlitterCanvasRenderer = function (renderer, src, camera, parentMatrix)
                 dy = Math.round(dy);
             }
 
-            ctx.drawImage(
-                frame.source.image,
-                cd.x,
-                cd.y,
-                cd.width,
-                cd.height,
-                dx + bob.x + cameraScrollX,
-                dy + bob.y + cameraScrollY,
-                cd.width,
-                cd.height
-            );
+            if (cd.width > 0 && cd.height > 0)
+            {
+                ctx.drawImage(
+                    frame.source.image,
+                    cd.x,
+                    cd.y,
+                    cd.width,
+                    cd.height,
+                    dx + bob.x + cameraScrollX,
+                    dy + bob.y + cameraScrollY,
+                    cd.width,
+                    cd.height
+                );
+            }
         }
         else
         {
@@ -111,11 +114,14 @@ var BlitterCanvasRenderer = function (renderer, src, camera, parentMatrix)
                 dy -= cd.height;
             }
 
-            ctx.save();
-            ctx.translate(bob.x + cameraScrollX, bob.y + cameraScrollY);
-            ctx.scale(fx, fy);
-            ctx.drawImage(frame.source.image, cd.x, cd.y, cd.width, cd.height, dx, dy, cd.width, cd.height);
-            ctx.restore();
+            if (cd.width > 0 && cd.height > 0)
+            {
+                ctx.save();
+                ctx.translate(bob.x + cameraScrollX, bob.y + cameraScrollY);
+                ctx.scale(fx, fy);
+                ctx.drawImage(frame.source.image, cd.x, cd.y, cd.width, cd.height, dx, dy, cd.width, cd.height);
+                ctx.restore();
+            }
         }
     }
 

src/gameobjects/container/Container.js

@@ -498,7 +498,8 @@ var Container = new Class({
         }
         else
         {
-            output = new Vector2(source.x, source.y);
+            output.x = source.x;
+            output.y = source.y;
         }
 
         var tempMatrix = this.tempTransformMatrix;

src/gameobjects/mesh/Mesh.js

@@ -1064,8 +1064,74 @@ var Mesh = new Class({
 
         this.debugCallback = null;
         this.debugGraphic = null;
-    }
+    },
 
+    /**
+     * Clears all tint values associated with this Game Object.
+     *
+     * Immediately sets the color values back to 0xffffff on all vertices,
+     * which results in no visible change to the texture.
+     *
+     * @method Phaser.GameObjects.Mesh#clearTint
+     * @webglOnly
+     * @since 3.60.0
+     *
+     * @return {this} This Game Object instance.
+     */
+    clearTint: function ()
+    {
+        return this.setTint();
+    },
+
+    /**
+     * Sets an additive tint on all vertices of this Mesh Game Object.
+     *
+     * The tint works by taking the pixel color values from the Game Objects texture, and then
+     * multiplying it by the color value of the tint.
+     *
+     * To modify the tint color once set, either call this method again with new values or use the
+     * `tint` property to set all colors at once.
+     *
+     * To remove a tint call `clearTint`.
+     *
+     * @method Phaser.GameObjects.Mesh#setTint
+     * @webglOnly
+     * @since 3.60.0
+     *
+     * @param {number} [tint=0xffffff] - The tint being applied to all vertices of this Mesh Game Object.
+     *
+     * @return {this} This Game Object instance.
+     */
+    setTint: function (tint)
+    {
+        if (tint === undefined) { tint = 0xffffff; }
+
+        var vertices = this.vertices;
+
+        for (var i = 0; i < vertices.length; i++)
+        {
+            vertices[i].color = tint;
+        }
+
+        return this;
+    },
+
+    /**
+     * The tint value being applied to the whole of the Game Object.
+     * This property is a setter-only.
+     *
+     * @method Phaser.GameObjects.Mesh#tint
+     * @type {number}
+     * @webglOnly
+     * @since 3.60.0
+     */
+    tint: {
+
+        set: function (value)
+        {
+            this.setTint(value);
+        }
+    }
 });
 
 module.exports = Mesh;

src/gameobjects/particles/ParticleManagerCanvasRenderer.js

@@ -103,26 +103,29 @@ var ParticleManagerCanvasRenderer = function (renderer, emitterManager, camera,
             var frame = particle.frame;
             var cd = frame.canvasData;
 
-            var x = -(frame.halfWidth);
-            var y = -(frame.halfHeight);
-
-            ctx.globalAlpha = alpha;
-
-            ctx.save();
-
-            calcMatrix.setToContext(ctx);
-
-            if (roundPixels)
+            if (cd.width > 0 && cd.height > 0)
             {
-                x = Math.round(x);
-                y = Math.round(y);
+                var x = -(frame.halfWidth);
+                var y = -(frame.halfHeight);
+
+                ctx.globalAlpha = alpha;
+
+                ctx.save();
+
+                calcMatrix.setToContext(ctx);
+
+                if (roundPixels)
+                {
+                    x = Math.round(x);
+                    y = Math.round(y);
+                }
+
+                ctx.imageSmoothingEnabled = !(!renderer.antialias || frame.source.scaleMode);
+
+                ctx.drawImage(frame.source.image, cd.x, cd.y, cd.width, cd.height, x, y, cd.width, cd.height);
+
+                ctx.restore();
             }
-
-            ctx.imageSmoothingEnabled = !(!renderer.antialias || frame.source.scaleMode);
-
-            ctx.drawImage(frame.source.image, cd.x, cd.y, cd.width, cd.height, x, y, cd.width, cd.height);
-
-            ctx.restore();
         }
 
         ctx.restore();

src/gameobjects/rendertexture/RenderTexture.js

@@ -664,7 +664,10 @@ var RenderTexture = new Class({
      * * A Texture Frame instance.
      * * A string. This is used to look-up a texture from the Texture Manager.
      *
-     * Note: You cannot draw a Render Texture to itself.
+     * Note 1: You cannot draw a Render Texture to itself.
+     *
+     * Note 2: For Game Objects that have Post FX Pipelines, the pipeline _cannot_ be
+     * used when drawn to this Render Texture.
      *
      * If passing in a Group or Container it will only draw children that return `true`
      * when their `willRender()` method is called. I.e. a Container with 10 children,
@@ -1279,7 +1282,10 @@ var RenderTexture = new Class({
 
             matrix.setToContext(ctx);
 
-            ctx.drawImage(source, cd.x, cd.y, cd.width, cd.height, x, y, cd.width, cd.height);
+            if (cd.width > 0 && cd.height > 0)
+            {
+                ctx.drawImage(source, cd.x, cd.y, cd.width, cd.height, x, y, cd.width, cd.height);
+            }
 
             ctx.restore();
         }

src/gameobjects/shape/polygon/PolygonCanvasRenderer.js

@@ -56,7 +56,10 @@ var PolygonCanvasRenderer = function (renderer, src, camera, parentMatrix)
             ctx.lineTo(px2, py2);
         }
 
-        ctx.closePath();
+        if (src.closePath)
+        {
+            ctx.closePath();
+        }
 
         if (src.isFilled)
         {

src/gameobjects/sprite/Sprite.js

@@ -346,7 +346,7 @@ var Sprite = new Class({
      * @method Phaser.GameObjects.Sprite#chain
      * @since 3.50.0
      *
-     * @param {(string|Phaser.Animations.Animation|Phaser.Types.Animations.PlayAnimationConfig|string[]|Phaser.Animations.Animation[]|Phaser.Types.Animations.PlayAnimationConfig[])} key - The string-based key of the animation to play, or an Animation instance, or a `PlayAnimationConfig` object, or an array of them.
+     * @param {(string|Phaser.Animations.Animation|Phaser.Types.Animations.PlayAnimationConfig|string[]|Phaser.Animations.Animation[]|Phaser.Types.Animations.PlayAnimationConfig[])} [key] - The string-based key of the animation to play, or an Animation instance, or a `PlayAnimationConfig` object, or an array of them.
      *
      * @return {this} This Game Object.
      */

src/gameobjects/tilesprite/typedefs/TileSpriteConfig.js

@@ -8,5 +8,5 @@
  * @property {number} [width=512] - The width of the Tile Sprite. If zero it will use the size of the texture frame.
  * @property {number} [height=512] - The height of the Tile Sprite. If zero it will use the size of the texture frame.
  * @property {string} [key=''] - The key of the Texture this Tile Sprite will use to render with, as stored in the Texture Manager.
- * @property {string} [frame=''] - An optional frame from the Texture this Tile Sprite is rendering with.
+ * @property {(number|string|Phaser.Textures.Frame)} [frame=''] - An optional frame from the Texture this Tile Sprite is rendering with.
  */

src/loader/filetypes/HTML5AudioFile.js

@@ -158,13 +158,21 @@ var HTML5AudioFile = new Class({
             var audio = new Audio();
             var dataset = audio.dataset;
 
+            if (dataset === undefined)
+            {
+                audio.dataset = dataset = {
+                    name: '',
+                    used: ''
+                };
+            }
+
             dataset.name = this.key + '-' + i.toString();
             dataset.used = 'false';
 
             if (this.locked)
             {
                 dataset.locked = 'true';
-                console.log('HTML5AudioFile:', dataset.name, 'locked');
+                // console.log('HTML5AudioFile:', dataset.name, 'locked');
             }
             else
             {
@@ -174,7 +182,7 @@ var HTML5AudioFile = new Class({
                 audio.oncanplaythrough = this.onProgress.bind(this);
                 audio.onerror = this.onError.bind(this);
 
-                console.log('HTML5AudioFile:', dataset.name, 'unlocked');
+                // console.log('HTML5AudioFile:', dataset.name, 'unlocked');
             }
 
             this.data.push(audio);
@@ -189,7 +197,7 @@ var HTML5AudioFile = new Class({
             if (!this.locked)
             {
                 audio.load();
-                console.log('HTML5AudioFile:', dataset.name, 'load called');
+                // console.log('HTML5AudioFile:', dataset.name, 'load called');
             }
         }
 

src/physics/arcade/World.js

@@ -1346,14 +1346,12 @@ var World = new Class({
      * @param {ArcadePhysicsCallback} [processCallback] - The process callback.
      * @param {*} [callbackContext] - The context in which to invoke the callback.
      * @param {boolean} [overlapOnly] - If this a collide or overlap check?
-     * @param {boolean} [intersects] - Assert that the bodies intersect and should not be tested before separation.
      *
      * @return {boolean} True if separation occurred, otherwise false.
      */
-    separate: function (body1, body2, processCallback, callbackContext, overlapOnly, intersects)
+    separate: function (body1, body2, processCallback, callbackContext, overlapOnly)
     {
         if (
-            !intersects &&
             !body1.enable ||
             !body2.enable ||
             body1.checkCollision.none ||
@@ -2002,7 +2000,7 @@ var World = new Class({
                     continue;
                 }
 
-                if (this.separate(bodyA, bodyB, processCallback, callbackContext, overlapOnly, true))
+                if (this.separate(bodyA, bodyB, processCallback, callbackContext, overlapOnly))
                 {
                     if (collideCallback)
                     {

src/physics/matter-js/MatterPhysics.js

@@ -11,6 +11,7 @@ var Body = require('./lib/body/Body');
 var BodyBounds = require('./BodyBounds');
 var Bounds = require('./lib/geometry/Bounds');
 var Class = require('../../utils/Class');
+var Collision = require('./lib/collision/Collision');
 var Composite = require('./lib/body/Composite');
 var Composites = require('./lib/factory/Composites');
 var Constraint = require('./lib/constraint/Constraint');
@@ -41,10 +42,10 @@ var World = require('./World');
 /**
  * @classdesc
  * The Phaser Matter plugin provides the ability to use the Matter JS Physics Engine within your Phaser games.
- * 
+ *
  * Unlike Arcade Physics, the other physics system provided with Phaser, Matter JS is a full-body physics system.
  * It features:
- * 
+ *
  * * Rigid bodies
  * * Compound bodies
  * * Composite bodies
@@ -62,10 +63,10 @@ var World = require('./World');
  * * Views (translate, zoom)
  * * Collision queries (raycasting, region tests)
  * * Time scaling (slow-mo, speed-up)
- * 
+ *
  * Configuration of Matter is handled via the Matter World Config object, which can be passed in either the
  * Phaser Game Config, or Phaser Scene Config. Here is a basic example:
- * 
+ *
  * ```js
  * physics: {
  *     default: 'matter',
@@ -81,11 +82,11 @@ var World = require('./World');
  *     }
  * }
  * ```
- * 
+ *
  * This class acts as an interface between a Phaser Scene and a single instance of the Matter Engine.
- * 
+ *
  * Use it to access the most common Matter features and helper functions.
- * 
+ *
  * You can find details, documentation and examples on the Matter JS website: https://brm.io/matter-js/
  *
  * @class MatterPhysics
@@ -141,7 +142,7 @@ var MatterPhysics = new Class({
         /**
          * An instance of the Matter Factory. This class provides lots of functions for creating a
          * wide variety of physics objects and adds them automatically to the Matter World.
-         * 
+         *
          * You can use this class to cut-down on the amount of code required in your game, however,
          * use of the Factory is entirely optional and should be seen as a development aid. It's
          * perfectly possible to create and add components to the Matter world without using it.
@@ -166,7 +167,7 @@ var MatterPhysics = new Class({
 
         /**
          * A reference to the `Matter.Body` module.
-         * 
+         *
          * The `Matter.Body` module contains methods for creating and manipulating body models.
          * A `Matter.Body` is a rigid body that can be simulated by a `Matter.Engine`.
          * Factories for commonly used body configurations (such as rectangles, circles and other polygons) can be found in the `Bodies` module.
@@ -179,7 +180,7 @@ var MatterPhysics = new Class({
 
         /**
          * A reference to the `Matter.Composite` module.
-         * 
+         *
          * The `Matter.Composite` module contains methods for creating and manipulating composite bodies.
          * A composite body is a collection of `Matter.Body`, `Matter.Constraint` and other `Matter.Composite`, therefore composites form a tree structure.
          * It is important to use the functions in this module to modify composites, rather than directly modifying their properties.
@@ -193,9 +194,22 @@ var MatterPhysics = new Class({
 
         //  Collision:
 
+        /**
+         * A reference to the `Matter.Collision` module.
+         *
+         * The `Matter.Collision` module contains methods for detecting collisions between a given pair of bodies.
+         *
+         * For efficient detection between a list of bodies, see `Matter.Detector` and `Matter.Query`.
+         *
+         * @name Phaser.Physics.Matter.MatterPhysics#collision
+         * @type {MatterJS.Collision}
+         * @since 3.60.0
+         */
+        this.collision = Collision;
+
         /**
          * A reference to the `Matter.Detector` module.
-         * 
+         *
          * The `Matter.Detector` module contains methods for detecting collisions given a set of pairs.
          *
          * @name Phaser.Physics.Matter.MatterPhysics#detector
@@ -206,7 +220,7 @@ var MatterPhysics = new Class({
 
         /**
          * A reference to the `Matter.Grid` module.
-         * 
+         *
          * The `Matter.Grid` module contains methods for creating and manipulating collision broadphase grid structures.
          *
          * @name Phaser.Physics.Matter.MatterPhysics#grid
@@ -217,7 +231,7 @@ var MatterPhysics = new Class({
 
         /**
          * A reference to the `Matter.Pair` module.
-         * 
+         *
          * The `Matter.Pair` module contains methods for creating and manipulating collision pairs.
          *
          * @name Phaser.Physics.Matter.MatterPhysics#pair
@@ -228,7 +242,7 @@ var MatterPhysics = new Class({
 
         /**
          * A reference to the `Matter.Pairs` module.
-         * 
+         *
          * The `Matter.Pairs` module contains methods for creating and manipulating collision pair sets.
          *
          * @name Phaser.Physics.Matter.MatterPhysics#pairs
@@ -239,7 +253,7 @@ var MatterPhysics = new Class({
 
         /**
          * A reference to the `Matter.Query` module.
-         * 
+         *
          * The `Matter.Query` module contains methods for performing collision queries.
          *
          * @name Phaser.Physics.Matter.MatterPhysics#query
@@ -250,7 +264,7 @@ var MatterPhysics = new Class({
 
         /**
          * A reference to the `Matter.Resolver` module.
-         * 
+         *
          * The `Matter.Resolver` module contains methods for resolving collision pairs.
          *
          * @name Phaser.Physics.Matter.MatterPhysics#resolver
@@ -261,7 +275,7 @@ var MatterPhysics = new Class({
 
         /**
          * A reference to the `Matter.SAT` module.
-         * 
+         *
          * The `Matter.SAT` module contains methods for detecting collisions using the Separating Axis Theorem.
          *
          * @name Phaser.Physics.Matter.MatterPhysics#sat
@@ -274,7 +288,7 @@ var MatterPhysics = new Class({
 
         /**
          * A reference to the `Matter.Constraint` module.
-         * 
+         *
          * The `Matter.Constraint` module contains methods for creating and manipulating constraints.
          * Constraints are used for specifying that a fixed distance must be maintained between two bodies (or a body and a fixed world-space position).
          * The stiffness of constraints can be modified to create springs or elastic.
@@ -289,7 +303,7 @@ var MatterPhysics = new Class({
 
         /**
          * A reference to the `Matter.Bodies` module.
-         * 
+         *
          * The `Matter.Bodies` module contains factory methods for creating rigid bodies
          * with commonly used body configurations (such as rectangles, circles and other polygons).
          *
@@ -301,7 +315,7 @@ var MatterPhysics = new Class({
 
         /**
          * A reference to the `Matter.Composites` module.
-         * 
+         *
          * The `Matter.Composites` module contains factory methods for creating composite bodies
          * with commonly used configurations (such as stacks and chains).
          *
@@ -315,7 +329,7 @@ var MatterPhysics = new Class({
 
         /**
          * A reference to the `Matter.Axes` module.
-         * 
+         *
          * The `Matter.Axes` module contains methods for creating and manipulating sets of axes.
          *
          * @name Phaser.Physics.Matter.MatterPhysics#axes
@@ -326,7 +340,7 @@ var MatterPhysics = new Class({
 
         /**
          * A reference to the `Matter.Bounds` module.
-         * 
+         *
          * The `Matter.Bounds` module contains methods for creating and manipulating axis-aligned bounding boxes (AABB).
          *
          * @name Phaser.Physics.Matter.MatterPhysics#bounds
@@ -337,7 +351,7 @@ var MatterPhysics = new Class({
 
         /**
          * A reference to the `Matter.Svg` module.
-         * 
+         *
          * The `Matter.Svg` module contains methods for converting SVG images into an array of vector points.
          *
          * To use this module you also need the SVGPathSeg polyfill: https://github.com/progers/pathseg
@@ -350,7 +364,7 @@ var MatterPhysics = new Class({
 
         /**
          * A reference to the `Matter.Vector` module.
-         * 
+         *
          * The `Matter.Vector` module contains methods for creating and manipulating vectors.
          * Vectors are the basis of all the geometry related operations in the engine.
          * A `Matter.Vector` object is of the form `{ x: 0, y: 0 }`.
@@ -363,7 +377,7 @@ var MatterPhysics = new Class({
 
         /**
          * A reference to the `Matter.Vertices` module.
-         * 
+         *
          * The `Matter.Vertices` module contains methods for creating and manipulating sets of vertices.
          * A set of vertices is an array of `Matter.Vector` with additional indexing properties inserted by `Vertices.create`.
          * A `Matter.Body` maintains a set of vertices to represent the shape of the object (its convex hull).
@@ -376,7 +390,7 @@ var MatterPhysics = new Class({
 
         /**
          * A reference to the `Matter.Vertices` module.
-         * 
+         *
          * The `Matter.Vertices` module contains methods for creating and manipulating sets of vertices.
          * A set of vertices is an array of `Matter.Vector` with additional indexing properties inserted by `Vertices.create`.
          * A `Matter.Body` maintains a set of vertices to represent the shape of the object (its convex hull).
@@ -488,18 +502,18 @@ var MatterPhysics = new Class({
 
     /**
      * Enables the Matter Attractors Plugin.
-     * 
+     *
      * The attractors plugin that makes it easy to apply continual forces on bodies.
      * It's possible to simulate effects such as wind, gravity and magnetism.
-     * 
+     *
      * https://github.com/liabru/matter-attractors
-     * 
+     *
      * This method is called automatically if `plugins.attractors` is set in the Matter World Config.
      * However, you can also call it directly from within your game.
      *
      * @method Phaser.Physics.Matter.MatterPhysics#enableAttractorPlugin
      * @since 3.0.0
-     * 
+     *
      * @return {this} This Matter Physics instance.
      */
     enableAttractorPlugin: function ()
@@ -512,19 +526,19 @@ var MatterPhysics = new Class({
 
     /**
      * Enables the Matter Wrap Plugin.
-     * 
+     *
      * The coordinate wrapping plugin that automatically wraps the position of bodies such that they always stay
      * within the given bounds. Upon crossing a boundary the body will appear on the opposite side of the bounds,
      * while maintaining its velocity.
-     * 
+     *
      * https://github.com/liabru/matter-wrap
-     * 
+     *
      * This method is called automatically if `plugins.wrap` is set in the Matter World Config.
      * However, you can also call it directly from within your game.
      *
      * @method Phaser.Physics.Matter.MatterPhysics#enableWrapPlugin
      * @since 3.0.0
-     * 
+     *
      * @return {this} This Matter Physics instance.
      */
     enableWrapPlugin: function ()
@@ -537,33 +551,33 @@ var MatterPhysics = new Class({
 
     /**
      * Enables the Matter Collision Events Plugin.
-     * 
+     *
      * Note that this plugin is enabled by default. So you should only ever need to call this
      * method if you have specifically disabled the plugin in your Matter World Config.
      * You can disable it by setting `plugins.collisionevents: false` in your Matter World Config.
-     * 
+     *
      * This plugin triggers three new events on Matter.Body:
-     * 
+     *
      * 1. `onCollide`
      * 2. `onCollideEnd`
      * 3. `onCollideActive`
-     * 
+     *
      * These events correspond to the Matter.js events `collisionStart`, `collisionActive` and `collisionEnd`, respectively.
      * You can listen to these events via Matter.Events or they will also be emitted from the Matter World.
-     * 
+     *
      * This plugin also extends Matter.Body with three convenience functions:
-     * 
+     *
      * `Matter.Body.setOnCollide(callback)`
      * `Matter.Body.setOnCollideEnd(callback)`
      * `Matter.Body.setOnCollideActive(callback)`
-     * 
+     *
      * You can register event callbacks by providing a function of type (pair: Matter.Pair) => void
-     * 
+     *
      * https://github.com/dxu/matter-collision-events
      *
      * @method Phaser.Physics.Matter.MatterPhysics#enableCollisionEventsPlugin
      * @since 3.22.0
-     * 
+     *
      * @return {this} This Matter Physics instance.
      */
     enableCollisionEventsPlugin: function ()
@@ -576,7 +590,7 @@ var MatterPhysics = new Class({
 
     /**
      * Pauses the Matter World instance and sets `enabled` to `false`.
-     * 
+     *
      * A paused world will not run any simulations for the duration it is paused.
      *
      * @method Phaser.Physics.Matter.MatterPhysics#pause
@@ -639,12 +653,12 @@ var MatterPhysics = new Class({
 
     /**
      * Manually advances the physics simulation by one iteration.
-     * 
+     *
      * You can optionally pass in the `delta` and `correction` values to be used by Engine.update.
      * If undefined they use the Matter defaults of 60Hz and no correction.
-     * 
+     *
      * Calling `step` directly bypasses any checks of `enabled` or `autoUpdate`.
-     * 
+     *
      * It also ignores any custom `getDelta` functions, as you should be passing the delta
      * value in to this call.
      *
@@ -671,22 +685,22 @@ var MatterPhysics = new Class({
 
     /**
      * Checks if the vertices of the given body, or an array of bodies, contains the given point, or not.
-     * 
+     *
      * You can pass in either a single body, or an array of bodies to be checked. This method will
      * return `true` if _any_ of the bodies in the array contain the point. See the `intersectPoint` method if you need
      * to get a list of intersecting bodies.
-     * 
+     *
      * The point should be transformed into the Matter World coordinate system in advance. This happens by
      * default with Input Pointers, but if you wish to use points from another system you may need to
      * transform them before passing them.
-     * 
+     *
      * @method Phaser.Physics.Matter.MatterPhysics#containsPoint
      * @since 3.22.0
      *
      * @param {(Phaser.Types.Physics.Matter.MatterBody|Phaser.Types.Physics.Matter.MatterBody[])} body - The body, or an array of bodies, to check against the point.
      * @param {number} x - The horizontal coordinate of the point.
      * @param {number} y - The vertical coordinate of the point.
-     * 
+     *
      * @return {boolean} `true` if the point is within one of the bodies given, otherwise `false`.
      */
     containsPoint: function (body, x, y)
@@ -702,20 +716,20 @@ var MatterPhysics = new Class({
 
     /**
      * Checks the given coordinates to see if any vertices of the given bodies contain it.
-     * 
+     *
      * If no bodies are provided it will search all bodies in the Matter World, including within Composites.
-     * 
+     *
      * The coordinates should be transformed into the Matter World coordinate system in advance. This happens by
      * default with Input Pointers, but if you wish to use coordinates from another system you may need to
      * transform them before passing them.
-     * 
+     *
      * @method Phaser.Physics.Matter.MatterPhysics#intersectPoint
      * @since 3.22.0
      *
      * @param {number} x - The horizontal coordinate of the point.
      * @param {number} y - The vertical coordinate of the point.
      * @param {Phaser.Types.Physics.Matter.MatterBody[]} [bodies] - An array of bodies to check. If not provided it will search all bodies in the world.
-     * 
+     *
      * @return {Phaser.Types.Physics.Matter.MatterBody[]} An array of bodies which contain the given point.
      */
     intersectPoint: function (x, y, bodies)
@@ -743,9 +757,9 @@ var MatterPhysics = new Class({
      * Checks the given rectangular area to see if any vertices of the given bodies intersect with it.
      * Or, if the `outside` parameter is set to `true`, it checks to see which bodies do not
      * intersect with it.
-     * 
+     *
      * If no bodies are provided it will search all bodies in the Matter World, including within Composites.
-     * 
+     *
      * @method Phaser.Physics.Matter.MatterPhysics#intersectRect
      * @since 3.22.0
      *
@@ -755,7 +769,7 @@ var MatterPhysics = new Class({
      * @param {number} height - The height of the area.
      * @param {boolean} [outside=false] - If `false` it checks for vertices inside the area, if `true` it checks for vertices outside the area.
      * @param {Phaser.Types.Physics.Matter.MatterBody[]} [bodies] - An array of bodies to check. If not provided it will search all bodies in the world.
-     * 
+     *
      * @return {Phaser.Types.Physics.Matter.MatterBody[]} An array of bodies that intersect with the given area.
      */
     intersectRect: function (x, y, width, height, outside, bodies)
@@ -786,11 +800,11 @@ var MatterPhysics = new Class({
 
     /**
      * Checks the given ray segment to see if any vertices of the given bodies intersect with it.
-     * 
+     *
      * If no bodies are provided it will search all bodies in the Matter World.
-     * 
+     *
      * The width of the ray can be specified via the `rayWidth` parameter.
-     * 
+     *
      * @method Phaser.Physics.Matter.MatterPhysics#intersectRay
      * @since 3.22.0
      *
@@ -800,13 +814,13 @@ var MatterPhysics = new Class({
      * @param {number} y2 - The vertical coordinate of the end of the ray segment.
      * @param {number} [rayWidth=1] - The width of the ray segment.
      * @param {Phaser.Types.Physics.Matter.MatterBody[]} [bodies] - An array of bodies to check. If not provided it will search all bodies in the world.
-     * 
+     *
      * @return {Phaser.Types.Physics.Matter.MatterBody[]} An array of bodies whos vertices intersect with the ray segment.
      */
     intersectRay: function (x1, y1, x2, y2, rayWidth, bodies)
     {
         if (rayWidth === undefined) { rayWidth = 1; }
-        
+
         bodies = this.getMatterBodies(bodies);
 
         var result = [];
@@ -822,15 +836,15 @@ var MatterPhysics = new Class({
 
     /**
      * Checks the given Matter Body to see if it intersects with any of the given bodies.
-     * 
+     *
      * If no bodies are provided it will check against all bodies in the Matter World.
-     * 
+     *
      * @method Phaser.Physics.Matter.MatterPhysics#intersectBody
      * @since 3.22.0
      *
      * @param {Phaser.Types.Physics.Matter.MatterBody} body - The target body.
      * @param {Phaser.Types.Physics.Matter.MatterBody[]} [bodies] - An array of bodies to check the target body against. If not provided it will search all bodies in the world.
-     * 
+     *
      * @return {Phaser.Types.Physics.Matter.MatterBody[]} An array of bodies whos vertices intersect with target body.
      */
     intersectBody: function (body, bodies)
@@ -859,22 +873,22 @@ var MatterPhysics = new Class({
 
     /**
      * Checks to see if the target body, or an array of target bodies, intersects with any of the given bodies.
-     * 
+     *
      * If intersection occurs this method will return `true` and, if provided, invoke the callbacks.
-     * 
+     *
      * If no bodies are provided for the second parameter the target will check again all bodies in the Matter World.
-     * 
+     *
      * Note that bodies can only overlap if they are in non-colliding collision groups or categories.
-     * 
+     *
      * If you provide a `processCallback` then the two bodies that overlap are sent to it. This callback
      * must return a boolean and is used to allow you to perform additional processing tests before a final
      * outcome is decided. If it returns `true` then the bodies are finally passed to the `overlapCallback`, if set.
-     * 
+     *
      * If you provide an `overlapCallback` then the matching pairs of overlapping bodies will be sent to it.
-     * 
+     *
      * Both callbacks have the following signature: `function (bodyA, bodyB, collisionInfo)` where `bodyA` is always
      * the target body. The `collisionInfo` object contains additional data, such as the angle and depth of penetration.
-     * 
+     *
      * @method Phaser.Physics.Matter.MatterPhysics#overlap
      * @since 3.22.0
      *
@@ -883,7 +897,7 @@ var MatterPhysics = new Class({
      * @param {ArcadePhysicsCallback} [overlapCallback] - An optional callback function that is called if the bodies overlap.
      * @param {ArcadePhysicsCallback} [processCallback] - An optional callback function that lets you perform additional checks against the two bodies if they overlap. If this is set then `overlapCallback` will only be invoked if this callback returns `true`.
      * @param {*} [callbackContext] - The context, or scope, in which to run the callbacks.
-     * 
+     *
      * @return {boolean} `true` if the target body intersects with _any_ of the bodies given, otherwise `false`.
      */
     overlap: function (target, bodies, overlapCallback, processCallback, callbackContext)
@@ -935,9 +949,9 @@ var MatterPhysics = new Class({
 
     /**
      * Sets the collision filter category of all given Matter Bodies to the given value.
-     * 
+     *
      * This number must be a power of two between 2^0 (= 1) and 2^31.
-     * 
+     *
      * Bodies with different collision groups (see {@link #setCollisionGroup}) will only collide if their collision
      * categories are included in their collision masks (see {@link #setCollidesWith}).
      *
@@ -963,10 +977,10 @@ var MatterPhysics = new Class({
 
     /**
      * Sets the collision filter group of all given Matter Bodies to the given value.
-     * 
+     *
      * If the group value is zero, or if two Matter Bodies have different group values,
      * they will collide according to the usual collision filter rules (see {@link #setCollisionCategory} and {@link #setCollisionGroup}).
-     * 
+     *
      * If two Matter Bodies have the same positive group value, they will always collide;
      * if they have the same negative group value they will never collide.
      *
@@ -992,9 +1006,9 @@ var MatterPhysics = new Class({
 
     /**
      * Sets the collision filter mask of all given Matter Bodies to the given value.
-     * 
+     *
      * Two Matter Bodies with different collision groups will only collide if each one includes the others
-     * category in its mask based on a bitwise AND operation: `(categoryA & maskB) !== 0` and 
+     * category in its mask based on a bitwise AND operation: `(categoryA & maskB) !== 0` and
      * `(categoryB & maskA) !== 0` are both true.
      *
      * @method Phaser.Physics.Matter.MatterPhysics#setCollidesWith
@@ -1033,10 +1047,10 @@ var MatterPhysics = new Class({
 
     /**
      * Takes an array and returns a new array made from all of the Matter Bodies found in the original array.
-     * 
+     *
      * For example, passing in Matter Game Objects, such as a bunch of Matter Sprites, to this method, would
      * return an array containing all of their native Matter Body objects.
-     * 
+     *
      * If the `bodies` argument is falsey, it will return all bodies in the world.
      *
      * @method Phaser.Physics.Matter.MatterPhysics#getMatterBodies
@@ -1212,7 +1226,7 @@ var MatterPhysics = new Class({
     /**
      * Applies a force to a body, from the given world position, including resulting torque.
      * If no angle is given, the current body angle is used.
-     * 
+     *
      * Use very small speed values, such as 0.1, depending on the mass and required velocity.
      *
      * @method Phaser.Physics.Matter.MatterPhysics#applyForceFromPosition
@@ -1250,7 +1264,7 @@ var MatterPhysics = new Class({
     /**
      * Apply a force to a body based on the given angle and speed.
      * If no angle is given, the current body angle is used.
-     * 
+     *
      * Use very small speed values, such as 0.1, depending on the mass and required velocity.
      *
      * @method Phaser.Physics.Matter.MatterPhysics#applyForceFromAngle
@@ -1318,22 +1332,22 @@ var MatterPhysics = new Class({
 
     /**
      * Aligns a Body, or Matter Game Object, against the given coordinates.
-     * 
+     *
      * The alignment takes place using the body bounds, which take into consideration things
      * like body scale and rotation.
-     * 
+     *
      * Although a Body has a `position` property, it is based on the center of mass for the body,
      * not a dimension based center. This makes aligning bodies difficult, especially if they have
      * rotated or scaled. This method will derive the correct position based on the body bounds and
      * its center of mass offset, in order to align the body with the given coordinate.
-     * 
+     *
      * For example, if you wanted to align a body so it sat in the bottom-center of the
      * Scene, and the world was 800 x 600 in size:
-     * 
+     *
      * ```javascript
      * this.matter.alignBody(body, 400, 600, Phaser.Display.Align.BOTTOM_CENTER);
      * ```
-     * 
+     *
      * You pass in 400 for the x coordinate, because that is the center of the world, and 600 for
      * the y coordinate, as that is the base of the world.
      *
@@ -1363,7 +1377,7 @@ var MatterPhysics = new Class({
             case ALIGN_CONST.TOP_CENTER:
                 pos = this.bodyBounds.getTopCenter(body, x, y);
                 break;
-    
+
             case ALIGN_CONST.TOP_RIGHT:
             case ALIGN_CONST.RIGHT_TOP:
                 pos = this.bodyBounds.getTopRight(body, x, y);

src/physics/matter-js/lib/body/Composite.js

@@ -37,7 +37,12 @@ var Body = require('./Body');
             constraints: [], 
             composites: [],
             label: 'Composite',
-            plugin: {}
+            plugin: {},
+            cache: {
+                allBodies: null,
+                allConstraints: null,
+                allComposites: null
+            }
         }, options);
     };
 
@@ -57,12 +62,18 @@ var Body = require('./Body');
 
         composite.isModified = isModified;
 
+        if (isModified && composite.cache) {
+            composite.cache.allBodies = null;
+            composite.cache.allConstraints = null;
+            composite.cache.allComposites = null;
+        }
+
         if (updateParents && composite.parent) {
             Composite.setModified(composite.parent, isModified, updateParents, updateChildren);
         }
 
         if (updateChildren) {
-            for(var i = 0; i < composite.composites.length; i++) {
+            for (var i = 0; i < composite.composites.length; i++) {
                 var childComposite = composite.composites[i];
                 Composite.setModified(childComposite, isModified, updateParents, updateChildren);
             }
@@ -70,11 +81,11 @@ var Body = require('./Body');
     };
 
     /**
-     * Generic add function. Adds one or many body(s), constraint(s) or a composite(s) to the given composite.
+     * Generic single or multi-add function. Adds a single or an array of body(s), constraint(s) or composite(s) to the given composite.
      * Triggers `beforeAdd` and `afterAdd` events on the `composite`.
      * @method add
      * @param {composite} composite
-     * @param {} object
+     * @param {object|array} object A single or an array of body(s), constraint(s) or composite(s)
      * @return {composite} The original composite with the objects added
      */
     Composite.add = function(composite, object) {
@@ -120,7 +131,7 @@ var Body = require('./Body');
      * Triggers `beforeRemove` and `afterRemove` events on the `composite`.
      * @method remove
      * @param {composite} composite
-     * @param {} object
+     * @param {object|array} object
      * @param {boolean} [deep=false]
      * @return {composite} The original composite with the objects removed
      */
@@ -180,10 +191,9 @@ var Body = require('./Body');
      * @return {composite} The original compositeA with the composite removed
      */
     Composite.removeComposite = function(compositeA, compositeB, deep) {
-        var position = compositeA.composites.indexOf(compositeB);
+        var position = Common.indexOf(compositeA.composites, compositeB);
         if (position !== -1) {
             Composite.removeCompositeAt(compositeA, position);
-            Composite.setModified(compositeA, true, true, false);
         }
 
         if (deep) {
@@ -233,10 +243,9 @@ var Body = require('./Body');
      * @return {composite} The original composite with the body removed
      */
     Composite.removeBody = function(composite, body, deep) {
-        var position = composite.bodies.indexOf(body);
+        var position = Common.indexOf(composite.bodies, body);
         if (position !== -1) {
             Composite.removeBodyAt(composite, position);
-            Composite.setModified(composite, true, true, false);
         }
 
         if (deep) {
@@ -286,7 +295,7 @@ var Body = require('./Body');
      * @return {composite} The original composite with the constraint removed
      */
     Composite.removeConstraint = function(composite, constraint, deep) {
-        var position = composite.constraints.indexOf(constraint);
+        var position = Common.indexOf(composite.constraints, constraint);
         if (position !== -1) {
             Composite.removeConstraintAt(composite, position);
         }
@@ -337,6 +346,7 @@ var Body = require('./Body');
 
         composite.constraints.length = 0;
         composite.composites.length = 0;
+
         Composite.setModified(composite, true, true, false);
 
         return composite;
@@ -349,11 +359,19 @@ var Body = require('./Body');
      * @return {body[]} All the bodies
      */
     Composite.allBodies = function(composite) {
+        if (composite.cache && composite.cache.allBodies) {
+            return composite.cache.allBodies;
+        }
+
         var bodies = [].concat(composite.bodies);
 
         for (var i = 0; i < composite.composites.length; i++)
             bodies = bodies.concat(Composite.allBodies(composite.composites[i]));
 
+        if (composite.cache) {
+            composite.cache.allBodies = bodies;
+        }
+
         return bodies;
     };
 
@@ -364,11 +382,19 @@ var Body = require('./Body');
      * @return {constraint[]} All the constraints
      */
     Composite.allConstraints = function(composite) {
+        if (composite.cache && composite.cache.allConstraints) {
+            return composite.cache.allConstraints;
+        }
+
         var constraints = [].concat(composite.constraints);
 
         for (var i = 0; i < composite.composites.length; i++)
             constraints = constraints.concat(Composite.allConstraints(composite.composites[i]));
 
+        if (composite.cache) {
+            composite.cache.allConstraints = constraints;
+        }
+
         return constraints;
     };
 
@@ -379,11 +405,19 @@ var Body = require('./Body');
      * @return {composite[]} All the composites
      */
     Composite.allComposites = function(composite) {
+        if (composite.cache && composite.cache.allComposites) {
+            return composite.cache.allComposites;
+        }
+
         var composites = [].concat(composite.composites);
 
         for (var i = 0; i < composite.composites.length; i++)
             composites = composites.concat(Composite.allComposites(composite.composites[i]));
 
+        if (composite.cache) {
+            composite.cache.allComposites = composites;
+        }
+
         return composites;
     };
 
@@ -450,8 +484,6 @@ var Body = require('./Body');
             objects[i].id = Common.nextId();
         }
 
-        Composite.setModified(composite, true, true, false);
-
         return composite;
     };
 
@@ -470,8 +502,6 @@ var Body = require('./Body');
             Body.translate(bodies[i], translation);
         }
 
-        Composite.setModified(composite, true, true, false);
-
         return composite;
     };
 
@@ -501,8 +531,6 @@ var Body = require('./Body');
             Body.rotate(body, rotation);
         }
 
-        Composite.setModified(composite, true, true, false);
-
         return composite;
     };
 
@@ -531,8 +559,6 @@ var Body = require('./Body');
             Body.scale(body, scaleX, scaleY);
         }
 
-        Composite.setModified(composite, true, true, false);
-
         return composite;
     };
 
@@ -685,4 +711,13 @@ var Body = require('./Body');
      * @type {}
      */
 
+    /**
+     * An object used for storing cached results for performance reasons.
+     * This is used internally only and is automatically managed.
+     *
+     * @private
+     * @property cache
+     * @type {}
+     */
+
 })();

src/physics/matter-js/lib/body/World.js

@@ -1,11 +1,13 @@
 /**
-* The `Matter.World` module contains methods for creating and manipulating the world composite.
-* A `Matter.World` is a `Matter.Composite` body, which is a collection of `Matter.Body`, `Matter.Constraint` and other `Matter.Composite`.
-* A `Matter.World` has a few additional properties including `gravity` and `bounds`.
-* It is important to use the functions in the `Matter.Composite` module to modify the world composite, rather than directly modifying its properties.
-* There are also a few methods here that alias those in `Matter.Composite` for easier readability.
+* This module has now been replaced by `Matter.Composite`.
 *
-* See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples).
+* All usage should be migrated to the equivalent functions found on `Matter.Composite`.
+* For example `World.add(world, body)` now becomes `Composite.add(world, body)`.
+*
+* The property `world.gravity` has been moved to `engine.gravity`.
+*
+* For back-compatibility purposes this module will remain as a direct alias to `Matter.Composite` in the short term during migration.
+* Eventually this alias module will be marked as deprecated and then later removed in a future release.
 *
 * @class World
 * @extends Composite
@@ -16,37 +18,19 @@ var World = {};
 module.exports = World;
 
 var Composite = require('./Composite');
-var Constraint = require('../constraint/Constraint');
-var Common = require('../core/Common');
 
 (function() {
 
     /**
-     * Creates a new world composite. The options parameter is an object that specifies any properties you wish to override the defaults.
-     * See the properties section below for detailed information on what you can pass via the `options` object.
-     * @method create
-     * @constructor
-     * @param {} options
-     * @return {world} A new world
+     * See above, aliases for back compatibility only
      */
-    World.create = function(options) {
-        var composite = Composite.create();
-
-        var defaults = {
-            label: 'World',
-            gravity: {
-                x: 0,
-                y: 1,
-                scale: 0.001
-            },
-            bounds: { 
-                min: { x: -Infinity, y: -Infinity }, 
-                max: { x: Infinity, y: Infinity } 
-            }
-        };
-        
-        return Common.extend(composite, defaults, options);
-    };
+    World.create = Composite.create;
+    World.add = Composite.add;
+    World.remove = Composite.remove;
+    World.clear = Composite.clear;
+    World.addComposite = Composite.addComposite;
+    World.addBody = Composite.addBody;
+    World.addConstraint = Composite.addConstraint;
 
     /*
     *
@@ -95,7 +79,7 @@ var Common = require('../core/Common');
 
     // World is a Composite body
     // see src/module/Outro.js for these aliases:
-    
+
     /**
      * An alias for Composite.add
      * @method add
@@ -127,7 +111,7 @@ var Common = require('../core/Common');
      * @param {composite} composite
      * @return {world} The original world with the objects from composite added
      */
-    
+
      /**
       * An alias for Composite.addBody
       * @method addBody

src/physics/matter-js/lib/collision/Collision.js

@@ -0,0 +1,408 @@
+/**
+* The `Matter.Collision` module contains methods for detecting collisions between a given pair of bodies.
+*
+* For efficient detection between a list of bodies, see `Matter.Detector` and `Matter.Query`.
+*
+* See `Matter.Engine` for collision events.
+*
+* @class Collision
+*/
+
+var Collision = {};
+
+module.exports = Collision;
+
+var Vertices = require('../geometry/Vertices');
+var Pair = require('./Pair');
+
+(function() {
+    var _supports = [];
+
+    var _overlapAB = {
+        overlap: 0,
+        axis: null
+    };
+
+    var _overlapBA = {
+        overlap: 0,
+        axis: null
+    };
+
+    /**
+     * Creates a new collision record.
+     * @method create
+     * @param {body} bodyA The first body part represented by the collision record
+     * @param {body} bodyB The second body part represented by the collision record
+     * @return {collision} A new collision record
+     */
+    Collision.create = function(bodyA, bodyB) {
+        return { 
+            pair: null,
+            collided: false,
+            bodyA: bodyA,
+            bodyB: bodyB,
+            parentA: bodyA.parent,
+            parentB: bodyB.parent,
+            depth: 0,
+            normal: { x: 0, y: 0 },
+            tangent: { x: 0, y: 0 },
+            penetration: { x: 0, y: 0 },
+            supports: []
+        };
+    };
+
+    /**
+     * Detect collision between two bodies.
+     * @method collides
+     * @param {body} bodyA
+     * @param {body} bodyB
+     * @param {pairs} [pairs] Optionally reuse collision records from existing pairs.
+     * @return {collision|null} A collision record if detected, otherwise null
+     */
+    Collision.collides = function(bodyA, bodyB, pairs) {
+        Collision._overlapAxes(_overlapAB, bodyA.vertices, bodyB.vertices, bodyA.axes);
+
+        if (_overlapAB.overlap <= 0) {
+            return null;
+        }
+
+        Collision._overlapAxes(_overlapBA, bodyB.vertices, bodyA.vertices, bodyB.axes);
+
+        if (_overlapBA.overlap <= 0) {
+            return null;
+        }
+
+        // reuse collision records for gc efficiency
+        var pair = pairs && pairs.table[Pair.id(bodyA, bodyB)],
+            collision;
+
+        if (!pair) {
+            collision = Collision.create(bodyA, bodyB);
+            collision.collided = true;
+            collision.bodyA = bodyA.id < bodyB.id ? bodyA : bodyB;
+            collision.bodyB = bodyA.id < bodyB.id ? bodyB : bodyA;
+            collision.parentA = collision.bodyA.parent;
+            collision.parentB = collision.bodyB.parent;
+        } else {
+            collision = pair.collision;
+        }
+
+        bodyA = collision.bodyA;
+        bodyB = collision.bodyB;
+
+        var minOverlap;
+
+        if (_overlapAB.overlap < _overlapBA.overlap) {
+            minOverlap = _overlapAB;
+        } else {
+            minOverlap = _overlapBA;
+        }
+
+        var normal = collision.normal,
+            supports = collision.supports,
+            minAxis = minOverlap.axis,
+            minAxisX = minAxis.x,
+            minAxisY = minAxis.y;
+
+        // ensure normal is facing away from bodyA
+        if (minAxisX * (bodyB.position.x - bodyA.position.x) + minAxisY * (bodyB.position.y - bodyA.position.y) < 0) {
+            normal.x = minAxisX;
+            normal.y = minAxisY;
+        } else {
+            normal.x = -minAxisX;
+            normal.y = -minAxisY;
+        }
+        
+        collision.tangent.x = -normal.y;
+        collision.tangent.y = normal.x;
+
+        collision.depth = minOverlap.overlap;
+
+        collision.penetration.x = normal.x * collision.depth;
+        collision.penetration.y = normal.y * collision.depth;
+
+        // find support points, there is always either exactly one or two
+        var supportsB = Collision._findSupports(bodyA, bodyB, normal, 1),
+            supportCount = 0;
+
+        // find the supports from bodyB that are inside bodyA
+        if (Vertices.contains(bodyA.vertices, supportsB[0])) {
+            supports[supportCount++] = supportsB[0];
+        }
+
+        if (Vertices.contains(bodyA.vertices, supportsB[1])) {
+            supports[supportCount++] = supportsB[1];
+        }
+
+        // find the supports from bodyA that are inside bodyB
+        if (supportCount < 2) {
+            var supportsA = Collision._findSupports(bodyB, bodyA, normal, -1);
+
+            if (Vertices.contains(bodyB.vertices, supportsA[0])) {
+                supports[supportCount++] = supportsA[0];
+            }
+
+            if (supportCount < 2 && Vertices.contains(bodyB.vertices, supportsA[1])) {
+                supports[supportCount++] = supportsA[1];
+            }
+        }
+
+        // account for the edge case of overlapping but no vertex containment
+        if (supportCount === 0) {
+            supports[supportCount++] = supportsB[0];
+        }
+
+        // update supports array size
+        supports.length = supportCount;
+
+        return collision;
+    };
+
+    /**
+     * Find the overlap between two sets of vertices.
+     * @method _overlapAxes
+     * @private
+     * @param {object} result
+     * @param {vertices} verticesA
+     * @param {vertices} verticesB
+     * @param {axes} axes
+     */
+    Collision._overlapAxes = function(result, verticesA, verticesB, axes) {
+        var verticesALength = verticesA.length,
+            verticesBLength = verticesB.length,
+            verticesAX = verticesA[0].x,
+            verticesAY = verticesA[0].y,
+            verticesBX = verticesB[0].x,
+            verticesBY = verticesB[0].y,
+            axesLength = axes.length,
+            overlapMin = Number.MAX_VALUE,
+            overlapAxisNumber = 0,
+            overlap,
+            overlapAB,
+            overlapBA,
+            dot,
+            i,
+            j;
+
+        for (i = 0; i < axesLength; i++) {
+            var axis = axes[i],
+                axisX = axis.x,
+                axisY = axis.y,
+                minA = verticesAX * axisX + verticesAY * axisY,
+                minB = verticesBX * axisX + verticesBY * axisY,
+                maxA = minA,
+                maxB = minB;
+            
+            for (j = 1; j < verticesALength; j += 1) {
+                dot = verticesA[j].x * axisX + verticesA[j].y * axisY;
+
+                if (dot > maxA) { 
+                    maxA = dot;
+                } else if (dot < minA) { 
+                    minA = dot;
+                }
+            }
+
+            for (j = 1; j < verticesBLength; j += 1) {
+                dot = verticesB[j].x * axisX + verticesB[j].y * axisY;
+
+                if (dot > maxB) { 
+                    maxB = dot;
+                } else if (dot < minB) { 
+                    minB = dot;
+                }
+            }
+
+            overlapAB = maxA - minB;
+            overlapBA = maxB - minA;
+            overlap = overlapAB < overlapBA ? overlapAB : overlapBA;
+
+            if (overlap < overlapMin) {
+                overlapMin = overlap;
+                overlapAxisNumber = i;
+
+                if (overlap <= 0) {
+                    // can not be intersecting
+                    break;
+                }
+            } 
+        }
+
+        result.axis = axes[overlapAxisNumber];
+        result.overlap = overlapMin;
+    };
+
+    /**
+     * Projects vertices on an axis and returns an interval.
+     * @method _projectToAxis
+     * @private
+     * @param {} projection
+     * @param {} vertices
+     * @param {} axis
+     */
+    Collision._projectToAxis = function(projection, vertices, axis) {
+        var min = vertices[0].x * axis.x + vertices[0].y * axis.y,
+            max = min;
+
+        for (var i = 1; i < vertices.length; i += 1) {
+            var dot = vertices[i].x * axis.x + vertices[i].y * axis.y;
+
+            if (dot > max) { 
+                max = dot; 
+            } else if (dot < min) { 
+                min = dot; 
+            }
+        }
+
+        projection.min = min;
+        projection.max = max;
+    };
+
+    /**
+     * Finds supporting vertices given two bodies along a given direction using hill-climbing.
+     * @method _findSupports
+     * @private
+     * @param {body} bodyA
+     * @param {body} bodyB
+     * @param {vector} normal
+     * @param {number} direction
+     * @return [vector]
+     */
+    Collision._findSupports = function(bodyA, bodyB, normal, direction) {
+        var vertices = bodyB.vertices,
+            verticesLength = vertices.length,
+            bodyAPositionX = bodyA.position.x,
+            bodyAPositionY = bodyA.position.y,
+            normalX = normal.x * direction,
+            normalY = normal.y * direction,
+            nearestDistance = Number.MAX_VALUE,
+            vertexA,
+            vertexB,
+            vertexC,
+            distance,
+            j;
+
+        // find deepest vertex relative to the axis
+        for (j = 0; j < verticesLength; j += 1) {
+            vertexB = vertices[j];
+            distance = normalX * (bodyAPositionX - vertexB.x) + normalY * (bodyAPositionY - vertexB.y);
+
+            // convex hill-climbing
+            if (distance < nearestDistance) {
+                nearestDistance = distance;
+                vertexA = vertexB;
+            }
+        }
+
+        // measure next vertex
+        vertexC = vertices[(verticesLength + vertexA.index - 1) % verticesLength];
+        nearestDistance = normalX * (bodyAPositionX - vertexC.x) + normalY * (bodyAPositionY - vertexC.y);
+
+        // compare with previous vertex
+        vertexB = vertices[(vertexA.index + 1) % verticesLength];
+        if (normalX * (bodyAPositionX - vertexB.x) + normalY * (bodyAPositionY - vertexB.y) < nearestDistance) {
+            _supports[0] = vertexA;
+            _supports[1] = vertexB;
+
+            return _supports;
+        }
+
+        _supports[0] = vertexA;
+        _supports[1] = vertexC;
+
+        return _supports;
+    };
+
+    /*
+    *
+    *  Properties Documentation
+    *
+    */
+
+    /**
+     * A reference to the pair using this collision record, if there is one.
+     *
+     * @property pair
+     * @type {pair|null}
+     * @default null
+     */
+
+    /**
+     * A flag that indicates if the bodies were colliding when the collision was last updated.
+     * 
+     * @property collided
+     * @type boolean
+     * @default false
+     */
+
+    /**
+     * The first body part represented by the collision (see also `collision.parentA`).
+     * 
+     * @property bodyA
+     * @type body
+     */
+
+    /**
+     * The second body part represented by the collision (see also `collision.parentB`).
+     * 
+     * @property bodyB
+     * @type body
+     */
+
+    /**
+     * The first body represented by the collision (i.e. `collision.bodyA.parent`).
+     * 
+     * @property parentA
+     * @type body
+     */
+
+    /**
+     * The second body represented by the collision (i.e. `collision.bodyB.parent`).
+     * 
+     * @property parentB
+     * @type body
+     */
+
+    /**
+     * A `Number` that represents the minimum separating distance between the bodies along the collision normal.
+     *
+     * @readOnly
+     * @property depth
+     * @type number
+     * @default 0
+     */
+
+    /**
+     * A normalised `Vector` that represents the direction between the bodies that provides the minimum separating distance.
+     *
+     * @property normal
+     * @type vector
+     * @default { x: 0, y: 0 }
+     */
+
+    /**
+     * A normalised `Vector` that is the tangent direction to the collision normal.
+     *
+     * @property tangent
+     * @type vector
+     * @default { x: 0, y: 0 }
+     */
+
+    /**
+     * A `Vector` that represents the direction and depth of the collision.
+     *
+     * @property penetration
+     * @type vector
+     * @default { x: 0, y: 0 }
+     */
+
+    /**
+     * An array of body vertices that represent the support points in the collision.
+     * These are the deepest vertices (along the collision normal) of each body that are contained by the other body's vertices.
+     *
+     * @property supports
+     * @type vector[]
+     * @default []
+     */
+
+})();

src/physics/matter-js/lib/collision/Contact.js

@@ -0,0 +1,27 @@
+/**
+* The `Matter.Contact` module contains methods for creating and manipulating collision contacts.
+*
+* @class Contact
+*/
+
+var Contact = {};
+
+module.exports = Contact;
+
+(function() {
+
+    /**
+     * Creates a new contact.
+     * @method create
+     * @param {vertex} vertex
+     * @return {contact} A new contact
+     */
+    Contact.create = function(vertex) {
+        return {
+            vertex: vertex,
+            normalImpulse: 0,
+            tangentImpulse: 0
+        };
+    };
+
+})();

src/physics/matter-js/lib/collision/Detector.js

@@ -1,84 +1,132 @@
 /**
-* The `Matter.Detector` module contains methods for detecting collisions given a set of pairs.
+* The `Matter.Detector` module contains methods for efficiently detecting collisions between a list of bodies using a broadphase algorithm.
 *
 * @class Detector
 */
 
-// TODO: speculative contacts
-
 var Detector = {};
 
 module.exports = Detector;
 
-var SAT = require('./SAT');
-var Pair = require('./Pair');
-var Bounds = require('../geometry/Bounds');
+var Common = require('../core/Common');
+var Collision = require('./Collision');
 
 (function() {
 
     /**
-     * Finds all collisions given a list of pairs.
-     * @method collisions
-     * @param {pair[]} broadphasePairs
-     * @param {engine} engine
-     * @return {array} collisions
+     * Creates a new collision detector.
+     * @method create
+     * @param {} options
+     * @return {detector} A new collision detector
      */
-    Detector.collisions = function(broadphasePairs, engine) {
+    Detector.create = function(options) {
+        var defaults = {
+            bodies: [],
+            pairs: null
+        };
+
+        return Common.extend(defaults, options);
+    };
+
+    /**
+     * Sets the list of bodies in the detector.
+     * @method setBodies
+     * @param {detector} detector
+     * @param {body[]} bodies
+     */
+    Detector.setBodies = function(detector, bodies) {
+        detector.bodies = bodies.slice(0);
+    };
+
+    /**
+     * Clears the detector including its list of bodies.
+     * @method clear
+     * @param {detector} detector
+     */
+    Detector.clear = function(detector) {
+        detector.bodies = [];
+    };
+
+    /**
+     * Efficiently finds all collisions among all the bodies in `detector.bodies` using a broadphase algorithm.
+     * 
+     * _Note:_ The specific ordering of collisions returned is not guaranteed between releases and may change for performance reasons.
+     * If a specific ordering is required then apply a sort to the resulting array.
+     * @method collisions
+     * @param {detector} detector
+     * @return {collision[]} collisions
+     */
+    Detector.collisions = function(detector) {
         var collisions = [],
-            pairsTable = engine.pairs.table;
+            pairs = detector.pairs,
+            bodies = detector.bodies,
+            bodiesLength = bodies.length,
+            canCollide = Detector.canCollide,
+            collides = Collision.collides,
+            i,
+            j;
 
-        // @if DEBUG
-        var metrics = engine.metrics;
-        // @endif
-        
-        for (var i = 0; i < broadphasePairs.length; i++) {
-            var bodyA = broadphasePairs[i][0], 
-                bodyB = broadphasePairs[i][1];
+        bodies.sort(Detector._compareBoundsX);
 
-            if ((bodyA.isStatic || bodyA.isSleeping) && (bodyB.isStatic || bodyB.isSleeping))
-                continue;
-            
-            if (!Detector.canCollide(bodyA.collisionFilter, bodyB.collisionFilter))
-                continue;
+        for (i = 0; i < bodiesLength; i++) {
+            var bodyA = bodies[i],
+                boundsA = bodyA.bounds,
+                boundXMax = bodyA.bounds.max.x,
+                boundYMax = bodyA.bounds.max.y,
+                boundYMin = bodyA.bounds.min.y,
+                bodyAStatic = bodyA.isStatic || bodyA.isSleeping,
+                partsALength = bodyA.parts.length,
+                partsASingle = partsALength === 1;
 
-            // @if DEBUG
-            metrics.midphaseTests += 1;
-            // @endif
+            for (j = i + 1; j < bodiesLength; j++) {
+                var bodyB = bodies[j],
+                    boundsB = bodyB.bounds;
 
-            // mid phase
-            if (Bounds.overlaps(bodyA.bounds, bodyB.bounds)) {
-                for (var j = bodyA.parts.length > 1 ? 1 : 0; j < bodyA.parts.length; j++) {
-                    var partA = bodyA.parts[j];
+                if (boundsB.min.x > boundXMax) {
+                    break;
+                }
 
-                    for (var k = bodyB.parts.length > 1 ? 1 : 0; k < bodyB.parts.length; k++) {
-                        var partB = bodyB.parts[k];
+                if (boundYMax < boundsB.min.y || boundYMin > boundsB.max.y) {
+                    continue;
+                }
 
-                        if ((partA === bodyA && partB === bodyB) || Bounds.overlaps(partA.bounds, partB.bounds)) {
-                            // find a previous collision we could reuse
-                            var pairId = Pair.id(partA, partB),
-                                pair = pairsTable[pairId],
-                                previousCollision;
+                if (bodyAStatic && (bodyB.isStatic || bodyB.isSleeping)) {
+                    continue;
+                }
 
-                            if (pair && pair.isActive) {
-                                previousCollision = pair.collision;
-                            } else {
-                                previousCollision = null;
+                if (!canCollide(bodyA.collisionFilter, bodyB.collisionFilter)) {
+                    continue;
+                }
+
+                var partsBLength = bodyB.parts.length;
+
+                if (partsASingle && partsBLength === 1) {
+                    var collision = collides(bodyA, bodyB, pairs);
+
+                    if (collision) {
+                        collisions.push(collision);
+                    }
+                } else {
+                    var partsAStart = partsALength > 1 ? 1 : 0,
+                        partsBStart = partsBLength > 1 ? 1 : 0;
+                    
+                    for (var k = partsAStart; k < partsALength; k++) {
+                        var partA = bodyA.parts[k],
+                            boundsA = partA.bounds;
+
+                        for (var z = partsBStart; z < partsBLength; z++) {
+                            var partB = bodyB.parts[z],
+                                boundsB = partB.bounds;
+
+                            if (boundsA.min.x > boundsB.max.x || boundsA.max.x < boundsB.min.x
+                                || boundsA.max.y < boundsB.min.y || boundsA.min.y > boundsB.max.y) {
+                                continue;
                             }
 
-                            // narrow phase
-                            var collision = SAT.collides(partA, partB, previousCollision);
+                            var collision = collides(partA, partB, pairs);
 
-                            // @if DEBUG
-                            metrics.narrowphaseTests += 1;
-                            if (collision.reused)
-                                metrics.narrowReuseCount += 1;
-                            // @endif
-
-                            if (collision.collided) {
+                            if (collision) {
                                 collisions.push(collision);
-                                // @if DEBUG
-                                metrics.narrowDetections += 1;
-                                // @endif
                             }
                         }
                     }
@@ -104,4 +152,39 @@ var Bounds = require('../geometry/Bounds');
         return (filterA.mask & filterB.category) !== 0 && (filterB.mask & filterA.category) !== 0;
     };
 
+    /**
+     * The comparison function used in the broadphase algorithm.
+     * Returns the signed delta of the bodies bounds on the x-axis.
+     * @private
+     * @method _sortCompare
+     * @param {body} bodyA
+     * @param {body} bodyB
+     * @return {number} The signed delta used for sorting
+     */
+    Detector._compareBoundsX = function(bodyA, bodyB) {
+        return bodyA.bounds.min.x - bodyB.bounds.min.x;
+    };
+
+    /*
+    *
+    *  Properties Documentation
+    *
+    */
+
+    /**
+     * The array of `Matter.Body` between which the detector finds collisions.
+     * 
+     * _Note:_ The order of bodies in this array _is not fixed_ and will be continually managed by the detector.
+     * @property bodies
+     * @type body[]
+     * @default []
+     */
+
+    /**
+     * Optional. A `Matter.Pairs` object from which previous collision objects may be reused. Intended for internal `Matter.Engine` usage.
+     * @property pairs
+     * @type {pairs|null}
+     * @default null
+     */
+
 })();

src/physics/matter-js/lib/collision/Grid.js

@@ -1,7 +1,13 @@
 /**
+* This module has now been replaced by `Matter.Detector`.
+*
+* All usage should be migrated to `Matter.Detector` or another alternative.
+* For back-compatibility purposes this module will remain for a short term and then later removed in a future release.
+*
 * The `Matter.Grid` module contains methods for creating and manipulating collision broadphase grid structures.
 *
 * @class Grid
+* @deprecated
 */
 
 var Grid = {};
@@ -9,21 +15,20 @@ var Grid = {};
 module.exports = Grid;
 
 var Pair = require('./Pair');
-var Detector = require('./Detector');
 var Common = require('../core/Common');
+var deprecated = Common.deprecated;
 
 (function() {
 
     /**
      * Creates a new grid.
+     * @deprecated replaced by Matter.Detector
      * @method create
      * @param {} options
      * @return {grid} A new grid
      */
     Grid.create = function(options) {
         var defaults = {
-            controller: Grid,
-            detector: Detector.collisions,
             buckets: {},
             pairs: {},
             pairsList: [],
@@ -52,6 +57,7 @@ var Common = require('../core/Common');
 
     /**
      * Updates the grid.
+     * @deprecated replaced by Matter.Detector
      * @method update
      * @param {grid} grid
      * @param {body[]} bodies
@@ -66,20 +72,15 @@ var Common = require('../core/Common');
             bucketId,
             gridChanged = false;
 
-        // @if DEBUG
-        var metrics = engine.metrics;
-        metrics.broadphaseTests = 0;
-        // @endif
-
         for (i = 0; i < bodies.length; i++) {
             var body = bodies[i];
 
             if (body.isSleeping && !forceUpdate)
                 continue;
 
-            // don't update out of world bodies
-            if (body.bounds.max.x < world.bounds.min.x || body.bounds.min.x > world.bounds.max.x
-                || body.bounds.max.y < world.bounds.min.y || body.bounds.min.y > world.bounds.max.y)
+            // temporary back compatibility bounds check
+            if (world.bounds && (body.bounds.max.x < world.bounds.min.x || body.bounds.min.x > world.bounds.max.x
+                || body.bounds.max.y < world.bounds.min.y || body.bounds.min.y > world.bounds.max.y))
                 continue;
 
             var newRegion = Grid._getRegion(grid, body);
@@ -87,10 +88,6 @@ var Common = require('../core/Common');
             // if the body has changed grid region
             if (!body.region || newRegion.id !== body.region.id || forceUpdate) {
 
-                // @if DEBUG
-                metrics.broadphaseTests += 1;
-                // @endif
-
                 if (!body.region || forceUpdate)
                     body.region = newRegion;
 
@@ -139,8 +136,11 @@ var Common = require('../core/Common');
             grid.pairsList = Grid._createActivePairsList(grid);
     };
 
+    deprecated(Grid, 'update', 'Grid.update ➤ replaced by Matter.Detector');
+
     /**
      * Clears the grid.
+     * @deprecated replaced by Matter.Detector
      * @method clear
      * @param {grid} grid
      */
@@ -150,9 +150,12 @@ var Common = require('../core/Common');
         grid.pairsList = [];
     };
 
+    deprecated(Grid, 'clear', 'Grid.clear ➤ replaced by Matter.Detector');
+
     /**
      * Finds the union of two regions.
      * @method _regionUnion
+     * @deprecated replaced by Matter.Detector
      * @private
      * @param {} regionA
      * @param {} regionB
@@ -170,6 +173,7 @@ var Common = require('../core/Common');
     /**
      * Gets the region a given body falls in for a given grid.
      * @method _getRegion
+     * @deprecated replaced by Matter.Detector
      * @private
      * @param {} grid
      * @param {} body
@@ -188,6 +192,7 @@ var Common = require('../core/Common');
     /**
      * Creates a region.
      * @method _createRegion
+     * @deprecated replaced by Matter.Detector
      * @private
      * @param {} startCol
      * @param {} endCol
@@ -208,6 +213,7 @@ var Common = require('../core/Common');
     /**
      * Gets the bucket id at the given position.
      * @method _getBucketId
+     * @deprecated replaced by Matter.Detector
      * @private
      * @param {} column
      * @param {} row
@@ -220,6 +226,7 @@ var Common = require('../core/Common');
     /**
      * Creates a bucket.
      * @method _createBucket
+     * @deprecated replaced by Matter.Detector
      * @private
      * @param {} buckets
      * @param {} bucketId
@@ -233,14 +240,20 @@ var Common = require('../core/Common');
     /**
      * Adds a body to a bucket.
      * @method _bucketAddBody
+     * @deprecated replaced by Matter.Detector
      * @private
      * @param {} grid
      * @param {} bucket
      * @param {} body
      */
     Grid._bucketAddBody = function(grid, bucket, body) {
+        var gridPairs = grid.pairs,
+            pairId = Pair.id,
+            bucketLength = bucket.length,
+            i;
+
         // add new pairs
-        for (var i = 0; i < bucket.length; i++) {
+        for (i = 0; i < bucketLength; i++) {
             var bodyB = bucket[i];
 
             if (body.id === bodyB.id || (body.isStatic && bodyB.isStatic))
@@ -248,13 +261,13 @@ var Common = require('../core/Common');
 
             // keep track of the number of buckets the pair exists in
             // important for Grid.update to work
-            var pairId = Pair.id(body, bodyB),
-                pair = grid.pairs[pairId];
+            var id = pairId(body, bodyB),
+                pair = gridPairs[id];
 
             if (pair) {
                 pair[2] += 1;
             } else {
-                grid.pairs[pairId] = [body, bodyB, 1];
+                gridPairs[id] = [body, bodyB, 1];
             }
         }
 
@@ -265,22 +278,27 @@ var Common = require('../core/Common');
     /**
      * Removes a body from a bucket.
      * @method _bucketRemoveBody
+     * @deprecated replaced by Matter.Detector
      * @private
      * @param {} grid
      * @param {} bucket
      * @param {} body
      */
     Grid._bucketRemoveBody = function(grid, bucket, body) {
+        var gridPairs = grid.pairs,
+            pairId = Pair.id,
+            i;
+
         // remove from bucket
-        bucket.splice(bucket.indexOf(body), 1);
+        bucket.splice(Common.indexOf(bucket, body), 1);
+
+        var bucketLength = bucket.length;
 
         // update pair counts
-        for (var i = 0; i < bucket.length; i++) {
+        for (i = 0; i < bucketLength; i++) {
             // keep track of the number of buckets the pair exists in
             // important for _createActivePairsList to work
-            var bodyB = bucket[i],
-                pairId = Pair.id(body, bodyB),
-                pair = grid.pairs[pairId];
+            var pair = gridPairs[pairId(body, bucket[i])];
 
             if (pair)
                 pair[2] -= 1;
@@ -290,28 +308,29 @@ var Common = require('../core/Common');
     /**
      * Generates a list of the active pairs in the grid.
      * @method _createActivePairsList
+     * @deprecated replaced by Matter.Detector
      * @private
      * @param {} grid
      * @return [] pairs
      */
     Grid._createActivePairsList = function(grid) {
-        var pairKeys,
-            pair,
-            pairs = [];
-
-        // grid.pairs is used as a hashmap
-        pairKeys = Common.keys(grid.pairs);
+        var pair,
+            gridPairs = grid.pairs,
+            pairKeys = Common.keys(gridPairs),
+            pairKeysLength = pairKeys.length,
+            pairs = [],
+            k;
 
         // iterate over grid.pairs
-        for (var k = 0; k < pairKeys.length; k++) {
-            pair = grid.pairs[pairKeys[k]];
+        for (k = 0; k < pairKeysLength; k++) {
+            pair = gridPairs[pairKeys[k]];
 
             // if pair exists in at least one bucket
             // it is a pair that needs further collision testing so push it
             if (pair[2] > 0) {
                 pairs.push(pair);
             } else {
-                delete grid.pairs[pairKeys[k]];
+                delete gridPairs[pairKeys[k]];
             }
         }
 

src/physics/matter-js/lib/collision/Pair.js

@@ -8,6 +8,8 @@ var Pair = {};
 
 module.exports = Pair;
 
+var Contact = require('./Contact');
+
 (function() {
     
     /**
@@ -25,6 +27,8 @@ module.exports = Pair;
             id: Pair.id(bodyA, bodyB),
             bodyA: bodyA,
             bodyB: bodyB,
+            collision: collision,
+            contacts: [],
             activeContacts: [],
             separation: 0,
             isActive: true,
@@ -32,7 +36,6 @@ module.exports = Pair;
             isSensor: bodyA.isSensor || bodyB.isSensor,
             timeCreated: timestamp,
             timeUpdated: timestamp,
-            collision: null,
             inverseMass: 0,
             friction: 0,
             frictionStatic: 0,
@@ -53,35 +56,36 @@ module.exports = Pair;
      * @param {number} timestamp
      */
     Pair.update = function(pair, collision, timestamp) {
+        var contacts = pair.contacts,
+            supports = collision.supports,
+            activeContacts = pair.activeContacts,
+            parentA = collision.parentA,
+            parentB = collision.parentB,
+            parentAVerticesLength = parentA.vertices.length;
+        
+        pair.isActive = true;
+        pair.timeUpdated = timestamp;
         pair.collision = collision;
+        pair.separation = collision.depth;
+        pair.inverseMass = parentA.inverseMass + parentB.inverseMass;
+        pair.friction = parentA.friction < parentB.friction ? parentA.friction : parentB.friction;
+        pair.frictionStatic = parentA.frictionStatic > parentB.frictionStatic ? parentA.frictionStatic : parentB.frictionStatic;
+        pair.restitution = parentA.restitution > parentB.restitution ? parentA.restitution : parentB.restitution;
+        pair.slop = parentA.slop > parentB.slop ? parentA.slop : parentB.slop;
 
-        if (collision.collided) {
-            var supports = collision.supports,
-                activeContacts = pair.activeContacts,
-                parentA = collision.parentA,
-                parentB = collision.parentB;
+        collision.pair = pair;
+        activeContacts.length = 0;
+        
+        for (var i = 0; i < supports.length; i++) {
+            var support = supports[i],
+                contactId = support.body === parentA ? support.index : parentAVerticesLength + support.index,
+                contact = contacts[contactId];
 
-            pair.inverseMass = parentA.inverseMass + parentB.inverseMass;
-            pair.friction = Math.min(parentA.friction, parentB.friction);
-            pair.frictionStatic = Math.max(parentA.frictionStatic, parentB.frictionStatic);
-            pair.restitution = Math.max(parentA.restitution, parentB.restitution);
-            pair.slop = Math.max(parentA.slop, parentB.slop);
-
-            for (var i = 0; i < supports.length; i++) {
-                activeContacts[i] = supports[i].contact;
+            if (contact) {
+                activeContacts.push(contact);
+            } else {
+                activeContacts.push(contacts[contactId] = Contact.create(support));
             }
-
-            // optimise array size
-            var supportCount = supports.length;
-            if (supportCount < activeContacts.length) {
-                activeContacts.length = supportCount;
-            }
-
-            pair.separation = collision.depth;
-            Pair.setActive(pair, true, timestamp);
-        } else {
-            if (pair.isActive === true)
-                Pair.setActive(pair, false, timestamp);
         }
     };
     

src/physics/matter-js/lib/collision/Pairs.js

@@ -12,8 +12,6 @@ var Pair = require('./Pair');
 var Common = require('../core/Common');
 
 (function() {
-    
-    Pairs._pairMaxIdleLife = 1000;
 
     /**
      * Creates a new pairs structure.
@@ -40,12 +38,14 @@ var Common = require('../core/Common');
      */
     Pairs.update = function(pairs, collisions, timestamp) {
         var pairsList = pairs.list,
+            pairsListLength = pairsList.length,
             pairsTable = pairs.table,
+            collisionsLength = collisions.length,
             collisionStart = pairs.collisionStart,
             collisionEnd = pairs.collisionEnd,
             collisionActive = pairs.collisionActive,
             collision,
-            pairId,
+            pairIndex,
             pair,
             i;
 
@@ -54,90 +54,61 @@ var Common = require('../core/Common');
         collisionEnd.length = 0;
         collisionActive.length = 0;
 
-        for (i = 0; i < pairsList.length; i++) {
+        for (i = 0; i < pairsListLength; i++) {
             pairsList[i].confirmedActive = false;
         }
 
-        for (i = 0; i < collisions.length; i++) {
+        for (i = 0; i < collisionsLength; i++) {
             collision = collisions[i];
+            pair = collision.pair;
 
-            if (collision.collided) {
-                pairId = Pair.id(collision.bodyA, collision.bodyB);
-
-                pair = pairsTable[pairId];
-                
-                if (pair) {
-                    // pair already exists (but may or may not be active)
-                    if (pair.isActive) {
-                        // pair exists and is active
-                        collisionActive.push(pair);
-                    } else {
-                        // pair exists but was inactive, so a collision has just started again
-                        collisionStart.push(pair);
-                    }
-
-                    // update the pair
-                    Pair.update(pair, collision, timestamp);
-                    pair.confirmedActive = true;
+            if (pair) {
+                // pair already exists (but may or may not be active)
+                if (pair.isActive) {
+                    // pair exists and is active
+                    collisionActive.push(pair);
                 } else {
-                    // pair did not exist, create a new pair
-                    pair = Pair.create(collision, timestamp);
-                    pairsTable[pairId] = pair;
-
-                    // push the new pair
+                    // pair exists but was inactive, so a collision has just started again
                     collisionStart.push(pair);
-                    pairsList.push(pair);
+                }
+
+                // update the pair
+                Pair.update(pair, collision, timestamp);
+                pair.confirmedActive = true;
+            } else {
+                // pair did not exist, create a new pair
+                pair = Pair.create(collision, timestamp);
+                pairsTable[pair.id] = pair;
+
+                // push the new pair
+                collisionStart.push(pair);
+                pairsList.push(pair);
+            }
+        }
+
+        // find pairs that are no longer active
+        var removePairIndex = [];
+        pairsListLength = pairsList.length;
+
+        for (i = 0; i < pairsListLength; i++) {
+            pair = pairsList[i];
+            
+            if (!pair.confirmedActive) {
+                Pair.setActive(pair, false, timestamp);
+                collisionEnd.push(pair);
+
+                if (!pair.collision.bodyA.isSleeping && !pair.collision.bodyB.isSleeping) {
+                    removePairIndex.push(i);
                 }
             }
         }
 
-        // deactivate previously active pairs that are now inactive
-        for (i = 0; i < pairsList.length; i++) {
-            pair = pairsList[i];
-            if (pair.isActive && !pair.confirmedActive) {
-                Pair.setActive(pair, false, timestamp);
-                collisionEnd.push(pair);
-            }
-        }
-    };
-    
-    /**
-     * Finds and removes pairs that have been inactive for a set amount of time.
-     * @method removeOld
-     * @param {object} pairs
-     * @param {number} timestamp
-     */
-    Pairs.removeOld = function(pairs, timestamp) {
-        var pairsList = pairs.list,
-            pairsTable = pairs.table,
-            indexesToRemove = [],
-            pair,
-            collision,
-            pairIndex,
-            i;
-
-        for (i = 0; i < pairsList.length; i++) {
-            pair = pairsList[i];
-            collision = pair.collision;
-            
-            // never remove sleeping pairs
-            if (collision.bodyA.isSleeping || collision.bodyB.isSleeping) {
-                pair.timeUpdated = timestamp;
-                continue;
-            }
-
-            // if pair is inactive for too long, mark it to be removed
-            if (timestamp - pair.timeUpdated > Pairs._pairMaxIdleLife) {
-                indexesToRemove.push(i);
-            }
-        }
-
-        // remove marked pairs
-        for (i = 0; i < indexesToRemove.length; i++) {
-            pairIndex = indexesToRemove[i] - i;
+        // remove inactive pairs
+        for (i = 0; i < removePairIndex.length; i++) {
+            pairIndex = removePairIndex[i] - i;
             pair = pairsList[pairIndex];
-            delete pairsTable[pair.id];
             pairsList.splice(pairIndex, 1);
+            delete pairsTable[pair.id];
         }
     };
 

src/physics/matter-js/lib/collision/Query.js

@@ -11,7 +11,7 @@ var Query = {};
 module.exports = Query;
 
 var Vector = require('../geometry/Vector');
-var SAT = require('./SAT');
+var Collision = require('./Collision');
 var Bounds = require('../geometry/Bounds');
 var Bodies = require('../factory/Bodies');
 var Vertices = require('../geometry/Vertices');
@@ -23,28 +23,34 @@ var Vertices = require('../geometry/Vertices');
      * @method collides
      * @param {body} body
      * @param {body[]} bodies
-     * @return {object[]} Collisions
+     * @return {collision[]} Collisions
      */
     Query.collides = function(body, bodies) {
-        var collisions = [];
+        var collisions = [],
+            bodiesLength = bodies.length,
+            bounds = body.bounds,
+            collides = Collision.collides,
+            overlaps = Bounds.overlaps;
 
-        for (var i = 0; i < bodies.length; i++) {
-            var bodyA = bodies[i];
+        for (var i = 0; i < bodiesLength; i++) {
+            var bodyA = bodies[i],
+                partsALength = bodyA.parts.length,
+                partsAStart = partsALength === 1 ? 0 : 1;
 
             //  Phaser addition - skip same body checks
             if (body === bodyA)
             {
                 continue;
             }
-            
-            if (Bounds.overlaps(bodyA.bounds, body.bounds)) {
-                for (var j = bodyA.parts.length === 1 ? 0 : 1; j < bodyA.parts.length; j++) {
+
+            if (overlaps(bodyA.bounds, bounds)) {
+                for (var j = partsAStart; j < partsALength; j++) {
                     var part = bodyA.parts[j];
 
-                    if (Bounds.overlaps(part.bounds, body.bounds)) {
-                        var collision = SAT.collides(part, body);
+                    if (overlaps(part.bounds, bounds)) {
+                        var collision = collides(part, body);
 
-                        if (collision.collided) {
+                        if (collision) {
                             collisions.push(collision);
                             break;
                         }
@@ -63,7 +69,7 @@ var Vertices = require('../geometry/Vertices');
      * @param {vector} startPoint
      * @param {vector} endPoint
      * @param {number} [rayWidth]
-     * @return {object[]} Collisions
+     * @return {collision[]} Collisions
      */
     Query.ray = function(bodies, startPoint, endPoint, rayWidth) {
         rayWidth = rayWidth || 1e-100;
@@ -77,7 +83,7 @@ var Vertices = require('../geometry/Vertices');
 
         for (var i = 0; i < collisions.length; i += 1) {
             var collision = collisions[i];
-            collision.body = collision.bodyB = collision.bodyA;            
+            collision.body = collision.bodyB = collision.bodyA;
         }
 
         return collisions;
@@ -116,7 +122,7 @@ var Vertices = require('../geometry/Vertices');
 
         for (var i = 0; i < bodies.length; i++) {
             var body = bodies[i];
-            
+
             if (Bounds.contains(body.bounds, point)) {
                 for (var j = body.parts.length === 1 ? 0 : 1; j < body.parts.length; j++) {
                     var part = body.parts[j];

src/physics/matter-js/lib/collision/Resolver.js

@@ -9,8 +9,6 @@ var Resolver = {};
 module.exports = Resolver;
 
 var Vertices = require('../geometry/Vertices');
-var Vector = require('../geometry/Vector');
-var Common = require('../core/Common');
 var Bounds = require('../geometry/Bounds');
 
 (function() {
@@ -29,10 +27,11 @@ var Bounds = require('../geometry/Bounds');
     Resolver.preSolvePosition = function(pairs) {
         var i,
             pair,
-            activeCount;
+            activeCount,
+            pairsLength = pairs.length;
 
         // find total contacts on each body
-        for (i = 0; i < pairs.length; i++) {
+        for (i = 0; i < pairsLength; i++) {
             pair = pairs[i];
             
             if (!pair.isActive)
@@ -48,36 +47,22 @@ var Bounds = require('../geometry/Bounds');
      * Find a solution for pair positions.
      * @method solvePosition
      * @param {pair[]} pairs
-     * @param {body[]} bodies
      * @param {number} timeScale
      */
-    Resolver.solvePosition = function(pairs, bodies, timeScale) {
+    Resolver.solvePosition = function(pairs, timeScale) {
         var i,
-            normalX,
-            normalY,
             pair,
             collision,
             bodyA,
             bodyB,
             normal,
-            separation,
-            penetration,
-            positionImpulseA,
-            positionImpulseB,
             contactShare,
-            bodyBtoAX,
-            bodyBtoAY,
             positionImpulse,
-            impulseCoefficient = timeScale * Resolver._positionDampen;
-
-        for (i = 0; i < bodies.length; i++) {
-            var body = bodies[i];
-            body.previousPositionImpulse.x = body.positionImpulse.x;
-            body.previousPositionImpulse.y = body.positionImpulse.y;
-        }
+            positionDampen = Resolver._positionDampen,
+            pairsLength = pairs.length;
 
         // find impulses required to resolve penetration
-        for (i = 0; i < pairs.length; i++) {
+        for (i = 0; i < pairsLength; i++) {
             pair = pairs[i];
             
             if (!pair.isActive || pair.isSensor)
@@ -88,35 +73,37 @@ var Bounds = require('../geometry/Bounds');
             bodyB = collision.parentB;
             normal = collision.normal;
 
-            positionImpulseA = bodyA.previousPositionImpulse;
-            positionImpulseB = bodyB.previousPositionImpulse;
+            // get current separation between body edges involved in collision
+            pair.separation = 
+                normal.x * (bodyB.positionImpulse.x + collision.penetration.x - bodyA.positionImpulse.x)
+                + normal.y * (bodyB.positionImpulse.y + collision.penetration.y - bodyA.positionImpulse.y);
+        }
+        
+        for (i = 0; i < pairsLength; i++) {
+            pair = pairs[i];
 
-            penetration = collision.penetration;
-
-            bodyBtoAX = positionImpulseB.x - positionImpulseA.x + penetration.x;
-            bodyBtoAY = positionImpulseB.y - positionImpulseA.y + penetration.y;
-
-            normalX = normal.x;
-            normalY = normal.y;
-
-            separation = normalX * bodyBtoAX + normalY * bodyBtoAY;
-            pair.separation = separation;
-
-            positionImpulse = (separation - pair.slop) * impulseCoefficient;
+            if (!pair.isActive || pair.isSensor)
+                continue;
+            
+            collision = pair.collision;
+            bodyA = collision.parentA;
+            bodyB = collision.parentB;
+            normal = collision.normal;
+            positionImpulse = (pair.separation - pair.slop) * timeScale;
 
             if (bodyA.isStatic || bodyB.isStatic)
                 positionImpulse *= 2;
             
             if (!(bodyA.isStatic || bodyA.isSleeping)) {
-                contactShare = positionImpulse / bodyA.totalContacts;
-                bodyA.positionImpulse.x += normalX * contactShare;
-                bodyA.positionImpulse.y += normalY * contactShare;
+                contactShare = positionDampen / bodyA.totalContacts;
+                bodyA.positionImpulse.x += normal.x * positionImpulse * contactShare;
+                bodyA.positionImpulse.y += normal.y * positionImpulse * contactShare;
             }
 
             if (!(bodyB.isStatic || bodyB.isSleeping)) {
-                contactShare = positionImpulse / bodyB.totalContacts;
-                bodyB.positionImpulse.x -= normalX * contactShare;
-                bodyB.positionImpulse.y -= normalY * contactShare;
+                contactShare = positionDampen / bodyB.totalContacts;
+                bodyB.positionImpulse.x -= normal.x * positionImpulse * contactShare;
+                bodyB.positionImpulse.y -= normal.y * positionImpulse * contactShare;
             }
         }
     };
@@ -127,34 +114,43 @@ var Bounds = require('../geometry/Bounds');
      * @param {body[]} bodies
      */
     Resolver.postSolvePosition = function(bodies) {
-        for (var i = 0; i < bodies.length; i++) {
-            var body = bodies[i];
+        var positionWarming = Resolver._positionWarming,
+            bodiesLength = bodies.length,
+            verticesTranslate = Vertices.translate,
+            boundsUpdate = Bounds.update;
+
+        for (var i = 0; i < bodiesLength; i++) {
+            var body = bodies[i],
+                positionImpulse = body.positionImpulse,
+                positionImpulseX = positionImpulse.x,
+                positionImpulseY = positionImpulse.y,
+                velocity = body.velocity;
 
             // reset contact count
             body.totalContacts = 0;
 
-            if (body.positionImpulse.x !== 0 || body.positionImpulse.y !== 0) {
+            if (positionImpulseX !== 0 || positionImpulseY !== 0) {
                 // update body geometry
                 for (var j = 0; j < body.parts.length; j++) {
                     var part = body.parts[j];
-                    Vertices.translate(part.vertices, body.positionImpulse);
-                    Bounds.update(part.bounds, part.vertices, body.velocity);
-                    part.position.x += body.positionImpulse.x;
-                    part.position.y += body.positionImpulse.y;
+                    verticesTranslate(part.vertices, positionImpulse);
+                    boundsUpdate(part.bounds, part.vertices, velocity);
+                    part.position.x += positionImpulseX;
+                    part.position.y += positionImpulseY;
                 }
 
                 // move the body without changing velocity
-                body.positionPrev.x += body.positionImpulse.x;
-                body.positionPrev.y += body.positionImpulse.y;
+                body.positionPrev.x += positionImpulseX;
+                body.positionPrev.y += positionImpulseY;
 
-                if (Vector.dot(body.positionImpulse, body.velocity) < 0) {
+                if (positionImpulseX * velocity.x + positionImpulseY * velocity.y < 0) {
                     // reset cached impulse if the body has velocity along it
-                    body.positionImpulse.x = 0;
-                    body.positionImpulse.y = 0;
+                    positionImpulse.x = 0;
+                    positionImpulse.y = 0;
                 } else {
                     // warm the next iteration
-                    body.positionImpulse.x *= Resolver._positionWarming;
-                    body.positionImpulse.y *= Resolver._positionWarming;
+                    positionImpulse.x *= positionWarming;
+                    positionImpulse.y *= positionWarming;
                 }
             }
         }
@@ -166,61 +162,53 @@ var Bounds = require('../geometry/Bounds');
      * @param {pair[]} pairs
      */
     Resolver.preSolveVelocity = function(pairs) {
-        var i,
-            j,
-            pair,
-            contacts,
-            collision,
-            bodyA,
-            bodyB,
-            normal,
-            tangent,
-            contact,
-            contactVertex,
-            normalImpulse,
-            tangentImpulse,
-            offset,
-            impulse = Vector._temp[0],
-            tempA = Vector._temp[1];
+        var pairsLength = pairs.length,
+            i,
+            j;
         
-        for (i = 0; i < pairs.length; i++) {
-            pair = pairs[i];
+        for (i = 0; i < pairsLength; i++) {
+            var pair = pairs[i];
             
             if (!pair.isActive || pair.isSensor)
                 continue;
             
-            contacts = pair.activeContacts;
-            collision = pair.collision;
-            bodyA = collision.parentA;
-            bodyB = collision.parentB;
-            normal = collision.normal;
-            tangent = collision.tangent;
-
+            var contacts = pair.activeContacts,
+                contactsLength = contacts.length,
+                collision = pair.collision,
+                bodyA = collision.parentA,
+                bodyB = collision.parentB,
+                normal = collision.normal,
+                tangent = collision.tangent;
+    
             // resolve each contact
-            for (j = 0; j < contacts.length; j++) {
-                contact = contacts[j];
-                contactVertex = contact.vertex;
-                normalImpulse = contact.normalImpulse;
-                tangentImpulse = contact.tangentImpulse;
-
+            for (j = 0; j < contactsLength; j++) {
+                var contact = contacts[j],
+                    contactVertex = contact.vertex,
+                    normalImpulse = contact.normalImpulse,
+                    tangentImpulse = contact.tangentImpulse;
+    
                 if (normalImpulse !== 0 || tangentImpulse !== 0) {
                     // total impulse from contact
-                    impulse.x = (normal.x * normalImpulse) + (tangent.x * tangentImpulse);
-                    impulse.y = (normal.y * normalImpulse) + (tangent.y * tangentImpulse);
+                    var impulseX = normal.x * normalImpulse + tangent.x * tangentImpulse,
+                        impulseY = normal.y * normalImpulse + tangent.y * tangentImpulse;
                     
                     // apply impulse from contact
                     if (!(bodyA.isStatic || bodyA.isSleeping)) {
-                        offset = Vector.sub(contactVertex, bodyA.position, tempA);
-                        bodyA.positionPrev.x += impulse.x * bodyA.inverseMass;
-                        bodyA.positionPrev.y += impulse.y * bodyA.inverseMass;
-                        bodyA.anglePrev += Vector.cross(offset, impulse) * bodyA.inverseInertia;
+                        bodyA.positionPrev.x += impulseX * bodyA.inverseMass;
+                        bodyA.positionPrev.y += impulseY * bodyA.inverseMass;
+                        bodyA.anglePrev += bodyA.inverseInertia * (
+                            (contactVertex.x - bodyA.position.x) * impulseY
+                            - (contactVertex.y - bodyA.position.y) * impulseX
+                        );
                     }
-
+    
                     if (!(bodyB.isStatic || bodyB.isSleeping)) {
-                        offset = Vector.sub(contactVertex, bodyB.position, tempA);
-                        bodyB.positionPrev.x -= impulse.x * bodyB.inverseMass;
-                        bodyB.positionPrev.y -= impulse.y * bodyB.inverseMass;
-                        bodyB.anglePrev -= Vector.cross(offset, impulse) * bodyB.inverseInertia;
+                        bodyB.positionPrev.x -= impulseX * bodyB.inverseMass;
+                        bodyB.positionPrev.y -= impulseY * bodyB.inverseMass;
+                        bodyB.anglePrev -= bodyB.inverseInertia * (
+                            (contactVertex.x - bodyB.position.x) * impulseY 
+                            - (contactVertex.y - bodyB.position.y) * impulseX
+                        );
                     }
                 }
             }
@@ -235,14 +223,17 @@ var Bounds = require('../geometry/Bounds');
      */
     Resolver.solveVelocity = function(pairs, timeScale) {
         var timeScaleSquared = timeScale * timeScale,
-            impulse = Vector._temp[0],
-            tempA = Vector._temp[1],
-            tempB = Vector._temp[2],
-            tempC = Vector._temp[3],
-            tempD = Vector._temp[4],
-            tempE = Vector._temp[5];
-        
-        for (var i = 0; i < pairs.length; i++) {
+            restingThresh = Resolver._restingThresh * timeScaleSquared,
+            frictionNormalMultiplier = Resolver._frictionNormalMultiplier,
+            restingThreshTangent = Resolver._restingThreshTangent * timeScaleSquared,
+            NumberMaxValue = Number.MAX_VALUE,
+            pairsLength = pairs.length,
+            tangentImpulse,
+            maxFriction,
+            i,
+            j;
+
+        for (i = 0; i < pairsLength; i++) {
             var pair = pairs[i];
             
             if (!pair.isActive || pair.isSensor)
@@ -251,97 +242,119 @@ var Bounds = require('../geometry/Bounds');
             var collision = pair.collision,
                 bodyA = collision.parentA,
                 bodyB = collision.parentB,
-                normal = collision.normal,
-                tangent = collision.tangent,
+                bodyAVelocity = bodyA.velocity,
+                bodyBVelocity = bodyB.velocity,
+                normalX = collision.normal.x,
+                normalY = collision.normal.y,
+                tangentX = collision.tangent.x,
+                tangentY = collision.tangent.y,
                 contacts = pair.activeContacts,
-                contactShare = 1 / contacts.length;
+                contactsLength = contacts.length,
+                contactShare = 1 / contactsLength,
+                inverseMassTotal = bodyA.inverseMass + bodyB.inverseMass,
+                friction = pair.friction * pair.frictionStatic * frictionNormalMultiplier * timeScaleSquared;
 
             // update body velocities
-            bodyA.velocity.x = bodyA.position.x - bodyA.positionPrev.x;
-            bodyA.velocity.y = bodyA.position.y - bodyA.positionPrev.y;
-            bodyB.velocity.x = bodyB.position.x - bodyB.positionPrev.x;
-            bodyB.velocity.y = bodyB.position.y - bodyB.positionPrev.y;
+            bodyAVelocity.x = bodyA.position.x - bodyA.positionPrev.x;
+            bodyAVelocity.y = bodyA.position.y - bodyA.positionPrev.y;
+            bodyBVelocity.x = bodyB.position.x - bodyB.positionPrev.x;
+            bodyBVelocity.y = bodyB.position.y - bodyB.positionPrev.y;
             bodyA.angularVelocity = bodyA.angle - bodyA.anglePrev;
             bodyB.angularVelocity = bodyB.angle - bodyB.anglePrev;
 
             // resolve each contact
-            for (var j = 0; j < contacts.length; j++) {
+            for (j = 0; j < contactsLength; j++) {
                 var contact = contacts[j],
-                    contactVertex = contact.vertex,
-                    offsetA = Vector.sub(contactVertex, bodyA.position, tempA),
-                    offsetB = Vector.sub(contactVertex, bodyB.position, tempB),
-                    velocityPointA = Vector.add(bodyA.velocity, Vector.mult(Vector.perp(offsetA), bodyA.angularVelocity), tempC),
-                    velocityPointB = Vector.add(bodyB.velocity, Vector.mult(Vector.perp(offsetB), bodyB.angularVelocity), tempD), 
-                    relativeVelocity = Vector.sub(velocityPointA, velocityPointB, tempE),
-                    normalVelocity = Vector.dot(normal, relativeVelocity);
+                    contactVertex = contact.vertex;
 
-                var tangentVelocity = Vector.dot(tangent, relativeVelocity),
-                    tangentSpeed = Math.abs(tangentVelocity),
-                    tangentVelocityDirection = Common.sign(tangentVelocity);
+                var offsetAX = contactVertex.x - bodyA.position.x,
+                    offsetAY = contactVertex.y - bodyA.position.y,
+                    offsetBX = contactVertex.x - bodyB.position.x,
+                    offsetBY = contactVertex.y - bodyB.position.y;
+ 
+                var velocityPointAX = bodyAVelocity.x - offsetAY * bodyA.angularVelocity,
+                    velocityPointAY = bodyAVelocity.y + offsetAX * bodyA.angularVelocity,
+                    velocityPointBX = bodyBVelocity.x - offsetBY * bodyB.angularVelocity,
+                    velocityPointBY = bodyBVelocity.y + offsetBX * bodyB.angularVelocity;
 
-                // raw impulses
-                var normalImpulse = (1 + pair.restitution) * normalVelocity,
-                    normalForce = Common.clamp(pair.separation + normalVelocity, 0, 1) * Resolver._frictionNormalMultiplier;
+                var relativeVelocityX = velocityPointAX - velocityPointBX,
+                    relativeVelocityY = velocityPointAY - velocityPointBY;
+
+                var normalVelocity = normalX * relativeVelocityX + normalY * relativeVelocityY,
+                    tangentVelocity = tangentX * relativeVelocityX + tangentY * relativeVelocityY;
 
                 // coulomb friction
-                var tangentImpulse = tangentVelocity,
-                    maxFriction = Infinity;
+                var normalOverlap = pair.separation + normalVelocity;
+                var normalForce = Math.min(normalOverlap, 1);
+                normalForce = normalOverlap < 0 ? 0 : normalForce;
+                
+                var frictionLimit = normalForce * friction;
 
-                if (tangentSpeed > pair.friction * pair.frictionStatic * normalForce * timeScaleSquared) {
-                    maxFriction = tangentSpeed;
-                    tangentImpulse = Common.clamp(
-                        pair.friction * tangentVelocityDirection * timeScaleSquared,
-                        -maxFriction, maxFriction
-                    );
+                if (tangentVelocity > frictionLimit || -tangentVelocity > frictionLimit) {
+                    maxFriction = tangentVelocity > 0 ? tangentVelocity : -tangentVelocity;
+                    tangentImpulse = pair.friction * (tangentVelocity > 0 ? 1 : -1) * timeScaleSquared;
+                    
+                    if (tangentImpulse < -maxFriction) {
+                        tangentImpulse = -maxFriction;
+                    } else if (tangentImpulse > maxFriction) {
+                        tangentImpulse = maxFriction;
+                    }
+                } else {
+                    tangentImpulse = tangentVelocity;
+                    maxFriction = NumberMaxValue;
                 }
 
-                // modify impulses accounting for mass, inertia and offset
-                var oAcN = Vector.cross(offsetA, normal),
-                    oBcN = Vector.cross(offsetB, normal),
-                    share = contactShare / (bodyA.inverseMass + bodyB.inverseMass + bodyA.inverseInertia * oAcN * oAcN  + bodyB.inverseInertia * oBcN * oBcN);
+                // account for mass, inertia and contact offset
+                var oAcN = offsetAX * normalY - offsetAY * normalX,
+                    oBcN = offsetBX * normalY - offsetBY * normalX,
+                    share = contactShare / (inverseMassTotal + bodyA.inverseInertia * oAcN * oAcN + bodyB.inverseInertia * oBcN * oBcN);
 
-                normalImpulse *= share;
+                // raw impulses
+                var normalImpulse = (1 + pair.restitution) * normalVelocity * share;
                 tangentImpulse *= share;
 
                 // handle high velocity and resting collisions separately
-                if (normalVelocity < 0 && normalVelocity * normalVelocity > Resolver._restingThresh * timeScaleSquared) {
+                if (normalVelocity * normalVelocity > restingThresh && normalVelocity < 0) {
                     // high normal velocity so clear cached contact normal impulse
                     contact.normalImpulse = 0;
                 } else {
                     // solve resting collision constraints using Erin Catto's method (GDC08)
                     // impulse constraint tends to 0
                     var contactNormalImpulse = contact.normalImpulse;
-                    contact.normalImpulse = Math.min(contact.normalImpulse + normalImpulse, 0);
+                    contact.normalImpulse += normalImpulse;
+                    contact.normalImpulse = Math.min(contact.normalImpulse, 0);
                     normalImpulse = contact.normalImpulse - contactNormalImpulse;
                 }
 
                 // handle high velocity and resting collisions separately
-                if (tangentVelocity * tangentVelocity > Resolver._restingThreshTangent * timeScaleSquared) {
+                if (tangentVelocity * tangentVelocity > restingThreshTangent) {
                     // high tangent velocity so clear cached contact tangent impulse
                     contact.tangentImpulse = 0;
                 } else {
                     // solve resting collision constraints using Erin Catto's method (GDC08)
                     // tangent impulse tends to -tangentSpeed or +tangentSpeed
                     var contactTangentImpulse = contact.tangentImpulse;
-                    contact.tangentImpulse = Common.clamp(contact.tangentImpulse + tangentImpulse, -maxFriction, maxFriction);
+                    contact.tangentImpulse += tangentImpulse;
+                    if (contact.tangentImpulse < -maxFriction) contact.tangentImpulse = -maxFriction;
+                    if (contact.tangentImpulse > maxFriction) contact.tangentImpulse = maxFriction;
                     tangentImpulse = contact.tangentImpulse - contactTangentImpulse;
                 }
 
                 // total impulse from contact
-                impulse.x = (normal.x * normalImpulse) + (tangent.x * tangentImpulse);
-                impulse.y = (normal.y * normalImpulse) + (tangent.y * tangentImpulse);
+                var impulseX = normalX * normalImpulse + tangentX * tangentImpulse,
+                    impulseY = normalY * normalImpulse + tangentY * tangentImpulse;
                 
                 // apply impulse from contact
                 if (!(bodyA.isStatic || bodyA.isSleeping)) {
-                    bodyA.positionPrev.x += impulse.x * bodyA.inverseMass;
-                    bodyA.positionPrev.y += impulse.y * bodyA.inverseMass;
-                    bodyA.anglePrev += Vector.cross(offsetA, impulse) * bodyA.inverseInertia;
+                    bodyA.positionPrev.x += impulseX * bodyA.inverseMass;
+                    bodyA.positionPrev.y += impulseY * bodyA.inverseMass;
+                    bodyA.anglePrev += (offsetAX * impulseY - offsetAY * impulseX) * bodyA.inverseInertia;
                 }
 
                 if (!(bodyB.isStatic || bodyB.isSleeping)) {
-                    bodyB.positionPrev.x -= impulse.x * bodyB.inverseMass;
-                    bodyB.positionPrev.y -= impulse.y * bodyB.inverseMass;
-                    bodyB.anglePrev -= Vector.cross(offsetB, impulse) * bodyB.inverseInertia;
+                    bodyB.positionPrev.x -= impulseX * bodyB.inverseMass;
+                    bodyB.positionPrev.y -= impulseY * bodyB.inverseMass;
+                    bodyB.anglePrev -= (offsetBX * impulseY - offsetBY * impulseX) * bodyB.inverseInertia;
                 }
             }
         }

src/physics/matter-js/lib/collision/SAT.js

@@ -1,270 +1,37 @@
 /**
+* This module has now been replaced by `Matter.Collision`.
+*
+* All usage should be migrated to `Matter.Collision`.
+* For back-compatibility purposes this module will remain for a short term and then later removed in a future release.
+*
 * The `Matter.SAT` module contains methods for detecting collisions using the Separating Axis Theorem.
 *
 * @class SAT
+* @deprecated
 */
 
-// TODO: true circles and curves
-
 var SAT = {};
 
 module.exports = SAT;
 
-var Vertices = require('../geometry/Vertices');
-var Vector = require('../geometry/Vector');
+var Collision = require('./Collision');
+var Common = require('../core/Common');
+var deprecated = Common.deprecated;
 
 (function() {
 
     /**
      * Detect collision between two bodies using the Separating Axis Theorem.
+     * @deprecated replaced by Collision.collides
      * @method collides
      * @param {body} bodyA
      * @param {body} bodyB
-     * @param {collision} previousCollision
      * @return {collision} collision
      */
-    SAT.collides = function(bodyA, bodyB, previousCollision) {
-        var overlapAB,
-            overlapBA, 
-            minOverlap,
-            collision,
-            canReusePrevCol = false;
-
-        if (previousCollision) {
-            // estimate total motion
-            var parentA = bodyA.parent,
-                parentB = bodyB.parent,
-                motion = parentA.speed * parentA.speed + parentA.angularSpeed * parentA.angularSpeed
-                       + parentB.speed * parentB.speed + parentB.angularSpeed * parentB.angularSpeed;
-
-            // we may be able to (partially) reuse collision result 
-            // but only safe if collision was resting
-            canReusePrevCol = previousCollision && previousCollision.collided && motion < 0.2;
-
-            // reuse collision object
-            collision = previousCollision;
-        } else {
-            collision = { collided: false, bodyA: bodyA, bodyB: bodyB };
-        }
-
-        if (previousCollision && canReusePrevCol) {
-            // if we can reuse the collision result
-            // we only need to test the previously found axis
-            var axisBodyA = collision.axisBody,
-                axisBodyB = axisBodyA === bodyA ? bodyB : bodyA,
-                axes = [axisBodyA.axes[previousCollision.axisNumber]];
-
-            minOverlap = SAT._overlapAxes(axisBodyA.vertices, axisBodyB.vertices, axes);
-            collision.reused = true;
-
-            if (minOverlap.overlap <= 0) {
-                collision.collided = false;
-                return collision;
-            }
-        } else {
-            // if we can't reuse a result, perform a full SAT test
-
-            overlapAB = SAT._overlapAxes(bodyA.vertices, bodyB.vertices, bodyA.axes);
-
-            if (overlapAB.overlap <= 0) {
-                collision.collided = false;
-                return collision;
-            }
-
-            overlapBA = SAT._overlapAxes(bodyB.vertices, bodyA.vertices, bodyB.axes);
-
-            if (overlapBA.overlap <= 0) {
-                collision.collided = false;
-                return collision;
-            }
-
-            if (overlapAB.overlap < overlapBA.overlap) {
-                minOverlap = overlapAB;
-                collision.axisBody = bodyA;
-            } else {
-                minOverlap = overlapBA;
-                collision.axisBody = bodyB;
-            }
-
-            // important for reuse later
-            collision.axisNumber = minOverlap.axisNumber;
-        }
-
-        collision.bodyA = bodyA.id < bodyB.id ? bodyA : bodyB;
-        collision.bodyB = bodyA.id < bodyB.id ? bodyB : bodyA;
-        collision.collided = true;
-        collision.depth = minOverlap.overlap;
-        collision.parentA = collision.bodyA.parent;
-        collision.parentB = collision.bodyB.parent;
-        
-        bodyA = collision.bodyA;
-        bodyB = collision.bodyB;
-
-        // ensure normal is facing away from bodyA
-        if (Vector.dot(minOverlap.axis, Vector.sub(bodyB.position, bodyA.position)) < 0) {
-            collision.normal = {
-                x: minOverlap.axis.x,
-                y: minOverlap.axis.y
-            };
-        } else {
-            collision.normal = {
-                x: -minOverlap.axis.x,
-                y: -minOverlap.axis.y
-            };
-        }
-
-        collision.tangent = Vector.perp(collision.normal);
-
-        collision.penetration = collision.penetration || {};
-        collision.penetration.x = collision.normal.x * collision.depth;
-        collision.penetration.y = collision.normal.y * collision.depth; 
-
-        // find support points, there is always either exactly one or two
-        var verticesB = SAT._findSupports(bodyA, bodyB, collision.normal),
-            supports = [];
-
-        // find the supports from bodyB that are inside bodyA
-        if (Vertices.contains(bodyA.vertices, verticesB[0]))
-            supports.push(verticesB[0]);
-
-        if (Vertices.contains(bodyA.vertices, verticesB[1]))
-            supports.push(verticesB[1]);
-
-        // find the supports from bodyA that are inside bodyB
-        if (supports.length < 2) {
-            var verticesA = SAT._findSupports(bodyB, bodyA, Vector.neg(collision.normal));
-                
-            if (Vertices.contains(bodyB.vertices, verticesA[0]))
-                supports.push(verticesA[0]);
-
-            if (supports.length < 2 && Vertices.contains(bodyB.vertices, verticesA[1]))
-                supports.push(verticesA[1]);
-        }
-
-        // account for the edge case of overlapping but no vertex containment
-        if (supports.length < 1)
-            supports = [verticesB[0]];
-        
-        collision.supports = supports;
-
-        return collision;
+    SAT.collides = function(bodyA, bodyB) {
+        return Collision.collides(bodyA, bodyB);
     };
 
-    /**
-     * Find the overlap between two sets of vertices.
-     * @method _overlapAxes
-     * @private
-     * @param {} verticesA
-     * @param {} verticesB
-     * @param {} axes
-     * @return result
-     */
-    SAT._overlapAxes = function(verticesA, verticesB, axes) {
-        var projectionA = Vector._temp[0], 
-            projectionB = Vector._temp[1],
-            result = { overlap: Number.MAX_VALUE },
-            overlap,
-            axis;
-
-        for (var i = 0; i < axes.length; i++) {
-            axis = axes[i];
-
-            SAT._projectToAxis(projectionA, verticesA, axis);
-            SAT._projectToAxis(projectionB, verticesB, axis);
-
-            overlap = Math.min(projectionA.max - projectionB.min, projectionB.max - projectionA.min);
-
-            if (overlap <= 0) {
-                result.overlap = overlap;
-                return result;
-            }
-
-            if (overlap < result.overlap) {
-                result.overlap = overlap;
-                result.axis = axis;
-                result.axisNumber = i;
-            }
-        }
-
-        return result;
-    };
-
-    /**
-     * Projects vertices on an axis and returns an interval.
-     * @method _projectToAxis
-     * @private
-     * @param {} projection
-     * @param {} vertices
-     * @param {} axis
-     */
-    SAT._projectToAxis = function(projection, vertices, axis) {
-        var min = Vector.dot(vertices[0], axis),
-            max = min;
-
-        for (var i = 1; i < vertices.length; i += 1) {
-            var dot = Vector.dot(vertices[i], axis);
-
-            if (dot > max) { 
-                max = dot; 
-            } else if (dot < min) { 
-                min = dot; 
-            }
-        }
-
-        projection.min = min;
-        projection.max = max;
-    };
-    
-    /**
-     * Finds supporting vertices given two bodies along a given direction using hill-climbing.
-     * @method _findSupports
-     * @private
-     * @param {} bodyA
-     * @param {} bodyB
-     * @param {} normal
-     * @return [vector]
-     */
-    SAT._findSupports = function(bodyA, bodyB, normal) {
-        var nearestDistance = Number.MAX_VALUE,
-            vertexToBody = Vector._temp[0],
-            vertices = bodyB.vertices,
-            bodyAPosition = bodyA.position,
-            distance,
-            vertex,
-            vertexA,
-            vertexB;
-
-        // find closest vertex on bodyB
-        for (var i = 0; i < vertices.length; i++) {
-            vertex = vertices[i];
-            vertexToBody.x = vertex.x - bodyAPosition.x;
-            vertexToBody.y = vertex.y - bodyAPosition.y;
-            distance = -Vector.dot(normal, vertexToBody);
-
-            if (distance < nearestDistance) {
-                nearestDistance = distance;
-                vertexA = vertex;
-            }
-        }
-
-        // find next closest vertex using the two connected to it
-        var prevIndex = vertexA.index - 1 >= 0 ? vertexA.index - 1 : vertices.length - 1;
-        vertex = vertices[prevIndex];
-        vertexToBody.x = vertex.x - bodyAPosition.x;
-        vertexToBody.y = vertex.y - bodyAPosition.y;
-        nearestDistance = -Vector.dot(normal, vertexToBody);
-        vertexB = vertex;
-
-        var nextIndex = (vertexA.index + 1) % vertices.length;
-        vertex = vertices[nextIndex];
-        vertexToBody.x = vertex.x - bodyAPosition.x;
-        vertexToBody.y = vertex.y - bodyAPosition.y;
-        distance = -Vector.dot(normal, vertexToBody);
-        if (distance < nearestDistance) {
-            vertexB = vertex;
-        }
-
-        return [vertexA, vertexB];
-    };
+    deprecated(SAT, 'collides', 'SAT.collides ➤ replaced by Collision.collides');
 
 })();

src/physics/matter-js/lib/constraint/Constraint.js

@@ -312,8 +312,10 @@ var Common = require('../core/Common');
      */
     Constraint.pointAWorld = function(constraint) {
         return {
-            x: (constraint.bodyA ? constraint.bodyA.position.x : 0) + constraint.pointA.x,
-            y: (constraint.bodyA ? constraint.bodyA.position.y : 0) + constraint.pointA.y
+            x: (constraint.bodyA ? constraint.bodyA.position.x : 0) 
+                + (constraint.pointA ? constraint.pointA.x : 0),
+            y: (constraint.bodyA ? constraint.bodyA.position.y : 0) 
+                + (constraint.pointA ? constraint.pointA.y : 0)
         };
     };
 
@@ -325,8 +327,10 @@ var Common = require('../core/Common');
      */
     Constraint.pointBWorld = function(constraint) {
         return {
-            x: (constraint.bodyB ? constraint.bodyB.position.x : 0) + constraint.pointB.x,
-            y: (constraint.bodyB ? constraint.bodyB.position.y : 0) + constraint.pointB.y
+            x: (constraint.bodyB ? constraint.bodyB.position.x : 0) 
+                + (constraint.pointB ? constraint.pointB.x : 0),
+            y: (constraint.bodyB ? constraint.bodyB.position.y : 0) 
+                + (constraint.pointB ? constraint.pointB.y : 0)
         };
     };
 

src/physics/matter-js/lib/core/Common.js

@@ -13,7 +13,9 @@ module.exports = Common;
     Common._nextId = 0;
     Common._seed = 0;
     Common._nowStartTime = +(new Date());
-
+    Common._warnedOnce = {};
+    Common._decomp = null;
+    
     /**
      * Extends the object in the first argument using the object in the second argument.
      * @method extend
@@ -221,7 +223,7 @@ module.exports = Common;
      * @return {boolean} True if the object is a string, otherwise false
      */
     Common.isString = function(obj) {
-        return Object.prototype.toString.call(obj) === '[object String]';
+        return toString.call(obj) === '[object String]';
     };
     
     /**
@@ -252,9 +254,9 @@ module.exports = Common;
     
     /**
      * Returns the current timestamp since the time origin (e.g. from page load).
-     * The result will be high-resolution including decimal places if available.
+     * The result is in milliseconds and will use high-resolution timing if available.
      * @method now
-     * @return {number} the current timestamp
+     * @return {number} the current timestamp in milliseconds
      */
     Common.now = function() {
         if (typeof window !== 'undefined' && window.performance) {
@@ -265,6 +267,10 @@ module.exports = Common;
             }
         }
 
+        if (Date.now) {
+            return Date.now();
+        }
+
         return (new Date()) - Common._nowStartTime;
     };
     
@@ -358,6 +364,35 @@ module.exports = Common;
         }
     };
 
+    /**
+     * Uses `Common.warn` to log the given message one time only.
+     * @method warnOnce
+     * @param ...objs {} The objects to log.
+     */
+    Common.warnOnce = function() {
+        var message = Array.prototype.slice.call(arguments).join(' ');
+
+        if (!Common._warnedOnce[message]) {
+            Common.warn(message);
+            Common._warnedOnce[message] = true;
+        }
+    };
+
+    /**
+     * Shows a deprecated console warning when the function on the given object is called.
+     * The target function will be replaced with a new function that first shows the warning
+     * and then calls the original function.
+     * @method deprecated
+     * @param {object} obj The object or module
+     * @param {string} name The property name of the function on obj
+     * @param {string} warning The one-time message to show if the function is called
+     */
+    Common.deprecated = function(obj, prop, warning) {
+        obj[prop] = Common.chain(function() {
+            Common.warnOnce('🔅 deprecated 🔅', warning);
+        }, obj[prop]);
+    };
+
     /**
      * Returns the next unique sequential ID.
      * @method nextId
@@ -535,4 +570,42 @@ module.exports = Common;
             func
         ));
     };
+
+    /**
+     * Provide the [poly-decomp](https://github.com/schteppe/poly-decomp.js) library module to enable
+     * concave vertex decomposition support when using `Bodies.fromVertices` e.g. `Common.setDecomp(require('poly-decomp'))`.
+     * @method setDecomp
+     * @param {} decomp The [poly-decomp](https://github.com/schteppe/poly-decomp.js) library module.
+     */
+    Common.setDecomp = function(decomp) {
+        Common._decomp = decomp;
+    };
+
+    /**
+     * Returns the [poly-decomp](https://github.com/schteppe/poly-decomp.js) library module provided through `Common.setDecomp`,
+     * otherwise returns the global `decomp` if set.
+     * @method getDecomp
+     * @return {} The [poly-decomp](https://github.com/schteppe/poly-decomp.js) library module if provided.
+     */
+    Common.getDecomp = function() {
+        // get user provided decomp if set
+        var decomp = Common._decomp;
+
+        try {
+            // otherwise from window global
+            if (!decomp && typeof window !== 'undefined') {
+                decomp = window.decomp;
+            }
+    
+            // otherwise from node global
+            if (!decomp && typeof global !== 'undefined') {
+                decomp = global.decomp;
+            }
+        } catch (e) {
+            // decomp not available
+            decomp = null;
+        }
+
+        return decomp;
+    };
 })();

src/physics/matter-js/lib/core/Engine.js

@@ -12,12 +12,10 @@ var Engine = {};
 
 module.exports = Engine;
 
-var World = require('../body/World');
 var Sleeping = require('./Sleeping');
 var Resolver = require('../collision/Resolver');
+var Detector = require('../collision/Detector');
 var Pairs = require('../collision/Pairs');
-var Metrics = require('./Metrics');
-var Grid = require('../collision/Grid');
 var Events = require('./Events');
 var Composite = require('../body/Composite');
 var Constraint = require('../constraint/Constraint');
@@ -34,16 +32,9 @@ var Body = require('../body/Body');
      * @param {object} [options]
      * @return {engine} engine
      */
-    Engine.create = function(element, options) {
-        // options may be passed as the first (and only) argument
-        options = Common.isElement(element) ? options : element;
-        element = Common.isElement(element) ? element : null;
+    Engine.create = function(options) {
         options = options || {};
 
-        if (element || options.render) {
-            Common.warn('Engine.create: engine.render is deprecated (see docs)');
-        }
-
         var defaults = {
             positionIterations: 6,
             velocityIterations: 4,
@@ -51,26 +42,31 @@ var Body = require('../body/Body');
             enableSleeping: false,
             events: [],
             plugin: {},
+            gravity: {
+                x: 0,
+                y: 1,
+                scale: 0.001
+            },
             timing: {
                 timestamp: 0,
-                timeScale: 1
-            },
-            broadphase: {
-                controller: Grid
+                timeScale: 1,
+                lastDelta: 0,
+                lastElapsed: 0
             }
         };
 
         var engine = Common.extend(defaults, options);
 
-        engine.world = options.world || World.create(engine.world);
-        engine.pairs = Pairs.create();
-        engine.broadphase = engine.broadphase.controller.create(engine.broadphase);
-        engine.metrics = engine.metrics || { extended: false };
-
-        // @if DEBUG
-        engine.metrics = Metrics.create(engine.metrics);
-        // @endif
+        engine.world = options.world || Composite.create({ label: 'World' });
+        engine.pairs = options.pairs || Pairs.create();
+        engine.detector = options.detector || Detector.create();
 
+        // for temporary back compatibility only
+        engine.grid = { buckets: [] };
+        engine.world.gravity = engine.gravity;
+        engine.broadphase = engine.grid;
+        engine.metrics = {};
+        
         return engine;
     };
 
@@ -90,17 +86,21 @@ var Body = require('../body/Body');
      * @param {number} [correction=1]
      */
     Engine.update = function(engine, delta, correction) {
+        var startTime = Common.now();
+
         delta = delta || 1000 / 60;
         correction = correction || 1;
 
         var world = engine.world,
+            detector = engine.detector,
+            pairs = engine.pairs,
             timing = engine.timing,
-            broadphase = engine.broadphase,
-            broadphasePairs = [],
+            timestamp = timing.timestamp,
             i;
 
         // increment timestamp
         timing.timestamp += delta * timing.timeScale;
+        timing.lastDelta = delta * timing.timeScale;
 
         // create an event object
         var event = {
@@ -109,21 +109,26 @@ var Body = require('../body/Body');
 
         Events.trigger(engine, 'beforeUpdate', event);
 
-        // get lists of all bodies and constraints, no matter what composites they are in
+        // get all bodies and all constraints in the world
         var allBodies = Composite.allBodies(world),
             allConstraints = Composite.allConstraints(world);
 
-        // @if DEBUG
-        // reset metrics logging
-        Metrics.reset(engine.metrics);
-        // @endif
+        // update the detector bodies if they have changed
+        if (world.isModified) {
+            Detector.setBodies(detector, allBodies);
+        }
 
-        // if sleeping enabled, call the sleeping controller
+        // reset all composite modified flags
+        if (world.isModified) {
+            Composite.setModified(world, false, false, true);
+        }
+
+        // update sleeping if enabled
         if (engine.enableSleeping)
             Sleeping.update(allBodies, timing.timeScale);
 
-        // applies gravity to all bodies
-        Engine._bodiesApplyGravity(allBodies, world.gravity);
+        // apply gravity to all bodies
+        Engine._bodiesApplyGravity(allBodies, engine.gravity);
 
         // update all body position and rotation by integration
         Engine._bodiesUpdate(allBodies, delta, timing.timeScale, correction, world.bounds);
@@ -135,33 +140,12 @@ var Body = require('../body/Body');
         }
         Constraint.postSolveAll(allBodies);
 
-        // broadphase pass: find potential collision pairs
-        if (broadphase.controller) {
-            // if world is dirty, we must flush the whole grid
-            if (world.isModified)
-                broadphase.controller.clear(broadphase);
-
-            // update the grid buckets based on current bodies
-            broadphase.controller.update(broadphase, allBodies, engine, world.isModified);
-            broadphasePairs = broadphase.pairsList;
-        } else {
-            // if no broadphase set, we just pass all bodies
-            broadphasePairs = allBodies;
-        }
-
-        // clear all composite modified flags
-        if (world.isModified) {
-            Composite.setModified(world, false, false, true);
-        }
-
-        // narrowphase pass: find actual collisions, then create or update collision pairs
-        var collisions = broadphase.detector(broadphasePairs, engine);
+        // find all collisions
+        detector.pairs = engine.pairs;
+        var collisions = Detector.collisions(detector);
 
         // update collision pairs
-        var pairs = engine.pairs,
-            timestamp = timing.timestamp;
         Pairs.update(pairs, collisions, timestamp);
-        Pairs.removeOld(pairs, timestamp);
 
         // wake up bodies involved in collisions
         if (engine.enableSleeping)
@@ -174,7 +158,7 @@ var Body = require('../body/Body');
         // iteratively resolve position between collisions
         Resolver.preSolvePosition(pairs.list);
         for (i = 0; i < engine.positionIterations; i++) {
-            Resolver.solvePosition(pairs.list, allBodies, timing.timeScale);
+            Resolver.solvePosition(pairs.list, timing.timeScale);
         }
         Resolver.postSolvePosition(allBodies);
 
@@ -198,16 +182,14 @@ var Body = require('../body/Body');
         if (pairs.collisionEnd.length > 0)
             Events.trigger(engine, 'collisionEnd', { pairs: pairs.collisionEnd });
 
-        // @if DEBUG
-        // update metrics log
-        Metrics.update(engine.metrics, engine);
-        // @endif
-
         // clear force buffers
         Engine._bodiesClearForces(allBodies);
 
         Events.trigger(engine, 'afterUpdate', event);
 
+        // log the time elapsed computing this update
+        engine.timing.lastElapsed = Common.now() - startTime;
+
         return engine;
     };
     
@@ -236,21 +218,13 @@ var Body = require('../body/Body');
     };
 
     /**
-     * Clears the engine including the world, pairs and broadphase.
+     * Clears the engine pairs and detector.
      * @method clear
      * @param {engine} engine
      */
     Engine.clear = function(engine) {
-        var world = engine.world;
-        
         Pairs.clear(engine.pairs);
-
-        var broadphase = engine.broadphase;
-        if (broadphase.controller) {
-            var bodies = Composite.allBodies(world);
-            broadphase.controller.clear(broadphase);
-            broadphase.controller.update(broadphase, bodies, engine, true);
-        }
+        Detector.clear(engine.detector);
     };
 
     /**
@@ -320,7 +294,8 @@ var Body = require('../body/Body');
     };
 
     /**
-     * An alias for `Runner.run`, see `Matter.Runner` for more information.
+     * A deprecated alias for `Runner.run`, use `Matter.Runner.run(engine)` instead and see `Matter.Runner` for more information.
+     * @deprecated use Matter.Runner.run(engine) instead
      * @method run
      * @param {engine} engine
      */
@@ -329,53 +304,53 @@ var Body = require('../body/Body');
     * Fired just before an update
     *
     * @event beforeUpdate
-    * @param {} event An event object
+    * @param {object} event An event object
     * @param {number} event.timestamp The engine.timing.timestamp of the event
-    * @param {} event.source The source object of the event
-    * @param {} event.name The name of the event
+    * @param {engine} event.source The source object of the event
+    * @param {string} event.name The name of the event
     */
 
     /**
     * Fired after engine update and all collision events
     *
     * @event afterUpdate
-    * @param {} event An event object
+    * @param {object} event An event object
     * @param {number} event.timestamp The engine.timing.timestamp of the event
-    * @param {} event.source The source object of the event
-    * @param {} event.name The name of the event
+    * @param {engine} event.source The source object of the event
+    * @param {string} event.name The name of the event
     */
 
     /**
     * Fired after engine update, provides a list of all pairs that have started to collide in the current tick (if any)
     *
     * @event collisionStart
-    * @param {} event An event object
-    * @param {} event.pairs List of affected pairs
+    * @param {object} event An event object
+    * @param {pair[]} event.pairs List of affected pairs
     * @param {number} event.timestamp The engine.timing.timestamp of the event
-    * @param {} event.source The source object of the event
-    * @param {} event.name The name of the event
+    * @param {engine} event.source The source object of the event
+    * @param {string} event.name The name of the event
     */
 
     /**
     * Fired after engine update, provides a list of all pairs that are colliding in the current tick (if any)
     *
     * @event collisionActive
-    * @param {} event An event object
-    * @param {} event.pairs List of affected pairs
+    * @param {object} event An event object
+    * @param {pair[]} event.pairs List of affected pairs
     * @param {number} event.timestamp The engine.timing.timestamp of the event
-    * @param {} event.source The source object of the event
-    * @param {} event.name The name of the event
+    * @param {engine} event.source The source object of the event
+    * @param {string} event.name The name of the event
     */
 
     /**
     * Fired after engine update, provides a list of all pairs that have ended collision in the current tick (if any)
     *
     * @event collisionEnd
-    * @param {} event An event object
-    * @param {} event.pairs List of affected pairs
+    * @param {object} event An event object
+    * @param {pair[]} event.pairs List of affected pairs
     * @param {number} event.timestamp The engine.timing.timestamp of the event
-    * @param {} event.source The source object of the event
-    * @param {} event.name The name of the event
+    * @param {engine} event.source The source object of the event
+    * @param {string} event.name The name of the event
     */
 
     /*
@@ -449,32 +424,56 @@ var Body = require('../body/Body');
      */
 
     /**
-     * An instance of a `Render` controller. The default value is a `Matter.Render` instance created by `Engine.create`.
-     * One may also develop a custom renderer module based on `Matter.Render` and pass an instance of it to `Engine.create` via `options.render`.
+     * A `Number` that represents the total execution time elapsed during the last `Engine.update` in milliseconds.
+     * It is updated by timing from the start of the last `Engine.update` call until it ends.
      *
-     * A minimal custom renderer object must define at least three functions: `create`, `clear` and `world` (see `Matter.Render`).
-     * It is also possible to instead pass the _module_ reference via `options.render.controller` and `Engine.create` will instantiate one for you.
+     * This value will also include the total execution time of all event handlers directly or indirectly triggered by the engine update.
      *
-     * @property render
-     * @type render
-     * @deprecated see Demo.js for an example of creating a renderer
-     * @default a Matter.Render instance
+     * @property timing.lastElapsed
+     * @type number
+     * @default 0
      */
 
     /**
-     * An instance of a broadphase controller. The default value is a `Matter.Grid` instance created by `Engine.create`.
+     * A `Number` that represents the `delta` value used in the last engine update.
      *
+     * @property timing.lastDelta
+     * @type number
+     * @default 0
+     */
+
+    /**
+     * A `Matter.Detector` instance.
+     *
+     * @property detector
+     * @type detector
+     * @default a Matter.Detector instance
+     */
+
+    /**
+     * A `Matter.Grid` instance.
+     *
+     * @deprecated replaced by `engine.detector`
+     * @property grid
+     * @type grid
+     * @default a Matter.Grid instance
+     */
+
+    /**
+     * Replaced by and now alias for `engine.grid`.
+     *
+     * @deprecated replaced by `engine.detector`
      * @property broadphase
      * @type grid
      * @default a Matter.Grid instance
      */
 
     /**
-     * A `World` composite object that will contain all simulated bodies and constraints.
+     * The root `Matter.Composite` instance that will contain all bodies, constraints and other composites to be simulated by this engine.
      *
      * @property world
-     * @type world
-     * @default a Matter.World instance
+     * @type composite
+     * @default a Matter.Composite instance
      */
 
     /**
@@ -484,4 +483,35 @@ var Body = require('../body/Body');
      * @type {}
      */
 
+    /**
+     * The gravity to apply on all bodies in `engine.world`.
+     *
+     * @property gravity
+     * @type object
+     */
+
+    /**
+     * The gravity x component.
+     *
+     * @property gravity.x
+     * @type object
+     * @default 0
+     */
+
+    /**
+     * The gravity y component.
+     *
+     * @property gravity.y
+     * @type object
+     * @default 1
+     */
+
+    /**
+     * The gravity scale factor.
+     *
+     * @property gravity.scale
+     * @type object
+     * @default 0.001
+     */
+
 })();

src/physics/matter-js/lib/core/Matter.js

@@ -27,7 +27,7 @@ var Common = require('./Common');
      * @readOnly
      * @type {String}
      */
-    Matter.version = '0.14.2';
+    Matter.version = '0.18.0';
 
     /**
      * A list of plugin dependencies to be installed. These are normally set and installed through `Matter.use`.

src/physics/matter-js/lib/core/Metrics.js

@@ -1,93 +0,0 @@
-// @if DEBUG
-/**
-* _Internal Class_, not generally used outside of the engine's internals.
-*
-*/
-
-var Metrics = {};
-
-module.exports = Metrics;
-
-var Composite = require('../body/Composite');
-var Common = require('./Common');
-
-(function() {
-
-    /**
-     * Creates a new metrics.
-     * @method create
-     * @private
-     * @return {metrics} A new metrics
-     */
-    Metrics.create = function(options) {
-        var defaults = {
-            extended: false,
-            narrowDetections: 0,
-            narrowphaseTests: 0,
-            narrowReuse: 0,
-            narrowReuseCount: 0,
-            midphaseTests: 0,
-            broadphaseTests: 0,
-            narrowEff: 0.0001,
-            midEff: 0.0001,
-            broadEff: 0.0001,
-            collisions: 0,
-            buckets: 0,
-            bodies: 0,
-            pairs: 0
-        };
-
-        return Common.extend(defaults, false, options);
-    };
-
-    /**
-     * Resets metrics.
-     * @method reset
-     * @private
-     * @param {metrics} metrics
-     */
-    Metrics.reset = function(metrics) {
-        if (metrics.extended) {
-            metrics.narrowDetections = 0;
-            metrics.narrowphaseTests = 0;
-            metrics.narrowReuse = 0;
-            metrics.narrowReuseCount = 0;
-            metrics.midphaseTests = 0;
-            metrics.broadphaseTests = 0;
-            metrics.narrowEff = 0;
-            metrics.midEff = 0;
-            metrics.broadEff = 0;
-            metrics.collisions = 0;
-            metrics.buckets = 0;
-            metrics.pairs = 0;
-            metrics.bodies = 0;
-        }
-    };
-
-    /**
-     * Updates metrics.
-     * @method update
-     * @private
-     * @param {metrics} metrics
-     * @param {engine} engine
-     */
-    Metrics.update = function(metrics, engine) {
-        if (metrics.extended) {
-            var world = engine.world,
-                bodies = Composite.allBodies(world);
-
-            metrics.collisions = metrics.narrowDetections;
-            metrics.pairs = engine.pairs.list.length;
-            metrics.bodies = bodies.length;
-            metrics.midEff = (metrics.narrowDetections / (metrics.midphaseTests || 1)).toFixed(2);
-            metrics.narrowEff = (metrics.narrowDetections / (metrics.narrowphaseTests || 1)).toFixed(2);
-            metrics.broadEff = (1 - (metrics.broadphaseTests / (bodies.length || 1))).toFixed(2);
-            metrics.narrowReuse = (metrics.narrowReuseCount / (metrics.narrowphaseTests || 1)).toFixed(2);
-            //var broadphase = engine.broadphase[engine.broadphase.current];
-            //if (broadphase.instance)
-            //    metrics.buckets = Common.keys(broadphase.instance.buckets).length;
-        }
-    };
-
-})();
-// @endif

src/physics/matter-js/lib/core/Plugin.js

@@ -46,7 +46,7 @@ var Common = require('./Common');
     };
 
     /**
-     * Resolves a dependency to a plugin object from the registry if it exists. 
+     * Resolves a dependency to a plugin object from the registry if it exists.
      * The `dependency` may contain a version, but only the name matters when resolving.
      * @method resolve
      * @param dependency {string} The dependency.
@@ -240,7 +240,7 @@ var Common = require('./Common');
      */
     Plugin.dependencyParse = function(dependency) {
         if (Common.isString(dependency)) {
-            var pattern = /^[\w-]+(@(\*|[\^~]?\d+\.\d+\.\d+(-[0-9A-Za-z-]+)?))?$/;
+            var pattern = /^[\w-]+(@(\*|[\^~]?\d+\.\d+\.\d+(-[0-9A-Za-z-+]+)?))?$/;
 
             if (!pattern.test(dependency)) {
                 Common.warn('Plugin.dependencyParse:', dependency, 'is not a valid dependency string.');
@@ -259,13 +259,15 @@ var Common = require('./Common');
     };
 
     /**
-     * Parses a version string into its components.  
+     * Parses a version string into its components.
      * Versions are strictly of the format `x.y.z` (as in [semver](http://semver.org/)).
      * Versions may optionally have a prerelease tag in the format `x.y.z-alpha`.
      * Ranges are a strict subset of [npm ranges](https://docs.npmjs.com/misc/semver#advanced-range-syntax).
      * Only the following range types are supported:
      * - Tilde ranges e.g. `~1.2.3`
      * - Caret ranges e.g. `^1.2.3`
+     * - Greater than ranges e.g. `>1.2.3`
+     * - Greater than or equal ranges e.g. `>=1.2.3`
      * - Exact version e.g. `1.2.3`
      * - Any version `*`
      * @method versionParse
@@ -273,29 +275,28 @@ var Common = require('./Common');
      * @return {object} The version range parsed into its components.
      */
     Plugin.versionParse = function(range) {
-        var pattern = /^\*|[\^~]?\d+\.\d+\.\d+(-[0-9A-Za-z-]+)?$/;
+        var pattern = /^(\*)|(\^|~|>=|>)?\s*((\d+)\.(\d+)\.(\d+))(-[0-9A-Za-z-+]+)?$/;
 
         if (!pattern.test(range)) {
             Common.warn('Plugin.versionParse:', range, 'is not a valid version or range.');
         }
 
-        var identifiers = range.split('-');
-        range = identifiers[0];
-
-        var isRange = isNaN(Number(range[0])),
-            version = isRange ? range.substr(1) : range,
-            parts = Common.map(version.split('.'), function(part) {
-                return Number(part);
-            });
+        var parts = pattern.exec(range);
+        var major = Number(parts[4]);
+        var minor = Number(parts[5]);
+        var patch = Number(parts[6]);
 
         return {
-            isRange: isRange,
-            version: version,
+            isRange: Boolean(parts[1] || parts[2]),
+            version: parts[3],
             range: range,
-            operator: isRange ? range[0] : '',
-            parts: parts,
-            prerelease: identifiers[1],
-            number: parts[0] * 1e8 + parts[1] * 1e4 + parts[2]
+            operator: parts[1] || parts[2] || '',
+            major: major,
+            minor: minor,
+            patch: patch,
+            parts: [major, minor, patch],
+            prerelease: parts[7],
+            number: major * 1e8 + minor * 1e4 + patch
         };
     };
 
@@ -311,30 +312,36 @@ var Common = require('./Common');
     Plugin.versionSatisfies = function(version, range) {
         range = range || '*';
 
-        var rangeParsed = Plugin.versionParse(range),
-            rangeParts = rangeParsed.parts,
-            versionParsed = Plugin.versionParse(version),
-            versionParts = versionParsed.parts;
+        var r = Plugin.versionParse(range),
+            v = Plugin.versionParse(version);
 
-        if (rangeParsed.isRange) {
-            if (rangeParsed.operator === '*' || version === '*') {
+        if (r.isRange) {
+            if (r.operator === '*' || version === '*') {
                 return true;
             }
 
-            if (rangeParsed.operator === '~') {
-                return versionParts[0] === rangeParts[0] && versionParts[1] === rangeParts[1] && versionParts[2] >= rangeParts[2];
+            if (r.operator === '>') {
+                return v.number > r.number;
             }
 
-            if (rangeParsed.operator === '^') {
-                if (rangeParts[0] > 0) {
-                    return versionParts[0] === rangeParts[0] && versionParsed.number >= rangeParsed.number;
+            if (r.operator === '>=') {
+                return v.number >= r.number;
+            }
+
+            if (r.operator === '~') {
+                return v.major === r.major && v.minor === r.minor && v.patch >= r.patch;
+            }
+
+            if (r.operator === '^') {
+                if (r.major > 0) {
+                    return v.major === r.major && v.number >= r.number;
                 }
 
-                if (rangeParts[1] > 0) {
-                    return versionParts[1] === rangeParts[1] && versionParts[2] >= rangeParts[2];
+                if (r.minor > 0) {
+                    return v.minor === r.minor && v.patch >= r.patch;
                 }
 
-                return versionParts[2] === rangeParts[2];
+                return v.patch === r.patch;
             }
         }
 

src/physics/matter-js/lib/core/Runner.js

@@ -101,7 +101,6 @@ var Common = require('./Common');
     /**
      * A game loop utility that updates the engine and renderer by one step (a 'tick').
      * Features delta smoothing, time correction and fixed or dynamic timing.
-     * Triggers `beforeTick`, `tick` and `afterTick` events on the engine.
      * Consider just `Engine.update(engine, delta)` if you're using your own loop.
      * @method tick
      * @param {runner} runner
@@ -119,7 +118,6 @@ var Common = require('./Common');
         };
 
         Events.trigger(runner, 'beforeTick', event);
-        Events.trigger(engine, 'beforeTick', event); // @deprecated
 
         if (runner.isFixed) {
             // fixed timestep
@@ -164,35 +162,13 @@ var Common = require('./Common');
         }
 
         Events.trigger(runner, 'tick', event);
-        Events.trigger(engine, 'tick', event); // @deprecated
-
-        // if world has been modified, clear the render scene graph
-        if (engine.world.isModified 
-            && engine.render
-            && engine.render.controller
-            && engine.render.controller.clear) {
-            engine.render.controller.clear(engine.render); // @deprecated
-        }
 
         // update
         Events.trigger(runner, 'beforeUpdate', event);
         Engine.update(engine, delta, correction);
         Events.trigger(runner, 'afterUpdate', event);
 
-        // render
-        // @deprecated
-        if (engine.render && engine.render.controller) {
-            Events.trigger(runner, 'beforeRender', event);
-            Events.trigger(engine, 'beforeRender', event); // @deprecated
-
-            engine.render.controller.world(engine.render);
-
-            Events.trigger(runner, 'afterRender', event);
-            Events.trigger(engine, 'afterRender', event); // @deprecated
-        }
-
         Events.trigger(runner, 'afterTick', event);
-        Events.trigger(engine, 'afterTick', event); // @deprecated
     };
 
     /**
@@ -271,28 +247,6 @@ var Common = require('./Common');
     * @param {} event.name The name of the event
     */
 
-    /**
-    * Fired before rendering
-    *
-    * @event beforeRender
-    * @param {} event An event object
-    * @param {number} event.timestamp The engine.timing.timestamp of the event
-    * @param {} event.source The source object of the event
-    * @param {} event.name The name of the event
-    * @deprecated
-    */
-
-    /**
-    * Fired after rendering
-    *
-    * @event afterRender
-    * @param {} event An event object
-    * @param {number} event.timestamp The engine.timing.timestamp of the event
-    * @param {} event.source The source object of the event
-    * @param {} event.name The name of the event
-    * @deprecated
-    */
-
     /*
     *
     *  Properties Documentation

src/physics/matter-js/lib/factory/Bodies.js

@@ -18,7 +18,6 @@ var Common = require('../core/Common');
 var Body = require('../body/Body');
 var Bounds = require('../geometry/Bounds');
 var Vector = require('../geometry/Vector');
-var decomp = require('../../poly-decomp');
 
 (function() {
 
@@ -177,29 +176,46 @@ var decomp = require('../../poly-decomp');
     };
 
     /**
-     * Creates a body using the supplied vertices (or an array containing multiple sets of vertices).
-     * If the vertices are convex, they will pass through as supplied.
-     * Otherwise if the vertices are concave, they will be decomposed if [poly-decomp.js](https://github.com/schteppe/poly-decomp.js) is available.
-     * Note that this process is not guaranteed to support complex sets of vertices (e.g. those with holes may fail).
-     * By default the decomposition will discard collinear edges (to improve performance).
-     * It can also optionally discard any parts that have an area less than `minimumArea`.
-     * If the vertices can not be decomposed, the result will fall back to using the convex hull.
-     * The options parameter is an object that specifies any `Matter.Body` properties you wish to override the defaults.
+     * Utility to create a compound body based on set(s) of vertices.
+     * 
+     * _Note:_ To optionally enable automatic concave vertices decomposition the [poly-decomp](https://github.com/schteppe/poly-decomp.js) 
+     * package must be first installed and provided see `Common.setDecomp`, otherwise the convex hull of each vertex set will be used.
+     * 
+     * The resulting vertices are reorientated about their centre of mass,
+     * and offset such that `body.position` corresponds to this point.
+     * 
+     * The resulting offset may be found if needed by subtracting `body.bounds` from the original input bounds.
+     * To later move the centre of mass see `Body.setCentre`.
+     * 
+     * Note that automatic conconcave decomposition results are not always optimal. 
+     * For best results, simplify the input vertices as much as possible first.
+     * By default this function applies some addtional simplification to help.
+     * 
+     * Some outputs may also require further manual processing afterwards to be robust.
+     * In particular some parts may need to be overlapped to avoid collision gaps.
+     * Thin parts and sharp points should be avoided or removed where possible.
+     *
+     * The options parameter object specifies any `Matter.Body` properties you wish to override the defaults.
+     * 
      * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object.
      * @method fromVertices
      * @param {number} x
      * @param {number} y
-     * @param [[vector]] vertexSets
-     * @param {object} [options]
-     * @param {bool} [flagInternal=false]
-     * @param {number} [removeCollinear=0.01]
-     * @param {number} [minimumArea=10]
+     * @param {array} vertexSets One or more arrays of vertex points e.g. `[[{ x: 0, y: 0 }...], ...]`.
+     * @param {object} [options] The body options.
+     * @param {bool} [flagInternal=false] Optionally marks internal edges with `isInternal`.
+     * @param {number} [removeCollinear=0.01] Threshold when simplifying vertices along the same edge.
+     * @param {number} [minimumArea=10] Threshold when removing small parts.
+     * @param {number} [removeDuplicatePoints=0.01] Threshold when simplifying nearby vertices.
      * @return {body}
      */
-    Bodies.fromVertices = function(x, y, vertexSets, options, flagInternal, removeCollinear, minimumArea) {
-        var body,
+    Bodies.fromVertices = function(x, y, vertexSets, options, flagInternal, removeCollinear, minimumArea, removeDuplicatePoints) {
+        var decomp = Common.getDecomp(),
+            canDecomp,
+            body,
             parts,
             isConvex,
+            isConcave,
             vertices,
             i,
             j,
@@ -207,16 +223,16 @@ var decomp = require('../../poly-decomp');
             v,
             z;
 
+        // check decomp is as expected
+        canDecomp = Boolean(decomp && decomp.quickDecomp);
+
         options = options || {};
         parts = [];
 
         flagInternal = typeof flagInternal !== 'undefined' ? flagInternal : false;
         removeCollinear = typeof removeCollinear !== 'undefined' ? removeCollinear : 0.01;
         minimumArea = typeof minimumArea !== 'undefined' ? minimumArea : 10;
-
-        if (!decomp) {
-            Common.warn('Bodies.fromVertices: poly-decomp.js required. Could not decompose vertices. Fallback to convex hull.');
-        }
+        removeDuplicatePoints = typeof removeDuplicatePoints !== 'undefined' ? removeDuplicatePoints : 0.01;
 
         // ensure vertexSets is an array of arrays
         if (!Common.isArray(vertexSets[0])) {
@@ -226,8 +242,15 @@ var decomp = require('../../poly-decomp');
         for (v = 0; v < vertexSets.length; v += 1) {
             vertices = vertexSets[v];
             isConvex = Vertices.isConvex(vertices);
+            isConcave = !isConvex;
 
-            if (isConvex || !decomp) {
+            if (isConcave && !canDecomp) {
+                Common.warnOnce(
+                    'Bodies.fromVertices: Install the \'poly-decomp\' library and use Common.setDecomp or provide \'decomp\' as a global to decompose concave vertices.'
+                );
+            }
+
+            if (isConvex || !canDecomp) {
                 if (isConvex) {
                     vertices = Vertices.clockwiseSort(vertices);
                 } else {
@@ -249,6 +272,8 @@ var decomp = require('../../poly-decomp');
                 decomp.makeCCW(concave);
                 if (removeCollinear !== false)
                     decomp.removeCollinearPoints(concave, removeCollinear);
+                if (removeDuplicatePoints !== false && decomp.removeDuplicatePoints)
+                    decomp.removeDuplicatePoints(concave, removeDuplicatePoints);
 
                 // use the quick decomposition algorithm (Bayazit)
                 var decomposed = decomp.quickDecomp(concave);
@@ -283,14 +308,45 @@ var decomp = require('../../poly-decomp');
             parts[i] = Body.create(Common.extend(parts[i], options));
         }
 
-        if (flagInternal)
-        {
-            Bodies.flagCoincidentParts(parts, 5);
+        // flag internal edges (coincident part edges)
+        if (flagInternal) {
+            var coincident_max_dist = 5;
+
+            for (i = 0; i < parts.length; i++) {
+                var partA = parts[i];
+
+                for (j = i + 1; j < parts.length; j++) {
+                    var partB = parts[j];
+
+                    if (Bounds.overlaps(partA.bounds, partB.bounds)) {
+                        var pav = partA.vertices,
+                            pbv = partB.vertices;
+
+                        // iterate vertices of both parts
+                        for (k = 0; k < partA.vertices.length; k++) {
+                            for (z = 0; z < partB.vertices.length; z++) {
+                                // find distances between the vertices
+                                var da = Vector.magnitudeSquared(Vector.sub(pav[(k + 1) % pav.length], pbv[z])),
+                                    db = Vector.magnitudeSquared(Vector.sub(pav[k], pbv[(z + 1) % pbv.length]));
+
+                                // if both vertices are very close, consider the edge concident (internal)
+                                if (da < coincident_max_dist && db < coincident_max_dist) {
+                                    pav[k].isInternal = true;
+                                    pbv[z].isInternal = true;
+                                }
+                            }
+                        }
+
+                    }
+                }
+            }
         }
 
         if (parts.length > 1) {
             // create the parent body to be returned, that contains generated compound parts
             body = Body.create(Common.extend({ parts: parts.slice(0) }, options));
+
+            // offset such that body.position is at the centre off mass
             Body.setPosition(body, { x: x, y: y });
 
             return body;
@@ -299,54 +355,4 @@ var decomp = require('../../poly-decomp');
         }
     };
 
-    /**
-     * Takes an array of Body objects and flags all internal edges (coincident parts) based on the maxDistance
-     * value. The array is changed in-place and returned, so you can pass this function a `Body.parts` property.
-     * 
-     * @method flagCoincidentParts
-     * @param {body[]} parts - The Body parts, or array of bodies, to flag.
-     * @param {number} [maxDistance=5]
-     * @return {body[]} The modified `parts` parameter.
-     */
-    Bodies.flagCoincidentParts = function (parts, maxDistance)
-    {
-        if (maxDistance === undefined) { maxDistance = 5; }
-
-        for (var i = 0; i < parts.length; i++)
-        {
-            var partA = parts[i];
-
-            for (var j = i + 1; j < parts.length; j++)
-            {
-                var partB = parts[j];
-
-                if (Bounds.overlaps(partA.bounds, partB.bounds))
-                {
-                    var pav = partA.vertices;
-                    var pbv = partB.vertices;
-
-                    // iterate vertices of both parts
-                    for (var k = 0; k < partA.vertices.length; k++)
-                    {
-                        for (var z = 0; z < partB.vertices.length; z++)
-                        {
-                            // find distances between the vertices
-                            var da = Vector.magnitudeSquared(Vector.sub(pav[(k + 1) % pav.length], pbv[z]));
-                            var db = Vector.magnitudeSquared(Vector.sub(pav[k], pbv[(z + 1) % pbv.length]));
-
-                            // if both vertices are very close, consider the edge concident (internal)
-                            if (da < maxDistance && db < maxDistance)
-                            {
-                                pav[k].isInternal = true;
-                                pbv[z].isInternal = true;
-                            }
-                        }
-                    }
-                }
-            }
-        }
-
-        return parts;
-    };
-
 })();

src/physics/matter-js/lib/factory/Composites.js

@@ -16,6 +16,7 @@ var Constraint = require('../constraint/Constraint');
 var Common = require('../core/Common');
 var Body = require('../body/Body');
 var Bodies = require('./Bodies');
+var deprecated = Common.deprecated;
 
 (function() {
 
@@ -202,7 +203,8 @@ var Bodies = require('./Bodies');
     };
 
     /**
-     * Creates a composite with a Newton's Cradle setup of bodies and constraints.
+     * This has now moved to the [newtonsCradle example](https://github.com/liabru/matter-js/blob/master/examples/newtonsCradle.js), follow that instead as this function is deprecated here.
+     * @deprecated moved to newtonsCradle example
      * @method newtonsCradle
      * @param {number} xx
      * @param {number} yy
@@ -226,9 +228,12 @@ var Bodies = require('./Bodies');
 
         return newtonsCradle;
     };
+
+    deprecated(Composites, 'newtonsCradle', 'Composites.newtonsCradle ➤ moved to newtonsCradle example');
     
     /**
-     * Creates a composite with simple car setup of bodies and constraints.
+     * This has now moved to the [car example](https://github.com/liabru/matter-js/blob/master/examples/car.js), follow that instead as this function is deprecated here.
+     * @deprecated moved to car example
      * @method car
      * @param {number} xx
      * @param {number} yy
@@ -294,8 +299,12 @@ var Bodies = require('./Bodies');
         return car;
     };
 
+    deprecated(Composites, 'car', 'Composites.car ➤ moved to car example');
+
     /**
-     * Creates a simple soft body like object.
+     * This has now moved to the [softBody example](https://github.com/liabru/matter-js/blob/master/examples/softBody.js)
+     * and the [cloth example](https://github.com/liabru/matter-js/blob/master/examples/cloth.js), follow those instead as this function is deprecated here.
+     * @deprecated moved to softBody and cloth examples
      * @method softBody
      * @param {number} xx
      * @param {number} yy
@@ -324,4 +333,5 @@ var Bodies = require('./Bodies');
         return softBody;
     };
 
+    deprecated(Composites, 'softBody', 'Composites.softBody ➤ moved to softBody and cloth examples');
 })();

src/physics/matter-js/lib/geometry/Vertices.js

@@ -44,17 +44,9 @@ var Common = require('../core/Common');
                     y: point.y,
                     index: i,
                     body: body,
-                    isInternal: false,
-                    contact: null,
-                    offset: null
+                    isInternal: false
                 };
 
-            vertex.contact = {
-                vertex: vertex,
-                normalImpulse: 0,
-                tangentImpulse: 0
-            };
-
             vertices.push(vertex);
         }
 
@@ -177,17 +169,16 @@ var Common = require('../core/Common');
      * @param {number} scalar
      */
     Vertices.translate = function(vertices, vector, scalar) {
-        var i;
-        if (scalar) {
-            for (i = 0; i < vertices.length; i++) {
-                vertices[i].x += vector.x * scalar;
-                vertices[i].y += vector.y * scalar;
-            }
-        } else {
-            for (i = 0; i < vertices.length; i++) {
-                vertices[i].x += vector.x;
-                vertices[i].y += vector.y;
-            }
+        scalar = typeof scalar !== 'undefined' ? scalar : 1;
+
+        var verticesLength = vertices.length,
+            translateX = vector.x * scalar,
+            translateY = vector.y * scalar,
+            i;
+        
+        for (i = 0; i < verticesLength; i++) {
+            vertices[i].x += translateX;
+            vertices[i].y += translateY;
         }
 
         return vertices;
@@ -205,15 +196,21 @@ var Common = require('../core/Common');
             return;
 
         var cos = Math.cos(angle),
-            sin = Math.sin(angle);
+            sin = Math.sin(angle),
+            pointX = point.x,
+            pointY = point.y,
+            verticesLength = vertices.length,
+            vertex,
+            dx,
+            dy,
+            i;
 
-        for (var i = 0; i < vertices.length; i++) {
-            var vertice = vertices[i],
-                dx = vertice.x - point.x,
-                dy = vertice.y - point.y;
-                
-            vertice.x = point.x + (dx * cos - dy * sin);
-            vertice.y = point.y + (dx * sin + dy * cos);
+        for (i = 0; i < verticesLength; i++) {
+            vertex = vertices[i];
+            dx = vertex.x - pointX;
+            dy = vertex.y - pointY;
+            vertex.x = pointX + (dx * cos - dy * sin);
+            vertex.y = pointY + (dx * sin + dy * cos);
         }
 
         return vertices;
@@ -227,12 +224,21 @@ var Common = require('../core/Common');
      * @return {boolean} True if the vertices contains point, otherwise false
      */
     Vertices.contains = function(vertices, point) {
-        for (var i = 0; i < vertices.length; i++) {
-            var vertice = vertices[i],
-                nextVertice = vertices[(i + 1) % vertices.length];
-            if ((point.x - vertice.x) * (nextVertice.y - vertice.y) + (point.y - vertice.y) * (vertice.x - nextVertice.x) > 0) {
+        var pointX = point.x,
+            pointY = point.y,
+            verticesLength = vertices.length,
+            vertex = vertices[verticesLength - 1],
+            nextVertex;
+
+        for (var i = 0; i < verticesLength; i++) {
+            nextVertex = vertices[i];
+
+            if ((pointX - vertex.x) * (nextVertex.y - vertex.y) 
+                + (pointY - vertex.y) * (vertex.x - nextVertex.x) > 0) {
                 return false;
             }
+
+            vertex = nextVertex;
         }
 
         return true;

src/physics/matter-js/lib/plugins/MatterAttractors.js

@@ -9,7 +9,7 @@ var MatterAttractors =
 {
     name: 'matter-attractors',
     version: '0.1.7',
-    for: 'matter-js@^0.14.2',
+    for: 'matter-js@^0.18.0',
     silent: true,
 
     // installs the plugin where `base` is `Matter`

src/physics/matter-js/lib/plugins/MatterCollisionEvents.js

@@ -8,7 +8,7 @@ var MatterCollisionEvents = {
 
     name: 'matter-collision-events',
     version: '0.1.6',
-    for: 'matter-js@^0.14.2',
+    for: 'matter-js@^0.18.0',
     silent: true,
 
     install: function (matter)

src/physics/matter-js/lib/plugins/MatterWrap.js

@@ -9,7 +9,7 @@ var MatterWrap = {
   // plugin meta
   name: 'matter-wrap', // PLUGIN_NAME
   version: '0.1.4', // PLUGIN_VERSION
-  for: 'matter-js@^0.14.2',
+  for: 'matter-js@^0.18.0',
   silent: true, // no console log please
 
   // installs the plugin where `base` is `Matter`
@@ -90,8 +90,8 @@ var MatterWrap = {
 
   Body: {
     /**
-     * Wraps the `body` position such that it always stays within the given bounds. 
-     * Upon crossing a boundary the body will appear on the opposite side of the bounds, 
+     * Wraps the `body` position such that it always stays within the given bounds.
+     * Upon crossing a boundary the body will appear on the opposite side of the bounds,
      * while maintaining its velocity.
      * This is called automatically by the plugin.
      * @function MatterWrap.Body.wrap
@@ -121,7 +121,7 @@ var MatterWrap = {
     bounds: function(composite) {
       var bodies = Matter.Composite.allBodies(composite),
         vertices = [];
-      
+
       for (var i = 0; i < bodies.length; i += 1) {
         var body = bodies[i];
         vertices.push(body.bounds.min, body.bounds.max);
@@ -131,8 +131,8 @@ var MatterWrap = {
     },
 
     /**
-     * Wraps the `composite` position such that it always stays within the given bounds. 
-     * Upon crossing a boundary the composite will appear on the opposite side of the bounds, 
+     * Wraps the `composite` position such that it always stays within the given bounds.
+     * Upon crossing a boundary the composite will appear on the opposite side of the bounds,
      * while maintaining its velocity.
      * This is called automatically by the plugin.
      * @function MatterWrap.Composite.wrap
@@ -142,7 +142,7 @@ var MatterWrap = {
      */
     wrap: function(composite, bounds) {
       var translation = MatterWrap.Bounds.wrap(
-        MatterWrap.Composite.bounds(composite), 
+        MatterWrap.Composite.bounds(composite),
         bounds
       );
 
@@ -163,15 +163,15 @@ module.exports = MatterWrap;
  */
 
 /**
- * This plugin adds a new property `body.plugin.wrap` to instances of `Matter.Body`.  
+ * This plugin adds a new property `body.plugin.wrap` to instances of `Matter.Body`.
  * This is a `Matter.Bounds` instance that specifies the wrapping region.
  * @property {Matter.Bounds} body.plugin.wrap
  * @memberof Matter.Body
  */
 
 /**
- * This plugin adds a new property `composite.plugin.wrap` to instances of `Matter.Composite`.  
+ * This plugin adds a new property `composite.plugin.wrap` to instances of `Matter.Composite`.
  * This is a `Matter.Bounds` instance that specifies the wrapping region.
  * @property {Matter.Bounds} composite.plugin.wrap
  * @memberof Matter.Composite
- */
+ */

src/polyfills/Uint32Array.js

@@ -44,4 +44,6 @@ if (typeof window.Uint32Array !== 'function' && typeof window.Uint32Array !== 'o
     CheapArray('Uint16Array'); // jshint ignore:line
     CheapArray('Int16Array'); // jshint ignore:line
     CheapArray('ArrayBuffer'); // jshint ignore:line
+    CheapArray('Int8Array'); // jshint ignore:line
+    CheapArray('Uint8Array'); // jshint ignore:line
 }

src/renderer/canvas/CanvasRenderer.js

@@ -818,7 +818,10 @@ var CanvasRenderer = new Class({
             sprite.mask.preRenderCanvas(this, sprite, camera);
         }
 
-        ctx.drawImage(frame.source.image, frameX, frameY, frameWidth, frameHeight, x, y, frameWidth / res, frameHeight / res);
+        if (frameWidth > 0 && frameHeight > 0)
+        {
+            ctx.drawImage(frame.source.image, frameX, frameY, frameWidth, frameHeight, x, y, frameWidth / res, frameHeight / res);
+        }
 
         if (sprite.mask)
         {

src/renderer/snapshot/CanvasSnapshot.js

@@ -10,7 +10,7 @@ var GetFastValue = require('../../utils/object/GetFastValue');
 
 /**
  * Takes a snapshot of an area from the current frame displayed by a canvas.
- * 
+ *
  * This is then copied to an Image object. When this loads, the results are sent
  * to the callback provided in the Snapshot Configuration object.
  *
@@ -45,10 +45,13 @@ var CanvasSnapshot = function (canvas, config)
         var copyCanvas = CanvasPool.createWebGL(this, width, height);
         var ctx = copyCanvas.getContext('2d');
 
-        ctx.drawImage(canvas, x, y, width, height, 0, 0, width, height);
+        if (width > 0 && height > 0)
+        {
+            ctx.drawImage(canvas, x, y, width, height, 0, 0, width, height);
+        }
 
         var image1 = new Image();
-    
+
         image1.onerror = function ()
         {
             callback.call(null);
@@ -69,7 +72,7 @@ var CanvasSnapshot = function (canvas, config)
     {
         //  Full Grab
         var image2 = new Image();
-    
+
         image2.onerror = function ()
         {
             callback.call(null);

src/renderer/snapshot/WebGLSnapshot.js

@@ -17,12 +17,12 @@ var GetFastValue = require('../../utils/object/GetFastValue');
  * @function Phaser.Renderer.Snapshot.WebGL
  * @since 3.0.0
  *
- * @param {HTMLCanvasElement} sourceCanvas - The canvas to take a snapshot of.
+ * @param {WebGLRenderingContext} sourceContext - The WebGL context to take a snapshot of.
  * @param {Phaser.Types.Renderer.Snapshot.SnapshotState} config - The snapshot configuration object.
  */
-var WebGLSnapshot = function (sourceCanvas, config)
+var WebGLSnapshot = function (sourceContext, config)
 {
-    var gl = sourceCanvas.getContext('experimental-webgl');
+    var gl = sourceContext;
 
     var callback = GetFastValue(config, 'callback');
     var type = GetFastValue(config, 'type', 'image/png');

src/renderer/webgl/WebGLRenderer.js

@@ -2654,7 +2654,7 @@ var WebGLRenderer = new Class({
 
         if (state.callback)
         {
-            WebGLSnapshot(this.canvas, state);
+            WebGLSnapshot(this.gl, state);
 
             state.callback = null;
         }
@@ -2814,7 +2814,7 @@ var WebGLRenderer = new Class({
 
         this.setFramebuffer(framebuffer);
 
-        WebGLSnapshot(this.canvas, state);
+        WebGLSnapshot(this.gl, state);
 
         this.setFramebuffer(currentFramebuffer);
 

src/sound/BaseSoundManager.js

@@ -194,30 +194,28 @@ var BaseSoundManager = new Class({
         var _this = this;
 
         var body = document.body;
-        var bodyAdd = body.addEventListener;
-        var bodyRemove = body.removeEventListener;
-
-        var unlockHandler = function unlockHandler ()
-        {
-            if (!_this.pendingUnlock)
-            {
-                return;
-            }
-
-            _this.unlockHandler();
-
-            bodyRemove('touchstart', unlockHandler);
-            bodyRemove('touchend', unlockHandler);
-            bodyRemove('click', unlockHandler);
-            bodyRemove('keydown', unlockHandler);
-        };
 
         if (body)
         {
-            bodyAdd('touchstart', unlockHandler, false);
-            bodyAdd('touchend', unlockHandler, false);
-            bodyAdd('click', unlockHandler, false);
-            bodyAdd('keydown', unlockHandler, false);
+            var unlockHandler = function unlockHandler ()
+            {
+                if (!_this.pendingUnlock)
+                {
+                    return;
+                }
+
+                _this.unlockHandler();
+
+                body.removeEventListener('touchstart', unlockHandler);
+                body.removeEventListener('touchend', unlockHandler);
+                body.removeEventListener('click', unlockHandler);
+                body.removeEventListener('keydown', unlockHandler);
+            };
+
+            body.addEventListener('touchstart', unlockHandler, false);
+            body.addEventListener('touchend', unlockHandler, false);
+            body.addEventListener('click', unlockHandler, false);
+            body.addEventListener('keydown', unlockHandler, false);
 
             this.pendingUnlock = true;
         }

src/sound/webaudio/WebAudioSoundManager.js

@@ -156,7 +156,15 @@ var WebAudioSoundManager = new Class({
         }
         else if (window.hasOwnProperty('webkitAudioContext'))
         {
-            context = new window.webkitAudioContext({ latencyHint: 'interactive' });
+            try
+            {
+                context = new window.webkitAudioContext({ latencyHint: 'interactive' });
+            }
+            catch (e)
+            {
+                //  For iOS10 and legacy devices we create without arguments:
+                context = new window.webkitAudioContext();
+            }
         }
 
         this.setAudioContext(context);

src/textures/TextureManager.js

@@ -331,17 +331,20 @@ var TextureManager = new Class({
             var canvas = CanvasPool.create2D(this, cd.width, cd.height);
             var ctx = canvas.getContext('2d');
 
-            ctx.drawImage(
-                textureFrame.source.image,
-                cd.x,
-                cd.y,
-                cd.width,
-                cd.height,
-                0,
-                0,
-                cd.width,
-                cd.height
-            );
+            if (cd.width > 0 && cd.height > 0)
+            {
+                ctx.drawImage(
+                    textureFrame.source.image,
+                    cd.x,
+                    cd.y,
+                    cd.width,
+                    cd.height,
+                    0,
+                    0,
+                    cd.width,
+                    cd.height
+                );
+            }
 
             data = canvas.toDataURL(type, encoderOptions);
 

src/tilemaps/TilemapLayerCanvasRenderer.js

@@ -90,15 +90,14 @@ var TilemapLayerCanvasRenderer = function (renderer, src, camera, parentMatrix)
         var image = tileset.image.getSourceImage();
 
         var tileTexCoords = tileset.getTileTextureCoordinates(tile.index);
+        var tileWidth = tileset.tileWidth;
+        var tileHeight = tileset.tileHeight;
 
-        if (tileTexCoords === null)
+        if (tileTexCoords === null || tileWidth === 0 || tileHeight === 0)
         {
             continue;
         }
 
-        var tileWidth = tileset.tileWidth;
-        var tileHeight = tileset.tileHeight;
-
         var halfWidth = tileWidth * 0.5;
         var halfHeight = tileHeight * 0.5;
 

src/tweens/tween/Tween.js

@@ -967,13 +967,16 @@ var Tween = new Class({
             this.state = TWEEN_CONST.ACTIVE;
         }
 
-        this.isSeeking = true;
-
-        do
+        if (toPosition > 0)
         {
-            this.update(0, delta);
+            this.isSeeking = true;
 
-        } while (this.totalProgress < toPosition);
+            do
+            {
+                this.update(0, delta);
+
+            } while (this.totalProgress < toPosition);
+        }
 
         this.isSeeking = false;
 

src/utils/array/SafeRange.js

@@ -24,8 +24,7 @@ var SafeRange = function (array, startIndex, endIndex, throwError)
     if (startIndex < 0 ||
         startIndex > len ||
         startIndex >= endIndex ||
-        endIndex > len ||
-        startIndex + endIndex > len)
+        endIndex > len)
     {
         if (throwError)
         {

src/utils/object/GetValue.js

@@ -4,47 +4,79 @@
  * @license      {@link https://opensource.org/licenses/MIT|MIT License}
  */
 
-//  Source object
-//  The key as a string, or an array of keys, i.e. 'banner', or 'banner.hideBanner'
-//  The default value to use if the key doesn't exist
-
 /**
- * Retrieves a value from an object.
+ * Retrieves a value from an object, or an alternative object, falling to a back-up default value if not found.
+ *
+ * The key is a string, which can be split based on the use of the period character.
+ *
+ * For example:
+ *
+ * ```javascript
+ * const source = {
+ *   lives: 3,
+ *   render: {
+ *     screen: {
+ *       width: 1024
+ *     }
+ *   }
+ * }
+ *
+ * const lives = GetValue(source, 'lives', 1);
+ * const width = GetValue(source, 'render.screen.width', 800);
+ * const height = GetValue(source, 'render.screen.height', 600);
+ * ```
+ *
+ * In the code above, `lives` will be 3 because it's defined at the top level of `source`.
+ * The `width` value will be 1024 because it can be found inside the `render.screen` object.
+ * The `height` value will be 600, the default value, because it is missing from the `render.screen` object.
  *
  * @function Phaser.Utils.Objects.GetValue
  * @since 3.0.0
  *
- * @param {object} source - The object to retrieve the value from.
+ * @param {object} source - The primary object to try to retrieve the value from. If not found in here, `altSource` is checked.
  * @param {string} key - The name of the property to retrieve from the object. If a property is nested, the names of its preceding properties should be separated by a dot (`.`) - `banner.hideBanner` would return the value of the `hideBanner` property from the object stored in the `banner` property of the `source` object.
  * @param {*} defaultValue - The value to return if the `key` isn't found in the `source` object.
+ * @param {object} [altSource] - An alternative object to retrieve the value from. If the property exists in `source` then `altSource` will not be used.
  *
  * @return {*} The value of the requested key.
  */
-var GetValue = function (source, key, defaultValue)
+var GetValue = function (source, key, defaultValue, altSource)
 {
-    if (!source || typeof source === 'number')
+    if ((!source && !altSource) || typeof source === 'number')
     {
         return defaultValue;
     }
-    else if (source.hasOwnProperty(key))
+    else if (source && source.hasOwnProperty(key))
     {
         return source[key];
     }
+    else if (altSource && altSource.hasOwnProperty(key))
+    {
+        return altSource[key];
+    }
     else if (key.indexOf('.') !== -1)
     {
         var keys = key.split('.');
-        var parent = source;
+        var parentA = source;
+        var parentB = altSource;
         var value = defaultValue;
 
         //  Use for loop here so we can break early
         for (var i = 0; i < keys.length; i++)
         {
-            if (parent.hasOwnProperty(keys[i]))
+            if (parentA && parentA.hasOwnProperty(keys[i]))
             {
-                //  Yes it has a key property, let's carry on down
-                value = parent[keys[i]];
+                //  Yes parentA has a key property, let's carry on down
+                value = parentA[keys[i]];
 
-                parent = parent[keys[i]];
+                parentA = parentA[keys[i]];
+            }
+            else if (parentB && parentB.hasOwnProperty(keys[i]))
+            {
+                //  Yes parentB has a key property, let's carry on down
+                value = parentB[keys[i]];
+
+                parentB = parentB[keys[i]];
             }
             else
             {